aboutsummaryrefslogtreecommitdiff
diff options
context:
space:
mode:
authorXpl0itR <xpl0itr@outlook.com>2019-09-02 17:03:57 +0100
committergdkchan <gab.dark.100@gmail.com>2019-09-02 13:03:57 -0300
commitedafce57be287c49791e708cb6f78b6f3fec1f2a (patch)
tree73a36b3b6e35d4eda80a788accbebc6710e3a485
parentc00c638ecc2c7266a19e49fe4427ce840a333f55 (diff)
Added GUI to Ryujinx (#695)
* Added GUI to Ryujinx * Updated to use Glade Also added scrollbar and default dark theme * Added support for loading icon from .nro files and cleaned up the code a bit * Added General Settings Menu (read-only for now) and moved some functionality from MainMenu.cs to ApplicationLibrary.cs * Added custom GUI theme support and changed the defualt theme to one I just wrote * Added GTK to process path, fixed a bug and minor edits * some more edits and a bug fix * general settings menu is now fully functional. also fixed the bug where ryujinx crashes when it trys to load an invalid gamedir * big rewrite * aesthetic changes to General Settings menu * Added Control Settings one day done feature :P * minor changes * 1st wave of changes * 2nd wave of changes * 3rd wave of changes * Cleanup settings ui * minor edits * new about window added, still needs styling * added spin button for new option and tooltips to settings * Game icons and names are now shown in the games list * add nuget package which contains gtk dependencies * requested changes have been changed * put CreateGameWindow on a new thread and stopped destroying the main menu when a game loads * fixed bug that allowed a user to attempt to load multiple games at a time which causes a crash * Added LastPlayed and TimePlayed columns to the game list * Did some testing and fixed some bugs Im not happy with one of the fixes so i will do it properly an upcoming commit * did some more bug testing and fixed another 2 bugs * caught an exception when ryujinx tries to load non-homebrew as homebrew * Large changes Rewrote ApplicationLibrary.cs (added comments too) so any devs reading it wont get eye cancer, also its probably more efficient now. Added 2 new columns (Developer name and application version) to the game list and wrote the logic for it. Ryujinx now loads NRO's TitleName and TitleID from the NACP file instead of the default NPDM. I also killed a lot of bugs * Moved Files moved ApplicationLibrary.cs to Ryujinx.HLE as that is a better place for it. Moved contents of GUI folder to Ui folder and changed the namespaces of the gui files from Ryujinx to Ryujinx.Ui * Added 'Open Ryujinx Folder' button to the file menu and did some small fixes * New features * updated nuget package with missing dlls and changed emmauss' requested changes * fixed some minor issues * all requested changes marked as resolved have been changed * gdkchan's requested changes * fixed an issue with settings window getting chopped on small res * fixed 2 problems caused by rebase * changed the default theme * applied Thog's patch to fix issue on linux * fixed issue caused by rebase * added update check button that runs ryujinx-updater * reads version info from installer and displays it in about menu * changes completed * requested changes changed * fixed issue with default theme * fixed a bug and completed requested changes * added more tooltips and changed some text
-rw-r--r--Ryujinx.HLE/FileSystem/SaveHelper.cs2
-rw-r--r--Ryujinx.HLE/FileSystem/SaveInfo.cs4
-rw-r--r--Ryujinx.HLE/FileSystem/VirtualFileSystem.cs4
-rw-r--r--Ryujinx.HLE/HOS/Horizon.cs53
-rw-r--r--Ryujinx.HLE/HOS/Kernel/Process/KProcess.cs4
-rw-r--r--Ryujinx.HLE/HOS/Kernel/Process/ProcessCreationInfo.cs6
-rw-r--r--Ryujinx.HLE/HOS/Kernel/SupervisorCall/SvcSystem.cs2
-rw-r--r--Ryujinx.HLE/HOS/Services/FspSrv/IFileSystemProxy.cs2
-rw-r--r--Ryujinx.HLE/HOS/SystemState/SystemStateMgr.cs2
-rw-r--r--Ryujinx.HLE/Loaders/Executables/KernelInitialProcess.cs4
-rw-r--r--Ryujinx.HLE/Loaders/Npdm/ACI0.cs4
-rw-r--r--Ryujinx.HLE/Loaders/Npdm/Npdm.cs2
-rw-r--r--Ryujinx.sln10
-rw-r--r--Ryujinx/Config.json (renamed from Ryujinx/Config.jsonc)73
-rw-r--r--Ryujinx/Configuration.cs151
-rw-r--r--Ryujinx/Program.cs176
-rw-r--r--Ryujinx/RPsupported.dat9
-rw-r--r--Ryujinx/Ryujinx.csproj25
-rw-r--r--Ryujinx/Theme.css4054
-rw-r--r--Ryujinx/Ui/AboutWindow.cs116
-rw-r--r--Ryujinx/Ui/AboutWindow.glade574
-rw-r--r--Ryujinx/Ui/ApplicationLibrary.cs450
-rw-r--r--Ryujinx/Ui/GLScreen.cs2
-rw-r--r--Ryujinx/Ui/MainWindow.cs601
-rw-r--r--Ryujinx/Ui/MainWindow.glade347
-rw-r--r--Ryujinx/Ui/NpadKeyboard.cs4
-rw-r--r--Ryujinx/Ui/SwitchSettings.cs424
-rw-r--r--Ryujinx/Ui/SwitchSettings.glade1989
-rw-r--r--Ryujinx/Ui/assets/DiscordLogo.pngbin0 -> 5216 bytes
-rw-r--r--Ryujinx/Ui/assets/GitHubLogo.pngbin0 -> 4044 bytes
-rw-r--r--Ryujinx/Ui/assets/JoyCon.pngbin0 -> 288310 bytes
-rw-r--r--Ryujinx/Ui/assets/PatreonLogo.pngbin0 -> 5899 bytes
-rw-r--r--Ryujinx/Ui/assets/TwitterLogo.pngbin0 -> 8012 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxIcon.pngbin0 -> 53785 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxNCAIcon.pngbin0 -> 13675 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxNROIcon.pngbin0 -> 13902 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxNSOIcon.pngbin0 -> 13948 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxNSPIcon.pngbin0 -> 13198 bytes
-rw-r--r--Ryujinx/Ui/assets/ryujinxXCIIcon.pngbin0 -> 13093 bytes
-rw-r--r--Ryujinx/_schema.json32
40 files changed, 8807 insertions, 319 deletions
diff --git a/Ryujinx.HLE/FileSystem/SaveHelper.cs b/Ryujinx.HLE/FileSystem/SaveHelper.cs
index 411d13e2..51400458 100644
--- a/Ryujinx.HLE/FileSystem/SaveHelper.cs
+++ b/Ryujinx.HLE/FileSystem/SaveHelper.cs
@@ -10,7 +10,7 @@ namespace Ryujinx.HLE.FileSystem
public static string GetSavePath(SaveInfo saveMetaData, ServiceCtx context)
{
string baseSavePath = NandPath;
- long currentTitleId = saveMetaData.TitleId;
+ ulong currentTitleId = saveMetaData.TitleId;
switch (saveMetaData.SaveSpaceId)
{
diff --git a/Ryujinx.HLE/FileSystem/SaveInfo.cs b/Ryujinx.HLE/FileSystem/SaveInfo.cs
index db7f6765..8685e6ca 100644
--- a/Ryujinx.HLE/FileSystem/SaveInfo.cs
+++ b/Ryujinx.HLE/FileSystem/SaveInfo.cs
@@ -4,7 +4,7 @@ namespace Ryujinx.HLE.FileSystem
{
struct SaveInfo
{
- public long TitleId { get; private set; }
+ public ulong TitleId { get; private set; }
public long SaveId { get; private set; }
public UInt128 UserId { get; private set; }
@@ -12,7 +12,7 @@ namespace Ryujinx.HLE.FileSystem
public SaveSpaceId SaveSpaceId { get; private set; }
public SaveInfo(
- long titleId,
+ ulong titleId,
long saveId,
SaveDataType saveDataType,
UInt128 userId,
diff --git a/Ryujinx.HLE/FileSystem/VirtualFileSystem.cs b/Ryujinx.HLE/FileSystem/VirtualFileSystem.cs
index eed5953f..e71fc27f 100644
--- a/Ryujinx.HLE/FileSystem/VirtualFileSystem.cs
+++ b/Ryujinx.HLE/FileSystem/VirtualFileSystem.cs
@@ -5,7 +5,7 @@ using System.IO;
namespace Ryujinx.HLE.FileSystem
{
- class VirtualFileSystem : IDisposable
+ public class VirtualFileSystem : IDisposable
{
public const string BasePath = "RyuFs";
public const string NandPath = "nand";
@@ -60,7 +60,7 @@ namespace Ryujinx.HLE.FileSystem
public string GetSystemPath() => MakeDirAndGetFullPath(SystemPath);
- public string GetGameSavePath(SaveInfo save, ServiceCtx context)
+ internal string GetGameSavePath(SaveInfo save, ServiceCtx context)
{
return MakeDirAndGetFullPath(SaveHelper.GetSavePath(save, context));
}
diff --git a/Ryujinx.HLE/HOS/Horizon.cs b/Ryujinx.HLE/HOS/Horizon.cs
index 5873223e..334cba12 100644
--- a/Ryujinx.HLE/HOS/Horizon.cs
+++ b/Ryujinx.HLE/HOS/Horizon.cs
@@ -94,7 +94,7 @@ namespace Ryujinx.HLE.HOS
internal KEvent VsyncEvent { get; private set; }
- internal Keyset KeySet { get; private set; }
+ public Keyset KeySet { get; private set; }
private bool _hasStarted;
@@ -453,9 +453,7 @@ namespace Ryujinx.HLE.HOS
Nacp controlData = new Nacp(controlFile.AsStream());
TitleName = CurrentTitle = controlData.Descriptions[(int)State.DesiredTitleLanguage].Title;
- TitleID = metaData.Aci0.TitleId.ToString("x16");
-
- CurrentTitle = controlData.Descriptions[(int)State.DesiredTitleLanguage].Title;
+ TitleID = metaData.Aci0.TitleId.ToString("x16");
if (string.IsNullOrWhiteSpace(CurrentTitle))
{
@@ -551,18 +549,51 @@ namespace Ryujinx.HLE.HOS
if (asetVersion == 0)
{
ulong iconOffset = reader.ReadUInt64();
- ulong iconSize = reader.ReadUInt64();
+ ulong iconSize = reader.ReadUInt64();
ulong nacpOffset = reader.ReadUInt64();
- ulong nacpSize = reader.ReadUInt64();
+ ulong nacpSize = reader.ReadUInt64();
ulong romfsOffset = reader.ReadUInt64();
- ulong romfsSize = reader.ReadUInt64();
+ ulong romfsSize = reader.ReadUInt64();
if (romfsSize != 0)
{
Device.FileSystem.SetRomFs(new HomebrewRomFsStream(input, obj.FileSize + (long)romfsOffset));
}
+
+ if (nacpSize != 0)
+ {
+ input.Seek(obj.FileSize + (long)nacpOffset, SeekOrigin.Begin);
+ using (MemoryStream stream = new MemoryStream(reader.ReadBytes((int)nacpSize)))
+ {
+ ControlData = new Nacp(stream);
+ }
+
+ metaData.TitleName = ControlData.Descriptions[(int)State.DesiredTitleLanguage].Title;
+
+ if (string.IsNullOrWhiteSpace(metaData.TitleName))
+ {
+ metaData.TitleName = ControlData.Descriptions.ToList().Find(x => !string.IsNullOrWhiteSpace(x.Title)).Title;
+ }
+
+ metaData.Aci0.TitleId = ControlData.PresenceGroupId;
+
+ if (metaData.Aci0.TitleId == 0)
+ {
+ metaData.Aci0.TitleId = ControlData.SaveDataOwnerId;
+ }
+
+ if (metaData.Aci0.TitleId == 0)
+ {
+ metaData.Aci0.TitleId = ControlData.AddOnContentBaseId - 0x1000;
+ }
+
+ if (metaData.Aci0.TitleId.ToString("x16") == "fffffffffffff000")
+ {
+ metaData.Aci0.TitleId = 0000000000000000;
+ }
+ }
}
else
{
@@ -578,8 +609,8 @@ namespace Ryujinx.HLE.HOS
ContentManager.LoadEntries();
- TitleID = CurrentTitle = metaData.Aci0.TitleId.ToString("x16");
- TitleName = metaData.TitleName;
+ TitleName = CurrentTitle = metaData.TitleName;
+ TitleID = metaData.Aci0.TitleId.ToString("x16");
ProgramLoader.LoadStaticObjects(this, metaData, new IExecutable[] { staticObject });
}
@@ -687,7 +718,9 @@ namespace Ryujinx.HLE.HOS
// It's only safe to release resources once all threads
// have exited.
ThreadCounter.Signal();
- ThreadCounter.Wait();
+ //ThreadCounter.Wait(); // FIXME: Uncomment this
+ // BODY: Right now, guest processes don't exit properly because the logic waits for them to exit.
+ // BODY: However, this doesn't happen when you close the main window so we need to find a way to make them exit gracefully
Scheduler.Dispose();
diff --git a/Ryujinx.HLE/HOS/Kernel/Process/KProcess.cs b/Ryujinx.HLE/HOS/Kernel/Process/KProcess.cs
index beb376f6..c6283afd 100644
--- a/Ryujinx.HLE/HOS/Kernel/Process/KProcess.cs
+++ b/Ryujinx.HLE/HOS/Kernel/Process/KProcess.cs
@@ -60,8 +60,8 @@ namespace Ryujinx.HLE.HOS.Kernel.Process
public KProcessCapabilities Capabilities { get; private set; }
- public long TitleId { get; private set; }
- public long Pid { get; private set; }
+ public ulong TitleId { get; private set; }
+ public long Pid { get; private set; }
private long _creationTimestamp;
private ulong _entrypoint;
diff --git a/Ryujinx.HLE/HOS/Kernel/Process/ProcessCreationInfo.cs b/Ryujinx.HLE/HOS/Kernel/Process/ProcessCreationInfo.cs
index ba9f54bf..7431d7dd 100644
--- a/Ryujinx.HLE/HOS/Kernel/Process/ProcessCreationInfo.cs
+++ b/Ryujinx.HLE/HOS/Kernel/Process/ProcessCreationInfo.cs
@@ -4,8 +4,8 @@ namespace Ryujinx.HLE.HOS.Kernel.Process
{
public string Name { get; private set; }
- public int Category { get; private set; }
- public long TitleId { get; private set; }
+ public int Category { get; private set; }
+ public ulong TitleId { get; private set; }
public ulong CodeAddress { get; private set; }
public int CodePagesCount { get; private set; }
@@ -17,7 +17,7 @@ namespace Ryujinx.HLE.HOS.Kernel.Process
public ProcessCreationInfo(
string name,
int category,
- long titleId,
+ ulong titleId,
ulong codeAddress,
int codePagesCount,
int mmuFlags,
diff --git a/Ryujinx.HLE/HOS/Kernel/SupervisorCall/SvcSystem.cs b/Ryujinx.HLE/HOS/Kernel/SupervisorCall/SvcSystem.cs
index 094e1935..6525628f 100644
--- a/Ryujinx.HLE/HOS/Kernel/SupervisorCall/SvcSystem.cs
+++ b/Ryujinx.HLE/HOS/Kernel/SupervisorCall/SvcSystem.cs
@@ -285,7 +285,7 @@ namespace Ryujinx.HLE.HOS.Kernel.SupervisorCall
break;
- case 18: value = process.TitleId; break;
+ case 18: value = (long)process.TitleId; break;
case 20: value = (long)process.UserExceptionContextAddress; break;
diff --git a/Ryujinx.HLE/HOS/Services/FspSrv/IFileSystemProxy.cs b/Ryujinx.HLE/HOS/Services/FspSrv/IFileSystemProxy.cs
index 16bfc00e..ab425cff 100644
--- a/Ryujinx.HLE/HOS/Services/FspSrv/IFileSystemProxy.cs
+++ b/Ryujinx.HLE/HOS/Services/FspSrv/IFileSystemProxy.cs
@@ -225,7 +225,7 @@ namespace Ryujinx.HLE.HOS.Services.FspSrv
{
SaveSpaceId saveSpaceId = (SaveSpaceId)context.RequestData.ReadInt64();
- long titleId = context.RequestData.ReadInt64();
+ ulong titleId = context.RequestData.ReadUInt64();
UInt128 userId = context.RequestData.ReadStruct<UInt128>();
diff --git a/Ryujinx.HLE/HOS/SystemState/SystemStateMgr.cs b/Ryujinx.HLE/HOS/SystemState/SystemStateMgr.cs
index 36775b07..97fa1d74 100644
--- a/Ryujinx.HLE/HOS/SystemState/SystemStateMgr.cs
+++ b/Ryujinx.HLE/HOS/SystemState/SystemStateMgr.cs
@@ -40,8 +40,6 @@ namespace Ryujinx.HLE.HOS.SystemState
internal string ActiveAudioOutput { get; private set; }
- public bool DiscordIntegrationEnabled { get; set; }
-
public bool DockedMode { get; set; }
public ColorSet ThemeColor { get; set; }
diff --git a/Ryujinx.HLE/Loaders/Executables/KernelInitialProcess.cs b/Ryujinx.HLE/Loaders/Executables/KernelInitialProcess.cs
index af57cf2d..d6a1cb66 100644
--- a/Ryujinx.HLE/Loaders/Executables/KernelInitialProcess.cs
+++ b/Ryujinx.HLE/Loaders/Executables/KernelInitialProcess.cs
@@ -7,7 +7,7 @@ namespace Ryujinx.HLE.Loaders.Executables
{
public string Name { get; private set; }
- public long TitleId { get; private set; }
+ public ulong TitleId { get; private set; }
public int ProcessCategory { get; private set; }
@@ -65,7 +65,7 @@ namespace Ryujinx.HLE.Loaders.Executables
Name = ReadString(reader, 12);
- TitleId = reader.ReadInt64();
+ TitleId = reader.ReadUInt64();
ProcessCategory = reader.ReadInt32();
diff --git a/Ryujinx.HLE/Loaders/Npdm/ACI0.cs b/Ryujinx.HLE/Loaders/Npdm/ACI0.cs
index af426bcf..8350acf7 100644
--- a/Ryujinx.HLE/Loaders/Npdm/ACI0.cs
+++ b/Ryujinx.HLE/Loaders/Npdm/ACI0.cs
@@ -7,7 +7,7 @@ namespace Ryujinx.HLE.Loaders.Npdm
{
private const int Aci0Magic = 'A' << 0 | 'C' << 8 | 'I' << 16 | '0' << 24;
- public long TitleId { get; private set; }
+ public ulong TitleId { get; set; }
public int FsVersion { get; private set; }
public ulong FsPermissionsBitmask { get; private set; }
@@ -28,7 +28,7 @@ namespace Ryujinx.HLE.Loaders.Npdm
stream.Seek(0xc, SeekOrigin.Current);
- TitleId = reader.ReadInt64();
+ TitleId = reader.ReadUInt64();
// Reserved.
stream.Seek(8, SeekOrigin.Current);
diff --git a/Ryujinx.HLE/Loaders/Npdm/Npdm.cs b/Ryujinx.HLE/Loaders/Npdm/Npdm.cs
index 36449e40..169e68da 100644
--- a/Ryujinx.HLE/Loaders/Npdm/Npdm.cs
+++ b/Ryujinx.HLE/Loaders/Npdm/Npdm.cs
@@ -18,7 +18,7 @@ namespace Ryujinx.HLE.Loaders.Npdm
public int PersonalMmHeapSize { get; private set; }
public int ProcessCategory { get; private set; }
public int MainThreadStackSize { get; private set; }
- public string TitleName { get; private set; }
+ public string TitleName { get; set; }
public byte[] ProductCode { get; private set; }
public Aci0 Aci0 { get; private set; }
diff --git a/Ryujinx.sln b/Ryujinx.sln
index 8177f861..18df571b 100644
--- a/Ryujinx.sln
+++ b/Ryujinx.sln
@@ -28,7 +28,7 @@ Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "Ryujinx.Common", "Ryujinx.C
EndProject
Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "Ryujinx.Profiler", "Ryujinx.Profiler\Ryujinx.Profiler.csproj", "{4E69B67F-8CA7-42CF-A9E1-CCB0915DFB34}"
EndProject
-Project("{FAE04EC0-301F-11D3-BF4B-00C04F79EFBC}") = "ARMeilleure", "ARMeilleure\ARMeilleure.csproj", "{ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}"
+Project("{9A19103F-16F7-4668-BE54-9A1E7A4F7556}") = "ARMeilleure", "ARMeilleure\ARMeilleure.csproj", "{ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}"
EndProject
Global
GlobalSection(SolutionConfigurationPlatforms) = preSolution
@@ -126,6 +126,14 @@ Global
{4E69B67F-8CA7-42CF-A9E1-CCB0915DFB34}.Profile Release|Any CPU.Build.0 = Profile Release|Any CPU
{4E69B67F-8CA7-42CF-A9E1-CCB0915DFB34}.Release|Any CPU.ActiveCfg = Release|Any CPU
{4E69B67F-8CA7-42CF-A9E1-CCB0915DFB34}.Release|Any CPU.Build.0 = Release|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Debug|Any CPU.Build.0 = Debug|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Profile Debug|Any CPU.ActiveCfg = Debug|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Profile Debug|Any CPU.Build.0 = Debug|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Profile Release|Any CPU.ActiveCfg = Release|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Profile Release|Any CPU.Build.0 = Release|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Release|Any CPU.ActiveCfg = Release|Any CPU
+ {ABF09A5E-2D8B-4B6F-A51D-5CE414DDB15A}.Release|Any CPU.Build.0 = Release|Any CPU
EndGlobalSection
GlobalSection(SolutionProperties) = preSolution
HideSolutionNode = FALSE
diff --git a/Ryujinx/Config.jsonc b/Ryujinx/Config.json
index 2acb7f38..d6ed189a 100644
--- a/Ryujinx/Config.jsonc
+++ b/Ryujinx/Config.json
@@ -1,75 +1,28 @@
{
- "$schema": "./_schema.json",
-
- // Dump shaders in local directory (e.g. `C:\ShaderDumps`)
"graphics_shaders_dump_path": "",
-
- // Enable printing debug logs
"logging_enable_debug": false,
-
- // Enable printing stubbed calls logs
"logging_enable_stub": true,
-
- // Enable printing information logs
"logging_enable_info": true,
-
- // Enable printing warning logs
"logging_enable_warn": true,
-
- // Enable printing error logs
"logging_enable_error": true,
-
- // Enable printing guest logs
"logging_enable_guest": true,
-
- // Enable printing FS access logs. fs_global_access_log_mode must be 2 or 3
"logging_enable_fs_access_log": false,
-
- // Filtered log classes, in a JSON array, eg. `[ "Loader", "ServiceFs" ]`
"logging_filtered_classes": [ ],
-
- // Enable file logging
"enable_file_log": true,
-
- // Change System Language
- // System Language list: https://gist.github.com/HorrorTroll/b6e4a88d774c3c9b3bdf54d79a7ca43b
"system_language": "AmericanEnglish",
-
- // Enable or disable Docked Mode
"docked_mode": false,
-
- // Enable or disable Discord Rich Presence
"enable_discord_integration": true,
-
- // Enable or disable Game Vsync
"enable_vsync": true,
-
- // Enable or disable Multi-core scheduling of threads
"enable_multicore_scheduling": true,
-
- // Enable integrity checks on Switch content files
"enable_fs_integrity_checks": true,
-
- // Sets the "GlobalAccessLogMode". Possible modes are 0-3
- "fs_global_access_log_mode": 0,
-
- // Use old ChocolArm64 ARM emulator
"enable_legacy_jit": false,
-
- // Enable or disable ignoring missing services, this may cause instability
"ignore_missing_services": false,
-
- // The primary controller's type
- // Supported Values: Handheld, ProController, NpadPair, NpadLeft, NpadRight
"controller_type": "Handheld",
-
- // Enable or disable "direct keyboard access (HID) support" (Provides games access to your keyboard as a text entry device).
- "enable_keyboard": false,
-
- // Keyboard Controls
- // https://github.com/opentk/opentk/blob/master/src/OpenTK/Input/Key.cs
+ "gui_columns": [ true, true, true, true, true, true, true, true, true ],
+ "game_dirs": [],
+ "enable_custom_theme": false,
+ "custom_theme_path": "",
"keyboard_controls": {
- // Left JoyCon Keyboard Bindings
"left_joycon": {
"stick_up": "W",
"stick_down": "S",
@@ -84,8 +37,6 @@
"button_l": "E",
"button_zl": "Q"
},
-
- // Right JoyCon Keyboard Bindings
"right_joycon": {
"stick_up": "I",
"stick_down": "K",
@@ -100,27 +51,15 @@
"button_r": "U",
"button_zr": "O"
},
-
"hotkeys": {
"toggle_vsync": "Tab"
}
},
-
- // Controller Controls
- "joystick_controls": {
- // Whether or not to enable Controller support
+ "joystick_controls": {
"enabled": true,
-
- // Controller Device Index
"index": 0,
-
- // Controller Analog Stick Deadzone
"deadzone": 0.05,
-
- // The value of how pressed down each trigger has to be in order to register a button press
"trigger_threshold": 0.5,
-
- // Left JoyCon Controller Bindings
"left_joycon": {
"stick": "Axis0",
"stick_button": "Button13",
@@ -132,8 +71,6 @@
"button_l": "Button6",
"button_zl": "Button8"
},
-
- // Right JoyCon Controller Bindings
"right_joycon": {
"stick": "Axis2",
"stick_button": "Button14",
diff --git a/Ryujinx/Configuration.cs b/Ryujinx/Configuration.cs
index 7c918205..53560521 100644
--- a/Ryujinx/Configuration.cs
+++ b/Ryujinx/Configuration.cs
@@ -1,4 +1,4 @@
-using ARMeilleure;
+using JsonPrettyPrinterPlus;
using LibHac.Fs;
using OpenTK.Input;
using Ryujinx.Common;
@@ -7,9 +7,12 @@ using Ryujinx.HLE;
using Ryujinx.HLE.HOS.SystemState;
using Ryujinx.HLE.HOS.Services;
using Ryujinx.HLE.Input;
+using Ryujinx.UI;
using Ryujinx.UI.Input;
using System;
+using System.Collections.Generic;
using System.IO;
+using System.Text;
using System.Threading.Tasks;
using Utf8Json;
using Utf8Json.Resolvers;
@@ -26,112 +29,132 @@ namespace Ryujinx
/// <summary>
/// Dumps shaders in this local directory
/// </summary>
- public string GraphicsShadersDumpPath { get; private set; }
+ public string GraphicsShadersDumpPath { get; set; }
/// <summary>
/// Enables printing debug log messages
/// </summary>
- public bool LoggingEnableDebug { get; private set; }
+ public bool LoggingEnableDebug { get; set; }
/// <summary>
/// Enables printing stub log messages
/// </summary>
- public bool LoggingEnableStub { get; private set; }
+ public bool LoggingEnableStub { get; set; }
/// <summary>
/// Enables printing info log messages
/// </summary>
- public bool LoggingEnableInfo { get; private set; }
+ public bool LoggingEnableInfo { get; set; }
/// <summary>
/// Enables printing warning log messages
/// </summary>
- public bool LoggingEnableWarn { get; private set; }
+ public bool LoggingEnableWarn { get; set; }
/// <summary>
/// Enables printing error log messages
/// </summary>
- public bool LoggingEnableError { get; private set; }
+ public bool LoggingEnableError { get; set; }
/// <summary>
/// Enables printing guest log messages
/// </summary>
- public bool LoggingEnableGuest { get; private set; }
+ public bool LoggingEnableGuest { get; set; }
/// <summary>
/// Enables printing FS access log messages
/// </summary>
- public bool LoggingEnableFsAccessLog { get; private set; }
+ public bool LoggingEnableFsAccessLog { get; set; }
/// <summary>
/// Controls which log messages are written to the log targets
/// </summary>
- public LogClass[] LoggingFilteredClasses { get; private set; }
+ public LogClass[] LoggingFilteredClasses { get; set; }
/// <summary>
/// Enables or disables logging to a file on disk
/// </summary>
- public bool EnableFileLog { get; private set; }
+ public bool EnableFileLog { get; set; }
/// <summary>
/// Change System Language
/// </summary>
- public SystemLanguage SystemLanguage { get; private set; }
+ public SystemLanguage SystemLanguage { get; set; }
/// <summary>
/// Enables or disables Docked Mode
/// </summary>
- public bool DockedMode { get; private set; }
+ public bool DockedMode { get; set; }
/// <summary>
/// Enables or disables Discord Rich Presence
/// </summary>
- public bool EnableDiscordIntegration { get; private set; }
+ public bool EnableDiscordIntegration { get; set; }
/// <summary>
/// Enables or disables Vertical Sync
/// </summary>
- public bool EnableVsync { get; private set; }
+ public bool EnableVsync { get; set; }
/// <summary>
/// Enables or disables multi-core scheduling of threads
/// </summary>
- public bool EnableMulticoreScheduling { get; private set; }
+ public bool EnableMulticoreScheduling { get; set; }
/// <summary>
/// Enables integrity checks on Game content files
/// </summary>
- public bool EnableFsIntegrityChecks { get; private set; }
+ public bool EnableFsIntegrityChecks { get; set; }
/// <summary>
/// Enables FS access log output to the console. Possible modes are 0-3
/// </summary>
- public int FsGlobalAccessLogMode { get; private set; }
+ public int FsGlobalAccessLogMode { get; set; }
/// <summary>
/// Use old ChocolArm64 ARM emulator
/// </summary>
- public bool EnableLegacyJit { get; private set; }
+ public bool EnableLegacyJit { get; set; }
/// <summary>
/// Enable or disable ignoring missing services
/// </summary>
- public bool IgnoreMissingServices { get; private set; }
+ public bool IgnoreMissingServices { get; set; }
/// <summary>
/// The primary controller's type
/// </summary>
- public ControllerStatus ControllerType { get; private set; }
+ public ControllerStatus ControllerType { get; set; }
+
+ /// <summary>
+ /// Used to toggle columns in the GUI
+ /// </summary>
+ public List<bool> GuiColumns { get; set; }
+
+ /// <summary>
+ /// A list of directories containing games to be used to load games into the games list
+ /// </summary>
+ public List<string> GameDirs { get; set; }
+
+ /// <summary>
+ /// Enable or disable custom themes in the GUI
+ /// </summary>
+ public bool EnableCustomTheme { get; set; }
+
+ /// <summary>
+ /// Path to custom GUI theme
+ /// </summary>
+ public string CustomThemePath { get; set; }
/// <summary>
/// Enable or disable keyboard support (Independent from controllers binding)
/// </summary>
- public bool EnableKeyboard { get; private set; }
+ public bool EnableKeyboard { get; set; }
/// <summary>
/// Keyboard control bindings
/// </summary>
- public NpadKeyboard KeyboardControls { get; private set; }
+ public NpadKeyboard KeyboardControls { get; set; }
/// <summary>
/// Controller control bindings
@@ -161,8 +184,8 @@ namespace Ryujinx
/// <param name="path">The path to the JSON configuration file</param>
public static async Task LoadAsync(string path)
{
- var resolver = CompositeResolver.Create(
- new[] { new ConfigurationEnumFormatter<Key>() },
+ IJsonFormatterResolver resolver = CompositeResolver.Create(
+ new[] { new ConfigurationEnumFormatter<Key>() },
new[] { StandardResolver.AllowPrivateSnakeCase }
);
@@ -173,17 +196,32 @@ namespace Ryujinx
}
/// <summary>
+ /// Save a configuration file to disk
+ /// </summary>
+ /// <param name="path">The path to the JSON configuration file</param>
+ public static void SaveConfig(Configuration config, string path)
+ {
+ IJsonFormatterResolver resolver = CompositeResolver.Create(
+ new[] { new ConfigurationEnumFormatter<Key>() },
+ new[] { StandardResolver.AllowPrivateSnakeCase }
+ );
+
+ byte[] data = JsonSerializer.Serialize(config, resolver);
+ File.WriteAllText(path, Encoding.UTF8.GetString(data, 0, data.Length).PrettyPrintJson());
+ }
+
+ /// <summary>
/// Configures a <see cref="Switch"/> instance
/// </summary>
/// <param name="device">The instance to configure</param>
- public static void Configure(Switch device)
+ public static void InitialConfigure(Switch device)
{
if (Instance == null)
{
throw new InvalidOperationException("Configuration has not been loaded yet.");
}
- GraphicsConfig.ShadersDumpPath = Instance.GraphicsShadersDumpPath;
+ SwitchSettings.ConfigureSettings(Instance);
Logger.AddTarget(new AsyncLogTargetWrapper(
new ConsoleLogTarget(),
@@ -194,65 +232,74 @@ namespace Ryujinx
if (Instance.EnableFileLog)
{
Logger.AddTarget(new AsyncLogTargetWrapper(
- new FileLogTarget(Path.Combine(Program.ApplicationDirectory, "Ryujinx.log")),
+ new FileLogTarget(Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Ryujinx.log")),
1000,
AsyncLogTargetOverflowAction.Block
));
}
- Logger.SetEnable(LogLevel.Debug, Instance.LoggingEnableDebug);
- Logger.SetEnable(LogLevel.Stub, Instance.LoggingEnableStub);
- Logger.SetEnable(LogLevel.Info, Instance.LoggingEnableInfo);
- Logger.SetEnable(LogLevel.Warning, Instance.LoggingEnableWarn);
- Logger.SetEnable(LogLevel.Error, Instance.LoggingEnableError);
- Logger.SetEnable(LogLevel.Guest, Instance.LoggingEnableGuest);
- Logger.SetEnable(LogLevel.AccessLog, Instance.LoggingEnableFsAccessLog);
+ Configure(device, Instance);
+ }
+
+ public static void Configure(Switch device, Configuration SwitchConfig)
+ {
+ GraphicsConfig.ShadersDumpPath = SwitchConfig.GraphicsShadersDumpPath;
+
+ Logger.SetEnable(LogLevel.Debug, SwitchConfig.LoggingEnableDebug );
+ Logger.SetEnable(LogLevel.Stub, SwitchConfig.LoggingEnableStub );
+ Logger.SetEnable(LogLevel.Info, SwitchConfig.LoggingEnableInfo );
+ Logger.SetEnable(LogLevel.Warning, SwitchConfig.LoggingEnableWarn );
+ Logger.SetEnable(LogLevel.Error, SwitchConfig.LoggingEnableError );
+ Logger.SetEnable(LogLevel.Guest, SwitchConfig.LoggingEnableGuest );
+ Logger.SetEnable(LogLevel.AccessLog, SwitchConfig.LoggingEnableFsAccessLog);
- if (Instance.LoggingFilteredClasses.Length > 0)
+ if (SwitchConfig.LoggingFilteredClasses.Length > 0)
{
foreach (var logClass in EnumExtensions.GetValues<LogClass>())
{
Logger.SetEnable(logClass, false);
}
- foreach (var logClass in Instance.LoggingFilteredClasses)
+ foreach (var logClass in SwitchConfig.LoggingFilteredClasses)
{
Logger.SetEnable(logClass, true);
}
}
- device.System.State.DiscordIntegrationEnabled = Instance.EnableDiscordIntegration;
+ MainWindow.DiscordIntegrationEnabled = SwitchConfig.EnableDiscordIntegration;
- device.EnableDeviceVsync = Instance.EnableVsync;
+ device.EnableDeviceVsync = SwitchConfig.EnableVsync;
- device.System.State.DockedMode = Instance.DockedMode;
+ device.System.State.DockedMode = SwitchConfig.DockedMode;
- device.System.State.SetLanguage(Instance.SystemLanguage);
+ device.System.State.SetLanguage(SwitchConfig.SystemLanguage);
- if (Instance.EnableMulticoreScheduling)
+ if (SwitchConfig.EnableMulticoreScheduling)
{
device.System.EnableMultiCoreScheduling();
}
- device.System.FsIntegrityCheckLevel = Instance.EnableFsIntegrityChecks
+ device.System.FsIntegrityCheckLevel = SwitchConfig.EnableFsIntegrityChecks
? IntegrityCheckLevel.ErrorOnInvalid
: IntegrityCheckLevel.None;
- device.System.GlobalAccessLogMode = Instance.FsGlobalAccessLogMode;
+ device.System.GlobalAccessLogMode = SwitchConfig.FsGlobalAccessLogMode;
- device.System.UseLegacyJit = Instance.EnableLegacyJit;
+ device.System.UseLegacyJit = SwitchConfig.EnableLegacyJit;
- ServiceConfiguration.IgnoreMissingServices = Instance.IgnoreMissingServices;
-
- if (Instance.JoystickControls.Enabled)
+ ServiceConfiguration.IgnoreMissingServices = SwitchConfig.IgnoreMissingServices;
+ }
+
+ public static void ConfigureHid(Switch device, Configuration SwitchConfig)
+ {
+ if (SwitchConfig.JoystickControls.Enabled)
{
- if (!Joystick.GetState(Instance.JoystickControls.Index).IsConnected)
+ if (!Joystick.GetState(SwitchConfig.JoystickControls.Index).IsConnected)
{
- Instance.JoystickControls.SetEnabled(false);
+ SwitchConfig.JoystickControls.SetEnabled(false);
}
}
-
- device.Hid.InitializePrimaryController(Instance.ControllerType);
+ device.Hid.InitializePrimaryController(SwitchConfig.ControllerType);
device.Hid.InitializeKeyboard();
}
diff --git a/Ryujinx/Program.cs b/Ryujinx/Program.cs
index d0518441..5663a5d5 100644
--- a/Ryujinx/Program.cs
+++ b/Ryujinx/Program.cs
@@ -1,169 +1,41 @@
-using DiscordRPC;
-using Ryujinx.Audio;
+using Gtk;
using Ryujinx.Common.Logging;
-using Ryujinx.Graphics.Gal;
-using Ryujinx.Graphics.Gal.OpenGL;
-using Ryujinx.HLE;
using Ryujinx.Profiler;
+using Ryujinx.UI;
using System;
using System.IO;
-using System.Linq;
namespace Ryujinx
{
class Program
{
- public static DiscordRpcClient DiscordClient;
-
- public static RichPresence DiscordPresence;
-
- public static string ApplicationDirectory => AppDomain.CurrentDomain.BaseDirectory;
-
static void Main(string[] args)
{
Console.Title = "Ryujinx Console";
- IGalRenderer renderer = new OglRenderer();
-
- IAalOutput audioOut = InitializeAudioEngine();
-
- Switch device = new Switch(renderer, audioOut);
-
- Configuration.Load(Path.Combine(ApplicationDirectory, "Config.jsonc"));
- Configuration.Configure(device);
-
- Profile.Initialize();
+ string systemPath = Environment.GetEnvironmentVariable("Path", EnvironmentVariableTarget.Machine);
+ Environment.SetEnvironmentVariable("Path", $"{Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "bin")};{systemPath}");
AppDomain.CurrentDomain.UnhandledException += CurrentDomain_UnhandledException;
AppDomain.CurrentDomain.ProcessExit += CurrentDomain_ProcessExit;
- if (device.System.State.DiscordIntegrationEnabled)
- {
- DiscordClient = new DiscordRpcClient("568815339807309834");
- DiscordPresence = new RichPresence
- {
- Assets = new Assets
- {
- LargeImageKey = "ryujinx",
- LargeImageText = "Ryujinx is an emulator for the Nintendo Switch"
- }
- };
-
- DiscordClient.Initialize();
- DiscordClient.SetPresence(DiscordPresence);
- }
-
- if (args.Length == 1)
- {
- if (Directory.Exists(args[0]))
- {
- string[] romFsFiles = Directory.GetFiles(args[0], "*.istorage");
-
- if (romFsFiles.Length == 0)
- {
- romFsFiles = Directory.GetFiles(args[0], "*.romfs");
- }
-
- if (romFsFiles.Length > 0)
- {
- Logger.PrintInfo(LogClass.Application, "Loading as cart with RomFS.");
- device.LoadCart(args[0], romFsFiles[0]);
- }
- else
- {
- Logger.PrintInfo(LogClass.Application, "Loading as cart WITHOUT RomFS.");
- device.LoadCart(args[0]);
- }
- }
- else if (File.Exists(args[0]))
- {
- switch (Path.GetExtension(args[0]).ToLowerInvariant())
- {
- case ".xci":
- Logger.PrintInfo(LogClass.Application, "Loading as XCI.");
- device.LoadXci(args[0]);
- break;
- case ".nca":
- Logger.PrintInfo(LogClass.Application, "Loading as NCA.");
- device.LoadNca(args[0]);
- break;
- case ".nsp":
- case ".pfs0":
- Logger.PrintInfo(LogClass.Application, "Loading as NSP.");
- device.LoadNsp(args[0]);
- break;
- default:
- Logger.PrintInfo(LogClass.Application, "Loading as homebrew.");
- device.LoadProgram(args[0]);
- break;
- }
- }
- else
- {
- Logger.PrintWarning(LogClass.Application, "Please specify a valid XCI/NCA/NSP/PFS0/NRO file");
- }
- }
- else
- {
- Logger.PrintWarning(LogClass.Application, "Please specify the folder with the NSOs/IStorage or a NSO/NRO.");
- }
-
- if (device.System.State.DiscordIntegrationEnabled)
- {
- if (File.ReadAllLines(Path.Combine(ApplicationDirectory, "RPsupported.dat")).Contains(device.System.TitleID))
- {
- DiscordPresence.Assets.LargeImageKey = device.System.TitleID;
- }
-
- string state = device.System.TitleID;
-
- if (state == null)
- {
- state = "Ryujinx";
- }
- else
- {
- state = state.ToUpper();
- }
-
- string details = "Idling";
-
- if (device.System.TitleName != null)
- {
- details = $"Playing {device.System.TitleName}";
- }
-
- DiscordPresence.Details = details;
- DiscordPresence.State = state;
- DiscordPresence.Assets.LargeImageText = device.System.TitleName;
- DiscordPresence.Assets.SmallImageKey = "ryujinx";
- DiscordPresence.Assets.SmallImageText = "Ryujinx is an emulator for the Nintendo Switch";
- DiscordPresence.Timestamps = new Timestamps(DateTime.UtcNow);
-
- DiscordClient.SetPresence(DiscordPresence);
- }
-
- using (GlScreen screen = new GlScreen(device, renderer))
- {
- screen.MainLoop();
+ Profile.Initialize();
- Profile.FinishProfiling();
+ Application.Init();
- device.Dispose();
- }
+ Application gtkApplication = new Application("Ryujinx.Ryujinx", GLib.ApplicationFlags.None);
+ MainWindow mainWindow = new MainWindow(args, gtkApplication);
- audioOut.Dispose();
-
- Logger.Shutdown();
+ gtkApplication.Register(GLib.Cancellable.Current);
+ gtkApplication.AddWindow(mainWindow);
+ mainWindow.Show();
- DiscordClient.Dispose();
+ Application.Run();
}
private static void CurrentDomain_ProcessExit(object sender, EventArgs e)
{
Logger.Shutdown();
-
- DiscordClient.Dispose();
}
private static void CurrentDomain_UnhandledException(object sender, UnhandledExceptionEventArgs e)
@@ -175,29 +47,7 @@ namespace Ryujinx
if (e.IsTerminating)
{
Logger.Shutdown();
-
- DiscordClient.Dispose();
- }
- }
-
- /// <summary>
- /// Picks an <see cref="IAalOutput"/> audio output renderer supported on this machine
- /// </summary>
- /// <returns>An <see cref="IAalOutput"/> supported by this machine</returns>
- private static IAalOutput InitializeAudioEngine()
- {
- if (SoundIoAudioOut.IsSupported)
- {
- return new SoundIoAudioOut();
- }
- else if (OpenALAudioOut.IsSupported)
- {
- return new OpenALAudioOut();
- }
- else
- {
- return new DummyAudioOut();
}
}
}
-}
+} \ No newline at end of file
diff --git a/Ryujinx/RPsupported.dat b/Ryujinx/RPsupported.dat
index ad2d715d..bcce8b49 100644
--- a/Ryujinx/RPsupported.dat
+++ b/Ryujinx/RPsupported.dat
@@ -2,10 +2,10 @@
01000d700be88000
01000dc007e90000
01000e2003fa0000
-01002fc00c6d0000
0100225000fee000
010028d0045ce000
01002b30028f6000
+01002fc00c6d0000
010034e005c9c000
01004f8006a78000
010051f00ac5e000
@@ -15,12 +15,14 @@
010065500b218000
010068f00aa78000
01006a800016e000
+010072800cbe8000
01007330027ee000
0100749009844000
01007a4008486000
010080b00ad66000
010094e00b52e000
01009aa000faa000
+01009b90006dc000
0100a4200a284000
0100a5c00d162000
0100ae000aebc000
@@ -31,8 +33,11 @@
0100d6b00cd88000
0100d870045b6000
0100e0c00adac000
+0100e46006708000
0100e7200b272000
0100e9f00b882000
0100eab00605c000
0100efd00a4fa000
-0100f6a00a684000 \ No newline at end of file
+0100f6a00a684000
+0100f9f00c696000
+051337133769a000 \ No newline at end of file
diff --git a/Ryujinx/Ryujinx.csproj b/Ryujinx/Ryujinx.csproj
index 80b03f46..763feec7 100644
--- a/Ryujinx/Ryujinx.csproj
+++ b/Ryujinx/Ryujinx.csproj
@@ -19,7 +19,27 @@
</PropertyGroup>
<ItemGroup>
+ <EmbeddedResource Include="Ui\AboutWindow.glade" />
+ <EmbeddedResource Include="Ui\assets\ryujinxNCAIcon.png" />
+ <EmbeddedResource Include="Ui\assets\ryujinxNROIcon.png" />
+ <EmbeddedResource Include="Ui\assets\ryujinxNSOIcon.png" />
+ <EmbeddedResource Include="Ui\assets\ryujinxNSPIcon.png" />
+ <EmbeddedResource Include="Ui\assets\ryujinxXCIIcon.png" />
+ <EmbeddedResource Include="Ui\assets\DiscordLogo.png" />
+ <EmbeddedResource Include="Ui\assets\GitHubLogo.png" />
+ <EmbeddedResource Include="Ui\assets\JoyCon.png" />
+ <EmbeddedResource Include="Ui\assets\PatreonLogo.png" />
+ <EmbeddedResource Include="Ui\assets\RyujinxIcon.png" />
+ <EmbeddedResource Include="Ui\assets\TwitterLogo.png" />
+ <EmbeddedResource Include="Ui\MainWindow.glade" />
+ <EmbeddedResource Include="Ui\SwitchSettings.glade" />
+ </ItemGroup>
+
+ <ItemGroup>
<PackageReference Include="DiscordRichPresence" Version="1.0.108" />
+ <PackageReference Include="GtkSharp" Version="3.22.24.37" />
+ <PackageReference Include="GtkSharp.Dependencies" Version="1.0.1" />
+ <PackageReference Include="JsonPrettyPrinter" Version="1.0.1.1" />
<PackageReference Include="OpenTK.NetStandard" Version="1.0.4" />
</ItemGroup>
@@ -33,7 +53,10 @@
</ItemGroup>
<ItemGroup>
- <None Update="Config.jsonc">
+ <None Update="Config.json">
+ <CopyToOutputDirectory>PreserveNewest</CopyToOutputDirectory>
+ </None>
+ <None Update="Theme.css">
<CopyToOutputDirectory>PreserveNewest</CopyToOutputDirectory>
</None>
<None Update="RPsupported.dat">
diff --git a/Ryujinx/Theme.css b/Ryujinx/Theme.css
new file mode 100644
index 00000000..286e092c
--- /dev/null
+++ b/Ryujinx/Theme.css
@@ -0,0 +1,4054 @@
+/* GTK NAMED COLORS
+ ----------------
+ use responsibly! */
+/*
+widget text/foreground color */
+@define-color theme_fg_color white;
+/*
+text color for entries, views and content in general */
+@define-color theme_text_color white;
+/*
+widget base background color */
+@define-color theme_bg_color #292f34;
+/*
+text widgets and the like base background color */
+@define-color theme_base_color #292f34;
+/*
+base background color of selections */
+@define-color theme_selected_bg_color #FF5F57;
+/*
+text/foreground color of selections */
+@define-color theme_selected_fg_color white;
+/*
+base background color of insensitive widgets */
+@define-color insensitive_bg_color #252b2f;
+/*
+text foreground color of insensitive widgets */
+@define-color insensitive_fg_color rgba(232, 232, 232, 0.35);
+/*
+insensitive text widgets and the like base background color */
+@define-color insensitive_base_color rgba(232, 232, 232, 0.35);
+/*
+widget text/foreground color on backdrop windows */
+@define-color theme_unfocused_fg_color white;
+/*
+text color for entries, views and content in general on backdrop windows */
+@define-color theme_unfocused_text_color white;
+/*
+widget base background color on backdrop windows */
+@define-color theme_unfocused_bg_color #292f34;
+/*
+text widgets and the like base background color on backdrop windows */
+@define-color theme_unfocused_base_color #292f34;
+/*
+base background color of selections on backdrop windows */
+@define-color theme_unfocused_selected_bg_color rgba(255, 95, 87, 0.5);
+/*
+text/foreground color of selections on backdrop windows */
+@define-color theme_unfocused_selected_fg_color white;
+/*
+widgets main borders color */
+@define-color borders #5f6367;
+/*
+widgets main borders color on backdrop windows */
+@define-color unfocused_borders #5f6367;
+/*
+widgets main borders color insensitive */
+@define-color insensitive_borders rgba(86, 90, 94, 0.35);
+/*
+these are pretty self explicative */
+@define-color warning_color #e67e22;
+@define-color error_color #e74c3c;
+@define-color success_color #3498db;
+@define-color content_view_bg #292f34;
+* {
+ padding: 0;
+ -GtkToolButton-icon-spacing: 4;
+ -GtkTextView-error-underline-color: #e74c3c;
+ -GtkScrolled-window-overlay-scrolling: FALSE;
+ -GtkToolItemGroup-expander-size: 11;
+ -GtkExpander-expander-size: 16;
+ -GtkTreeView-expander-size: 11;
+ -GtkTreeView-horizontal-separator: 4;
+ -GtkWidget-text-handle-width: 20;
+ -GtkWidget-text-handle-height: 20;
+ -GtkDialog-button-spacing: 4;
+ -GtkDialog-action-area-border: 0;
+ -GtkStatusbar-shadow-type: none;
+ outline-width: 0px; }
+
+/***************
+ * Base States *
+ ***************/
+* {
+ color: white
+}
+
+.background {
+ color: white;
+ background-color: #292f34; }
+ .background:backdrop {
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ background-color: #292f34; }
+
+/*
+ These wildcard seems unavoidable, need to investigate.
+ Wildcards are bad and troublesome, use them with care,
+ or better, just don't.
+ Everytime a wildcard is used a kitten dies, painfully.
+*/
+*:disabled {
+ -gtk-icon-effect: dim; }
+
+.gtkstyle-fallback {
+ background-color: #292f34;
+ color: white; }
+ .gtkstyle-fallback:hover {
+ background-color: #3f4951;
+ color: white; }
+ .gtkstyle-fallback:active {
+ background-color: #131517;
+ color: white; }
+ .gtkstyle-fallback:disabled {
+ background-color: #252b2f;
+ color: rgba(232, 232, 232, 0.35); }
+ .gtkstyle-fallback:selected {
+ background-color: #FF5F57;
+ color: white; }
+
+.view text,
+textview text,
+.view {
+ color: white;
+ background-color: #292f34; }
+ .view text:backdrop,
+ textview text:backdrop,
+ .view:backdrop {
+ color: white;
+ background-color: #292f34; }
+ .view text:selected:focus,
+ textview text:selected:focus, .view text:selected,
+ textview text:selected,
+ .view:selected:focus,
+ .view:selected {
+ border-radius: 3px; }
+
+textview border {
+ background-color: #292f34;
+ background-image: image(#5f6367);
+ background-repeat: no-repeat; }
+ textview border:backdrop {
+ background-color: #292f34; }
+ textview border.bottom {
+ background-size: 100% 1px;
+ background-position: top; }
+ textview border.top {
+ background-size: 100% 1px;
+ background-position: bottom; }
+ textview border.left {
+ background-size: 1px 100%;
+ background-position: right; }
+ textview border.right {
+ background-size: 1px 100%;
+ background-position: left; }
+
+.rubberband,
+rubberband,
+flowbox rubberband,
+treeview.view rubberband {
+ border: 1px solid #FF5F57;
+ background-color: rgba(255, 95, 87, 0.2); }
+ .rubberband:backdrop,
+ rubberband:backdrop,
+ treeview.view rubberband:backdrop {
+ border-color: #FF5F57;
+ background-color: rgba(255, 95, 87, 0.2); }
+
+flowbox flowboxchild {
+ padding: 3px;
+ border-radius: 3px; }
+ flowbox flowboxchild:selected {
+ outline-offset: 0px; }
+
+label.separator {
+ color: white; }
+ label.separator:backdrop {
+ color: white; }
+label selection {
+ background-color: #FF5F57;
+ color: white; }
+label:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ label:disabled:backdrop {
+ color: rgba(232, 232, 232, 0.35); }
+label:backdrop {
+ color: white; }
+
+.dim-label, label.separator,
+headerbar .subtitle {
+ opacity: 0.5;
+ text-shadow: none; }
+
+assistant .sidebar {
+ background-color: white;
+ border-top: 1px solid #5f6367; }
+ assistant .sidebar:backdrop {
+ background-color: white;
+ border-color: #5f6367; }
+assistant.csd .sidebar {
+ border-top-style: none; }
+assistant .sidebar label {
+ padding: 6px 12px; }
+assistant .sidebar label.highlight {
+ background-color: #54595d; }
+
+.app-notification,
+.app-notification.frame, .csd popover.background.touch-selection, .csd popover.background.magnifier, popover.background.touch-selection, popover.background.magnifier, .csd popover.background.osd, popover.background.osd,
+.osd {
+ color: white;
+ border: 1px solid #5f6367;
+ background-color: rgba(41, 47, 52, 0.8);
+ background-clip: padding-box;
+ box-shadow: none;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+ .app-notification:backdrop, popover.background.touch-selection:backdrop, popover.background.magnifier:backdrop, popover.background.osd:backdrop,
+ .osd:backdrop {
+ color: white;
+ background-color: rgba(41, 47, 52, 0.8);
+ -gtk-icon-shadow: none; }
+
+.view text:selected:focus,
+textview text:selected:focus, .view text:selected,
+textview text:selected,
+.view:selected:focus,
+.view:selected, .view text selection:focus, .view text selection,
+textview text selection:focus,
+textview text selection, flowbox flowboxchild:selected, spinbutton:not(.vertical) selection:focus, spinbutton:not(.vertical) selection,
+entry selection:focus,
+entry selection, row:selected, .sidebar:selected {
+ background-color: #FF5F57;
+ color: white; }
+ textview text:hover:selected:focus, .view text:hover:selected,
+ textview text:hover:selected,
+ .view:hover:selected, .view text selection:hover,
+ textview text selection:hover, flowbox flowboxchild:hover:selected, spinbutton:not(.vertical) selection:hover,
+ entry selection:hover, row:hover:selected, .sidebar:hover:selected {
+ background-color: #FF5F57;
+ color: white; }
+ textview text:backdrop:selected:focus, .view text:backdrop:selected,
+ textview text:backdrop:selected,
+ .view:backdrop:selected, .view text selection:backdrop,
+ textview text selection:backdrop, flowbox flowboxchild:backdrop:selected, label:backdrop selction, spinbutton:not(.vertical) selection:backdrop,
+ entry selection:backdrop, row:backdrop:selected, .sidebar:backdrop:selected {
+ background-color: rgba(255, 95, 87, 0.5);
+ color: #292f34; }
+
+.view text:selected:focus,
+textview text:selected:focus, .view text:selected,
+textview text:selected,
+.view:selected:focus,
+.view:selected, .view text selection:focus, .view text selection,
+textview text selection:focus,
+textview text selection, flowbox flowboxchild:selected, spinbutton:not(.vertical) selection:focus, spinbutton:not(.vertical) selection,
+entry selection:focus,
+entry selection, row:selected, .sidebar:selected {
+ background-color: #FF5F57;
+ border-radius: 0px; }
+ .view text:selected:focus,
+ textview text:selected:focus, .view text:selected,
+ textview text:selected,
+ .view:selected:focus,
+ .view:selected, .view text selection:focus, .view text selection,
+ textview text selection:focus,
+ textview text selection, flowbox flowboxchild:selected, spinbutton:not(.vertical) selection:focus, spinbutton:not(.vertical) selection,
+ entry selection:focus,
+ entry selection, row:selected, .sidebar:selected {
+ color: white; }
+ textview text:disabled:selected:focus, .view text:disabled:selected,
+ textview text:disabled:selected,
+ .view:disabled:selected, .view text selection:disabled,
+ textview text selection:disabled, flowbox flowboxchild:disabled:selected, label:disabled selection, spinbutton:not(.vertical) selection:disabled,
+ entry selection:disabled, row:disabled:selected, .sidebar:disabled:selected {
+ color: rgba(232, 232, 232, 0.35); }
+ textview text:backdrop:selected:focus, .view text:backdrop:selected,
+ textview text:backdrop:selected,
+ .view:backdrop:selected, .view text selection:backdrop,
+ textview text selection:backdrop, flowbox flowboxchild:backdrop:selected, label:backdrop selction, spinbutton:not(.vertical) selection:backdrop,
+ entry selection:backdrop, row:backdrop:selected, .sidebar:backdrop:selected {
+ color: white; }
+ .view text:backdrop:disabled:selected,
+ textview text:backdrop:disabled:selected,
+ .view:backdrop:disabled:selected, .view text selection:backdrop:disabled,
+ textview text selection:backdrop:disabled, flowbox flowboxchild:backdrop:disabled:selected, label:disabled selection:backdrop, label:backdrop selction:disabled, spinbutton:not(.vertical) selection:backdrop:disabled,
+ entry selection:backdrop:disabled, row:backdrop:disabled:selected, .sidebar:backdrop:disabled:selected {
+ color: rgba(232, 232, 232, 0.35); }
+
+/***********
+ * Buttons *
+ ***********/
+@keyframes needs_attention {
+ from {
+ background-image: -gtk-gradient(radial, center center, 0, center center, 0.01, to(#FF5F57), to(transparent)); }
+ to {
+ background-image: -gtk-gradient(radial, center center, 0, center center, 0.5, to(#FF5F57), to(transparent)); } }
+notebook > header > tabs > arrow, .csd popover.background.touch-selection button, .csd popover.background.magnifier button, popover.background.touch-selection button, popover.background.magnifier button,
+button, notebook > header > tabs > arrow.osd,
+button.osd {
+ border: 1px solid;
+ border-radius: 3px;
+ padding: 4px 6px;
+ background-clip: border-box;
+ transition: all 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ box-shadow: 1px 1px 1px rgba(0, 0, 0, 0.1);
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32); }
+ notebook > header > tabs > arrow, button.sidebar-button, popover.background.touch-selection button.flat, popover.background.magnifier button.flat,
+ button.flat, notebook > header > tabs > arrow.osd, button.osd.sidebar-button {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ transition: none; }
+ notebook > header > tabs > arrow:hover, button.sidebar-button:hover, popover.background.touch-selection button.flat:hover, popover.background.magnifier button.flat:hover,
+ button.flat:hover, notebook > header > tabs > arrow.osd:hover {
+ transition: all 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ transition-duration: 500ms; }
+ notebook > header > tabs > arrow:hover:active, button.sidebar-button:hover:active,
+ button.flat:hover:active {
+ transition: all 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94); }
+ notebook > header > tabs > arrow:checked, button.sidebar-button:checked, popover.background.touch-selection button.flat:checked, popover.background.magnifier button.flat:checked,
+ button.flat:checked, notebook > header > tabs > arrow.osd:checked {
+ background-color: #5f6367; }
+ notebook > header > tabs > arrow:hover, popover.background.touch-selection button:hover, popover.background.magnifier button:hover,
+ button:hover, notebook > header > tabs > arrow.osd:hover {
+ color: white;
+ border-color: #FF5F57;
+ -gtk-icon-effect: none; }
+ notebook > header > tabs > arrow:active, popover.background.touch-selection button:active, popover.background.magnifier button:active,
+ button:active, notebook > header > tabs > arrow.osd:active, notebook > header > tabs > arrow:checked, popover.background.touch-selection button:checked, popover.background.magnifier button:checked,
+ button:checked, notebook > header > tabs > arrow.osd:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57);
+ transition-duration: 50ms; }
+ notebook > header > tabs > arrow:active:hover, popover.background.touch-selection button:active:hover, popover.background.magnifier button:active:hover,
+ button:active:hover, notebook > header > tabs > arrow:checked:hover, popover.background.touch-selection button:checked:hover, popover.background.magnifier button:checked:hover,
+ button:checked:hover {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ notebook > header > tabs > arrow:backdrop, popover.background.touch-selection button:backdrop, popover.background.magnifier button:backdrop,
+ button:backdrop, notebook > header > tabs > arrow.osd:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32);
+ -gtk-icon-effect: none; }
+ notebook > header > tabs > arrow:backdrop:active, popover.background.touch-selection button:backdrop:active, popover.background.magnifier button:backdrop:active,
+ button:backdrop:active, notebook > header > tabs > arrow:backdrop:checked, popover.background.touch-selection button:backdrop:checked, popover.background.magnifier button:backdrop:checked,
+ button:backdrop:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ notebook > header > tabs > arrow:backdrop:disabled, popover.background.touch-selection button:backdrop:disabled, popover.background.magnifier button:backdrop:disabled,
+ button:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ notebook > header > tabs > arrow:backdrop:disabled > .label, popover.background.touch-selection button:backdrop:disabled > .label, popover.background.magnifier button:backdrop:disabled > .label,
+ button:backdrop:disabled > .label {
+ color: inherit; }
+ notebook > header > tabs > arrow:backdrop:disabled:active,
+ button:backdrop:disabled:active, notebook > header > tabs > arrow:backdrop:disabled:checked,
+ button:backdrop:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ notebook > header > tabs > arrow:backdrop:disabled:active > .label, popover.background.touch-selection button:backdrop:disabled:active > .label, popover.background.magnifier button:backdrop:disabled:active > .label,
+ button:backdrop:disabled:active > .label, notebook > header > tabs > arrow:backdrop:disabled:checked > .label, popover.background.touch-selection button:backdrop:disabled:checked > .label, popover.background.magnifier button:backdrop:disabled:checked > .label,
+ button:backdrop:disabled:checked > .label {
+ color: inherit; }
+ notebook > header > tabs > arrow:backdrop, button.sidebar-button:backdrop, popover.background.touch-selection button.flat:backdrop, popover.background.magnifier button.flat:backdrop,
+ button.flat:backdrop, notebook > header > tabs > arrow.osd:backdrop {
+ -gtk-icon-effect: none;
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white; }
+ notebook > header > tabs > arrow:disabled, button.sidebar-button:disabled, popover.background.touch-selection button.flat:disabled, popover.background.magnifier button.flat:disabled,
+ button.flat:disabled, notebook > header > tabs > arrow.osd:disabled {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: rgba(232, 232, 232, 0.35); }
+ notebook > header > tabs > arrow:backdrop:disabled, button.sidebar-button:backdrop:disabled,
+ button.flat:backdrop:disabled {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: rgba(232, 232, 232, 0.35); }
+ notebook > header > tabs > arrow:disabled, popover.background.touch-selection button:disabled, popover.background.magnifier button:disabled,
+ button:disabled, notebook > header > tabs > arrow.osd:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ notebook > header > tabs > arrow:disabled > .label, popover.background.touch-selection button:disabled > .label, popover.background.magnifier button:disabled > .label,
+ button:disabled > .label {
+ color: inherit; }
+ notebook > header > tabs > arrow:disabled:active, popover.background.touch-selection button:disabled:active, popover.background.magnifier button:disabled:active,
+ button:disabled:active, notebook > header > tabs > arrow:disabled:checked, popover.background.touch-selection button:disabled:checked, popover.background.magnifier button:disabled:checked,
+ button:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ notebook > header > tabs > arrow:disabled:active > .label, popover.background.touch-selection button:disabled:active > .label, popover.background.magnifier button:disabled:active > .label,
+ button:disabled:active > .label, notebook > header > tabs > arrow:disabled:checked > .label, popover.background.touch-selection button:disabled:checked > .label, popover.background.magnifier button:disabled:checked > .label,
+ button:disabled:checked > .label {
+ color: inherit; }
+ notebook > header > tabs > arrow separator, .csd popover.background.touch-selection button separator, .csd popover.background.magnifier button separator, popover.background.touch-selection button separator, popover.background.magnifier button separator,
+ button separator, notebook > header > tabs > arrow.osd separator,
+ button.osd separator {
+ background-color: transparent;
+ background-image: none;
+ color: transparent; }
+
+notebook > header > tabs > arrow.image-button, popover.background.touch-selection button.image-button, popover.background.magnifier button.image-button,
+button.image-button {
+ min-width: 16px;
+ padding: 6px; }
+notebook > header > tabs > arrow.text-button, popover.background.touch-selection button.text-button, popover.background.magnifier button.text-button,
+button.text-button {
+ padding-left: 6px;
+ padding-right: 6px; }
+notebook > header > tabs > arrow.text-button.image-button, popover.background.touch-selection button.text-button.image-button, popover.background.magnifier button.text-button.image-button,
+button.text-button.image-button {
+ padding-left: 6px;
+ padding-right: 6px; }
+ notebook > header > tabs > arrow.text-button.image-button label, popover.background.touch-selection button.text-button.image-button label, popover.background.magnifier button.text-button.image-button label,
+ button.text-button.image-button label {
+ padding-left: 6px;
+ padding-right: 6px; }
+row:selected popover.background.touch-selection button, popover.background.touch-selection row:selected button, row:selected popover.background.magnifier button, popover.background.magnifier row:selected button, row:selected
+button {
+ border-color: #FF5F57; }
+ row:selected popover.background.touch-selection button.flat:not(:active):not(:checked):not(:hover):not(disabled), popover.background.touch-selection row:selected button.flat:not(:active):not(:checked):not(:hover):not(disabled), row:selected popover.background.magnifier button.flat:not(:active):not(:checked):not(:hover):not(disabled), popover.background.magnifier row:selected button.flat:not(:active):not(:checked):not(:hover):not(disabled), row:selected
+ button.flat:not(:active):not(:checked):not(:hover):not(disabled) {
+ color: white;
+ border-color: transparent; }
+ row:selected popover.background.touch-selection button.flat:not(:active):not(:checked):not(:hover):not(disabled):backdrop, popover.background.touch-selection row:selected button.flat:not(:active):not(:checked):not(:hover):not(disabled):backdrop, row:selected popover.background.magnifier button.flat:not(:active):not(:checked):not(:hover):not(disabled):backdrop, popover.background.magnifier row:selected button.flat:not(:active):not(:checked):not(:hover):not(disabled):backdrop, row:selected
+ button.flat:not(:active):not(:checked):not(:hover):not(disabled):backdrop {
+ color: white; }
+popover.background.touch-selection button.suggested-action, popover.background.magnifier button.suggested-action, popover.background.touch-selection button.suggested-action.osd button, popover.background.magnifier button.suggested-action.osd button,
+button.suggested-action,
+button.suggested-action.osd popover.background.touch-selection button,
+popover.background.touch-selection button.suggested-action.osd button,
+button.suggested-action.osd popover.background.magnifier button,
+popover.background.magnifier button.suggested-action.osd button, popover.background.touch-selection button.suggested-action.osd
+button, popover.background.magnifier button.suggested-action.osd
+button,
+button.suggested-action.osd
+button {
+ box-shadow: 1px 1px 1px rgba(0, 0, 0, 0.1);
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ popover.background.touch-selection button.suggested-action.flat, popover.background.magnifier button.suggested-action.flat, popover.background.touch-selection button.suggested-action.osd button.flat, popover.background.magnifier button.suggested-action.osd button.flat,
+ button.suggested-action.flat,
+ button.suggested-action.osd popover.background.touch-selection button.flat,
+ popover.background.touch-selection button.suggested-action.osd button.flat,
+ button.suggested-action.osd popover.background.magnifier button.flat,
+ popover.background.magnifier button.suggested-action.osd button.flat, popover.background.touch-selection button.suggested-action.osd
+ button.flat, popover.background.magnifier button.suggested-action.osd
+ button.flat,
+ button.suggested-action.osd
+ button.flat {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: #FF5F57; }
+ popover.background.touch-selection button.suggested-action:hover, popover.background.magnifier button.suggested-action:hover, popover.background.touch-selection button.suggested-action.osd button:hover, popover.background.magnifier button.suggested-action.osd button:hover,
+ button.suggested-action:hover,
+ button.suggested-action.osd popover.background.touch-selection button:hover,
+ popover.background.touch-selection button.suggested-action.osd button:hover,
+ button.suggested-action.osd popover.background.magnifier button:hover,
+ popover.background.magnifier button.suggested-action.osd button:hover, popover.background.touch-selection button.suggested-action.osd
+ button:hover, popover.background.magnifier button.suggested-action.osd
+ button:hover,
+ button.suggested-action.osd
+ button:hover {
+ color: white;
+ border-color: #FF5F57; }
+ popover.background.touch-selection button.suggested-action:active, popover.background.magnifier button.suggested-action:active, popover.background.touch-selection button.suggested-action:checked, popover.background.magnifier button.suggested-action:checked, popover.background.touch-selection button.suggested-action.osd button:active, popover.background.magnifier button.suggested-action.osd button:active, popover.background.touch-selection button.suggested-action.osd button:checked, popover.background.magnifier button.suggested-action.osd button:checked,
+ button.suggested-action:active,
+ button.suggested-action:checked,
+ button.suggested-action.osd popover.background.touch-selection button:active,
+ popover.background.touch-selection button.suggested-action.osd button:active,
+ button.suggested-action.osd popover.background.magnifier button:active,
+ popover.background.magnifier button.suggested-action.osd button:active,
+ button.suggested-action.osd popover.background.touch-selection button:checked,
+ popover.background.touch-selection button.suggested-action.osd button:checked,
+ button.suggested-action.osd popover.background.magnifier button:checked,
+ popover.background.magnifier button.suggested-action.osd button:checked, popover.background.touch-selection button.suggested-action.osd
+ button:active, popover.background.magnifier button.suggested-action.osd
+ button:active, popover.background.touch-selection button.suggested-action.osd
+ button:checked, popover.background.magnifier button.suggested-action.osd
+ button:checked,
+ button.suggested-action.osd
+ button:active,
+ button.suggested-action.osd
+ button:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ popover.background.touch-selection button.suggested-action:backdrop, popover.background.magnifier button.suggested-action:backdrop, popover.background.touch-selection button.suggested-action.flat:backdrop, popover.background.magnifier button.suggested-action.flat:backdrop, popover.background.touch-selection button.suggested-action.osd button:backdrop, popover.background.magnifier button.suggested-action.osd button:backdrop, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop, popover.background.magnifier button.suggested-action.osd button.flat:backdrop,
+ button.suggested-action:backdrop,
+ button.suggested-action.flat:backdrop,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop,
+ button.suggested-action.osd popover.background.magnifier button:backdrop,
+ popover.background.magnifier button.suggested-action.osd button:backdrop,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop, popover.background.magnifier button.suggested-action.osd
+ button:backdrop, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop,
+ button.suggested-action.osd
+ button:backdrop,
+ button.suggested-action.osd
+ button.flat:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ popover.background.touch-selection button.suggested-action:backdrop:active, popover.background.magnifier button.suggested-action:backdrop:active, popover.background.touch-selection button.suggested-action:backdrop:checked, popover.background.magnifier button.suggested-action:backdrop:checked, popover.background.touch-selection button.suggested-action.flat:backdrop:active, popover.background.magnifier button.suggested-action.flat:backdrop:active, popover.background.touch-selection button.suggested-action.flat:backdrop:checked, popover.background.magnifier button.suggested-action.flat:backdrop:checked, popover.background.touch-selection button.suggested-action.osd button:backdrop:active, popover.background.magnifier button.suggested-action.osd button:backdrop:active, popover.background.touch-selection button.suggested-action.osd button:backdrop:checked, popover.background.magnifier button.suggested-action.osd button:backdrop:checked, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:active, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:active, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:checked, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:checked,
+ button.suggested-action:backdrop:active,
+ button.suggested-action:backdrop:checked,
+ button.suggested-action.flat:backdrop:active,
+ button.suggested-action.flat:backdrop:checked,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:active,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:active,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:active,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:active,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:checked,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:checked,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:checked,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:checked,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:active,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:active,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:active,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:active,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:checked,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:checked,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:checked,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:checked, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:active, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:active, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:checked, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:checked, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:active, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:active, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:checked, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:checked,
+ button.suggested-action.osd
+ button:backdrop:active,
+ button.suggested-action.osd
+ button:backdrop:checked,
+ button.suggested-action.osd
+ button.flat:backdrop:active,
+ button.suggested-action.osd
+ button.flat:backdrop:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ popover.background.touch-selection button.suggested-action:backdrop:disabled, popover.background.magnifier button.suggested-action:backdrop:disabled, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.flat:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled,
+ button.suggested-action:backdrop:disabled,
+ button.suggested-action.flat:backdrop:disabled,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled,
+ button.suggested-action.osd
+ button:backdrop:disabled,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ popover.background.touch-selection button.suggested-action:backdrop:disabled > .label, popover.background.magnifier button.suggested-action:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.flat:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled > .label,
+ button.suggested-action:backdrop:disabled > .label,
+ button.suggested-action.flat:backdrop:disabled > .label,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled > .label,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled > .label,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled > .label,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled > .label,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled > .label,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled > .label,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled > .label,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled > .label, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled > .label, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled > .label,
+ button.suggested-action.osd
+ button:backdrop:disabled > .label,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled > .label {
+ color: inherit; }
+ popover.background.touch-selection button.suggested-action:backdrop:disabled:active, popover.background.magnifier button.suggested-action:backdrop:disabled:active, popover.background.touch-selection button.suggested-action:backdrop:disabled:checked, popover.background.magnifier button.suggested-action:backdrop:disabled:checked, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled:active, popover.background.magnifier button.suggested-action.flat:backdrop:disabled:active, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled:checked, popover.background.magnifier button.suggested-action.flat:backdrop:disabled:checked, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:active, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:active, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:checked, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:checked, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:active, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:active, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:checked, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:checked,
+ button.suggested-action:backdrop:disabled:active,
+ button.suggested-action:backdrop:disabled:checked,
+ button.suggested-action.flat:backdrop:disabled:active,
+ button.suggested-action.flat:backdrop:disabled:checked,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:active,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:active,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:active,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:active,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:checked,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:checked,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:checked,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:checked,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:active,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:active,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:active,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:checked,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:checked, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled:active, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled:active, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled:checked, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled:checked, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled:active, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled:active, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled:checked, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled:checked,
+ button.suggested-action.osd
+ button:backdrop:disabled:active,
+ button.suggested-action.osd
+ button:backdrop:disabled:checked,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled:active,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ popover.background.touch-selection button.suggested-action:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:checked > .label,
+ button.suggested-action:backdrop:disabled:active > .label,
+ button.suggested-action:backdrop:disabled:checked > .label,
+ button.suggested-action.flat:backdrop:disabled:active > .label,
+ button.suggested-action.flat:backdrop:disabled:checked > .label,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:active > .label,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:active > .label,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:active > .label,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:active > .label,
+ button.suggested-action.osd popover.background.touch-selection button:backdrop:disabled:checked > .label,
+ popover.background.touch-selection button.suggested-action.osd button:backdrop:disabled:checked > .label,
+ button.suggested-action.osd popover.background.magnifier button:backdrop:disabled:checked > .label,
+ popover.background.magnifier button.suggested-action.osd button:backdrop:disabled:checked > .label,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active > .label,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:active > .label,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:active > .label,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:active > .label,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked > .label,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled:checked > .label,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked > .label,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd
+ button:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd
+ button:backdrop:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled:checked > .label,
+ button.suggested-action.osd
+ button:backdrop:disabled:active > .label,
+ button.suggested-action.osd
+ button:backdrop:disabled:checked > .label,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled:active > .label,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled:checked > .label {
+ color: inherit; }
+ popover.background.touch-selection button.suggested-action.flat:backdrop, popover.background.magnifier button.suggested-action.flat:backdrop, popover.background.touch-selection button.suggested-action.flat:disabled, popover.background.magnifier button.suggested-action.flat:disabled, popover.background.touch-selection button.suggested-action.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.flat:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop, popover.background.magnifier button.suggested-action.osd button.flat:backdrop, popover.background.touch-selection button.suggested-action.osd button.flat:disabled, popover.background.magnifier button.suggested-action.osd button.flat:disabled, popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled,
+ button.suggested-action.flat:backdrop,
+ button.suggested-action.flat:disabled,
+ button.suggested-action.flat:backdrop:disabled,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop,
+ button.suggested-action.osd popover.background.touch-selection button.flat:disabled,
+ popover.background.touch-selection button.suggested-action.osd button.flat:disabled,
+ button.suggested-action.osd popover.background.magnifier button.flat:disabled,
+ popover.background.magnifier button.suggested-action.osd button.flat:disabled,
+ button.suggested-action.osd popover.background.touch-selection button.flat:backdrop:disabled,
+ popover.background.touch-selection button.suggested-action.osd button.flat:backdrop:disabled,
+ button.suggested-action.osd popover.background.magnifier button.flat:backdrop:disabled,
+ popover.background.magnifier button.suggested-action.osd button.flat:backdrop:disabled, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop, popover.background.touch-selection button.suggested-action.osd
+ button.flat:disabled, popover.background.magnifier button.suggested-action.osd
+ button.flat:disabled, popover.background.touch-selection button.suggested-action.osd
+ button.flat:backdrop:disabled, popover.background.magnifier button.suggested-action.osd
+ button.flat:backdrop:disabled,
+ button.suggested-action.osd
+ button.flat:backdrop,
+ button.suggested-action.osd
+ button.flat:disabled,
+ button.suggested-action.osd
+ button.flat:backdrop:disabled {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: rgba(255, 95, 87, 0.8); }
+ popover.background.touch-selection button.suggested-action:disabled, popover.background.magnifier button.suggested-action:disabled, popover.background.touch-selection button.suggested-action.osd button:disabled, popover.background.magnifier button.suggested-action.osd button:disabled,
+ button.suggested-action:disabled,
+ button.suggested-action.osd popover.background.touch-selection button:disabled,
+ popover.background.touch-selection button.suggested-action.osd button:disabled,
+ button.suggested-action.osd popover.background.magnifier button:disabled,
+ popover.background.magnifier button.suggested-action.osd button:disabled, popover.background.touch-selection button.suggested-action.osd
+ button:disabled, popover.background.magnifier button.suggested-action.osd
+ button:disabled,
+ button.suggested-action.osd
+ button:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ popover.background.touch-selection button.suggested-action:disabled > .label, popover.background.magnifier button.suggested-action:disabled > .label, popover.background.touch-selection button.suggested-action.osd button:disabled > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:disabled > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:disabled > .label, popover.background.magnifier button.suggested-action.osd button:disabled > .label,
+ button.suggested-action:disabled > .label,
+ button.suggested-action.osd popover.background.touch-selection button:disabled > .label,
+ popover.background.touch-selection button.suggested-action.osd button:disabled > .label,
+ button.suggested-action.osd popover.background.magnifier button:disabled > .label,
+ popover.background.magnifier button.suggested-action.osd button:disabled > .label, popover.background.touch-selection button.suggested-action.osd
+ button:disabled > .label, popover.background.magnifier button.suggested-action.osd
+ button:disabled > .label,
+ button.suggested-action.osd
+ button:disabled > .label {
+ color: inherit; }
+ popover.background.touch-selection button.suggested-action:disabled:active, popover.background.magnifier button.suggested-action:disabled:active, popover.background.touch-selection button.suggested-action:disabled:checked, popover.background.magnifier button.suggested-action:disabled:checked, popover.background.touch-selection button.suggested-action.osd button:disabled:active, popover.background.magnifier button.suggested-action.osd button:disabled:active, popover.background.touch-selection button.suggested-action.osd button:disabled:checked, popover.background.magnifier button.suggested-action.osd button:disabled:checked,
+ button.suggested-action:disabled:active,
+ button.suggested-action:disabled:checked,
+ button.suggested-action.osd popover.background.touch-selection button:disabled:active,
+ popover.background.touch-selection button.suggested-action.osd button:disabled:active,
+ button.suggested-action.osd popover.background.magnifier button:disabled:active,
+ popover.background.magnifier button.suggested-action.osd button:disabled:active,
+ button.suggested-action.osd popover.background.touch-selection button:disabled:checked,
+ popover.background.touch-selection button.suggested-action.osd button:disabled:checked,
+ button.suggested-action.osd popover.background.magnifier button:disabled:checked,
+ popover.background.magnifier button.suggested-action.osd button:disabled:checked, popover.background.touch-selection button.suggested-action.osd
+ button:disabled:active, popover.background.magnifier button.suggested-action.osd
+ button:disabled:active, popover.background.touch-selection button.suggested-action.osd
+ button:disabled:checked, popover.background.magnifier button.suggested-action.osd
+ button:disabled:checked,
+ button.suggested-action.osd
+ button:disabled:active,
+ button.suggested-action.osd
+ button:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ popover.background.touch-selection button.suggested-action:disabled:active > .label, popover.background.magnifier button.suggested-action:disabled:active > .label, popover.background.touch-selection button.suggested-action:disabled:checked > .label, popover.background.magnifier button.suggested-action:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd button:disabled:active > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:disabled:active > .label, popover.background.magnifier button.suggested-action.osd button:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd button:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd popover.background.touch-selection button:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd popover.background.magnifier button:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd button:disabled:checked > .label,
+ button.suggested-action:disabled:active > .label,
+ button.suggested-action:disabled:checked > .label,
+ button.suggested-action.osd popover.background.touch-selection button:disabled:active > .label,
+ popover.background.touch-selection button.suggested-action.osd button:disabled:active > .label,
+ button.suggested-action.osd popover.background.magnifier button:disabled:active > .label,
+ popover.background.magnifier button.suggested-action.osd button:disabled:active > .label,
+ button.suggested-action.osd popover.background.touch-selection button:disabled:checked > .label,
+ popover.background.touch-selection button.suggested-action.osd button:disabled:checked > .label,
+ button.suggested-action.osd popover.background.magnifier button:disabled:checked > .label,
+ popover.background.magnifier button.suggested-action.osd button:disabled:checked > .label, popover.background.touch-selection button.suggested-action.osd
+ button:disabled:active > .label, popover.background.magnifier button.suggested-action.osd
+ button:disabled:active > .label, popover.background.touch-selection button.suggested-action.osd
+ button:disabled:checked > .label, popover.background.magnifier button.suggested-action.osd
+ button:disabled:checked > .label,
+ button.suggested-action.osd
+ button:disabled:active > .label,
+ button.suggested-action.osd
+ button:disabled:checked > .label {
+ color: inherit; }
+popover.background.touch-selection button.destructive-action, popover.background.magnifier button.destructive-action, popover.background.touch-selection button.destructive-action.osd button, popover.background.magnifier button.destructive-action.osd button,
+button.destructive-action,
+button.destructive-action.osd popover.background.touch-selection button,
+popover.background.touch-selection button.destructive-action.osd button,
+button.destructive-action.osd popover.background.magnifier button,
+popover.background.magnifier button.destructive-action.osd button, popover.background.touch-selection button.destructive-action.osd
+button, popover.background.magnifier button.destructive-action.osd
+button,
+button.destructive-action.osd
+button {
+ box-shadow: 1px 1px 1px rgba(0, 0, 0, 0.1);
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ border-color: #e74c3c;
+ background-image: linear-gradient(to bottom, #e74e3f, #e64534); }
+ popover.background.touch-selection button.destructive-action.flat, popover.background.magnifier button.destructive-action.flat, popover.background.touch-selection button.destructive-action.osd button.flat, popover.background.magnifier button.destructive-action.osd button.flat,
+ button.destructive-action.flat,
+ button.destructive-action.osd popover.background.touch-selection button.flat,
+ popover.background.touch-selection button.destructive-action.osd button.flat,
+ button.destructive-action.osd popover.background.magnifier button.flat,
+ popover.background.magnifier button.destructive-action.osd button.flat, popover.background.touch-selection button.destructive-action.osd
+ button.flat, popover.background.magnifier button.destructive-action.osd
+ button.flat,
+ button.destructive-action.osd
+ button.flat {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: #e74c3c; }
+ popover.background.touch-selection button.destructive-action:hover, popover.background.magnifier button.destructive-action:hover, popover.background.touch-selection button.destructive-action.osd button:hover, popover.background.magnifier button.destructive-action.osd button:hover,
+ button.destructive-action:hover,
+ button.destructive-action.osd popover.background.touch-selection button:hover,
+ popover.background.touch-selection button.destructive-action.osd button:hover,
+ button.destructive-action.osd popover.background.magnifier button:hover,
+ popover.background.magnifier button.destructive-action.osd button:hover, popover.background.touch-selection button.destructive-action.osd
+ button:hover, popover.background.magnifier button.destructive-action.osd
+ button:hover,
+ button.destructive-action.osd
+ button:hover {
+ color: white;
+ border-color: #e74c3c; }
+ popover.background.touch-selection button.destructive-action:active, popover.background.magnifier button.destructive-action:active, popover.background.touch-selection button.destructive-action:checked, popover.background.magnifier button.destructive-action:checked, popover.background.touch-selection button.destructive-action.osd button:active, popover.background.magnifier button.destructive-action.osd button:active, popover.background.touch-selection button.destructive-action.osd button:checked, popover.background.magnifier button.destructive-action.osd button:checked,
+ button.destructive-action:active,
+ button.destructive-action:checked,
+ button.destructive-action.osd popover.background.touch-selection button:active,
+ popover.background.touch-selection button.destructive-action.osd button:active,
+ button.destructive-action.osd popover.background.magnifier button:active,
+ popover.background.magnifier button.destructive-action.osd button:active,
+ button.destructive-action.osd popover.background.touch-selection button:checked,
+ popover.background.touch-selection button.destructive-action.osd button:checked,
+ button.destructive-action.osd popover.background.magnifier button:checked,
+ popover.background.magnifier button.destructive-action.osd button:checked, popover.background.touch-selection button.destructive-action.osd
+ button:active, popover.background.magnifier button.destructive-action.osd
+ button:active, popover.background.touch-selection button.destructive-action.osd
+ button:checked, popover.background.magnifier button.destructive-action.osd
+ button:checked,
+ button.destructive-action.osd
+ button:active,
+ button.destructive-action.osd
+ button:checked {
+ color: white;
+ border-color: #e74c3c;
+ background-image: linear-gradient(to bottom, #e85344, #e43624); }
+ popover.background.touch-selection button.destructive-action:backdrop, popover.background.magnifier button.destructive-action:backdrop, popover.background.touch-selection button.destructive-action.flat:backdrop, popover.background.magnifier button.destructive-action.flat:backdrop, popover.background.touch-selection button.destructive-action.osd button:backdrop, popover.background.magnifier button.destructive-action.osd button:backdrop, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop, popover.background.magnifier button.destructive-action.osd button.flat:backdrop,
+ button.destructive-action:backdrop,
+ button.destructive-action.flat:backdrop,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop,
+ button.destructive-action.osd popover.background.magnifier button:backdrop,
+ popover.background.magnifier button.destructive-action.osd button:backdrop,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop, popover.background.magnifier button.destructive-action.osd
+ button:backdrop, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop,
+ button.destructive-action.osd
+ button:backdrop,
+ button.destructive-action.osd
+ button.flat:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #e74e3f, #e64534); }
+ popover.background.touch-selection button.destructive-action:backdrop:active, popover.background.magnifier button.destructive-action:backdrop:active, popover.background.touch-selection button.destructive-action:backdrop:checked, popover.background.magnifier button.destructive-action:backdrop:checked, popover.background.touch-selection button.destructive-action.flat:backdrop:active, popover.background.magnifier button.destructive-action.flat:backdrop:active, popover.background.touch-selection button.destructive-action.flat:backdrop:checked, popover.background.magnifier button.destructive-action.flat:backdrop:checked, popover.background.touch-selection button.destructive-action.osd button:backdrop:active, popover.background.magnifier button.destructive-action.osd button:backdrop:active, popover.background.touch-selection button.destructive-action.osd button:backdrop:checked, popover.background.magnifier button.destructive-action.osd button:backdrop:checked, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:active, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:active, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:checked, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:checked,
+ button.destructive-action:backdrop:active,
+ button.destructive-action:backdrop:checked,
+ button.destructive-action.flat:backdrop:active,
+ button.destructive-action.flat:backdrop:checked,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:active,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:active,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:active,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:active,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:checked,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:checked,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:checked,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:checked,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:active,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:active,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:active,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:active,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:checked,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:checked,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:checked,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:checked, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:active, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:active, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:checked, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:checked, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:active, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:active, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:checked, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:checked,
+ button.destructive-action.osd
+ button:backdrop:active,
+ button.destructive-action.osd
+ button:backdrop:checked,
+ button.destructive-action.osd
+ button.flat:backdrop:active,
+ button.destructive-action.osd
+ button.flat:backdrop:checked {
+ color: white;
+ border-color: #e74c3c;
+ background-image: linear-gradient(to bottom, #e85344, #e43624); }
+ popover.background.touch-selection button.destructive-action:backdrop:disabled, popover.background.magnifier button.destructive-action:backdrop:disabled, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.flat:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled,
+ button.destructive-action:backdrop:disabled,
+ button.destructive-action.flat:backdrop:disabled,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled,
+ button.destructive-action.osd
+ button:backdrop:disabled,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ popover.background.touch-selection button.destructive-action:backdrop:disabled > .label, popover.background.magnifier button.destructive-action:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.flat:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled > .label,
+ button.destructive-action:backdrop:disabled > .label,
+ button.destructive-action.flat:backdrop:disabled > .label,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled > .label,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled > .label,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled > .label,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled > .label,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled > .label,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled > .label,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled > .label,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled > .label, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled > .label, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled > .label,
+ button.destructive-action.osd
+ button:backdrop:disabled > .label,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled > .label {
+ color: inherit; }
+ popover.background.touch-selection button.destructive-action:backdrop:disabled:active, popover.background.magnifier button.destructive-action:backdrop:disabled:active, popover.background.touch-selection button.destructive-action:backdrop:disabled:checked, popover.background.magnifier button.destructive-action:backdrop:disabled:checked, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled:active, popover.background.magnifier button.destructive-action.flat:backdrop:disabled:active, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled:checked, popover.background.magnifier button.destructive-action.flat:backdrop:disabled:checked, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:active, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:active, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:checked, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:checked, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:active, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:active, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:checked, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:checked,
+ button.destructive-action:backdrop:disabled:active,
+ button.destructive-action:backdrop:disabled:checked,
+ button.destructive-action.flat:backdrop:disabled:active,
+ button.destructive-action.flat:backdrop:disabled:checked,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:active,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:active,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:active,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:active,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:checked,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:checked,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:checked,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:checked,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:active,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:active,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:active,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:checked,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:checked, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled:active, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled:active, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled:checked, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled:checked, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled:active, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled:active, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled:checked, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled:checked,
+ button.destructive-action.osd
+ button:backdrop:disabled:active,
+ button.destructive-action.osd
+ button:backdrop:disabled:checked,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled:active,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(228, 54, 36, 0.35);
+ background-image: linear-gradient(to bottom, rgba(229, 61, 44, 0.35), rgba(214, 44, 26, 0.35)); }
+ popover.background.touch-selection button.destructive-action:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:checked > .label,
+ button.destructive-action:backdrop:disabled:active > .label,
+ button.destructive-action:backdrop:disabled:checked > .label,
+ button.destructive-action.flat:backdrop:disabled:active > .label,
+ button.destructive-action.flat:backdrop:disabled:checked > .label,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:active > .label,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:active > .label,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:active > .label,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:active > .label,
+ button.destructive-action.osd popover.background.touch-selection button:backdrop:disabled:checked > .label,
+ popover.background.touch-selection button.destructive-action.osd button:backdrop:disabled:checked > .label,
+ button.destructive-action.osd popover.background.magnifier button:backdrop:disabled:checked > .label,
+ popover.background.magnifier button.destructive-action.osd button:backdrop:disabled:checked > .label,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:active > .label,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:active > .label,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:active > .label,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:active > .label,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled:checked > .label,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled:checked > .label,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled:checked > .label,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd
+ button:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd
+ button:backdrop:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled:active > .label, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled:checked > .label,
+ button.destructive-action.osd
+ button:backdrop:disabled:active > .label,
+ button.destructive-action.osd
+ button:backdrop:disabled:checked > .label,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled:active > .label,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled:checked > .label {
+ color: inherit; }
+ popover.background.touch-selection button.destructive-action.flat:backdrop, popover.background.magnifier button.destructive-action.flat:backdrop, popover.background.touch-selection button.destructive-action.flat:disabled, popover.background.magnifier button.destructive-action.flat:disabled, popover.background.touch-selection button.destructive-action.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.flat:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop, popover.background.magnifier button.destructive-action.osd button.flat:backdrop, popover.background.touch-selection button.destructive-action.osd button.flat:disabled, popover.background.magnifier button.destructive-action.osd button.flat:disabled, popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled,
+ button.destructive-action.flat:backdrop,
+ button.destructive-action.flat:disabled,
+ button.destructive-action.flat:backdrop:disabled,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop,
+ button.destructive-action.osd popover.background.touch-selection button.flat:disabled,
+ popover.background.touch-selection button.destructive-action.osd button.flat:disabled,
+ button.destructive-action.osd popover.background.magnifier button.flat:disabled,
+ popover.background.magnifier button.destructive-action.osd button.flat:disabled,
+ button.destructive-action.osd popover.background.touch-selection button.flat:backdrop:disabled,
+ popover.background.touch-selection button.destructive-action.osd button.flat:backdrop:disabled,
+ button.destructive-action.osd popover.background.magnifier button.flat:backdrop:disabled,
+ popover.background.magnifier button.destructive-action.osd button.flat:backdrop:disabled, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop, popover.background.touch-selection button.destructive-action.osd
+ button.flat:disabled, popover.background.magnifier button.destructive-action.osd
+ button.flat:disabled, popover.background.touch-selection button.destructive-action.osd
+ button.flat:backdrop:disabled, popover.background.magnifier button.destructive-action.osd
+ button.flat:backdrop:disabled,
+ button.destructive-action.osd
+ button.flat:backdrop,
+ button.destructive-action.osd
+ button.flat:disabled,
+ button.destructive-action.osd
+ button.flat:backdrop:disabled {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: rgba(231, 76, 60, 0.8); }
+ popover.background.touch-selection button.destructive-action:disabled, popover.background.magnifier button.destructive-action:disabled, popover.background.touch-selection button.destructive-action.osd button:disabled, popover.background.magnifier button.destructive-action.osd button:disabled,
+ button.destructive-action:disabled,
+ button.destructive-action.osd popover.background.touch-selection button:disabled,
+ popover.background.touch-selection button.destructive-action.osd button:disabled,
+ button.destructive-action.osd popover.background.magnifier button:disabled,
+ popover.background.magnifier button.destructive-action.osd button:disabled, popover.background.touch-selection button.destructive-action.osd
+ button:disabled, popover.background.magnifier button.destructive-action.osd
+ button:disabled,
+ button.destructive-action.osd
+ button:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ popover.background.touch-selection button.destructive-action:disabled > .label, popover.background.magnifier button.destructive-action:disabled > .label, popover.background.touch-selection button.destructive-action.osd button:disabled > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:disabled > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:disabled > .label, popover.background.magnifier button.destructive-action.osd button:disabled > .label,
+ button.destructive-action:disabled > .label,
+ button.destructive-action.osd popover.background.touch-selection button:disabled > .label,
+ popover.background.touch-selection button.destructive-action.osd button:disabled > .label,
+ button.destructive-action.osd popover.background.magnifier button:disabled > .label,
+ popover.background.magnifier button.destructive-action.osd button:disabled > .label, popover.background.touch-selection button.destructive-action.osd
+ button:disabled > .label, popover.background.magnifier button.destructive-action.osd
+ button:disabled > .label,
+ button.destructive-action.osd
+ button:disabled > .label {
+ color: inherit; }
+ popover.background.touch-selection button.destructive-action:disabled:active, popover.background.magnifier button.destructive-action:disabled:active, popover.background.touch-selection button.destructive-action:disabled:checked, popover.background.magnifier button.destructive-action:disabled:checked, popover.background.touch-selection button.destructive-action.osd button:disabled:active, popover.background.magnifier button.destructive-action.osd button:disabled:active, popover.background.touch-selection button.destructive-action.osd button:disabled:checked, popover.background.magnifier button.destructive-action.osd button:disabled:checked,
+ button.destructive-action:disabled:active,
+ button.destructive-action:disabled:checked,
+ button.destructive-action.osd popover.background.touch-selection button:disabled:active,
+ popover.background.touch-selection button.destructive-action.osd button:disabled:active,
+ button.destructive-action.osd popover.background.magnifier button:disabled:active,
+ popover.background.magnifier button.destructive-action.osd button:disabled:active,
+ button.destructive-action.osd popover.background.touch-selection button:disabled:checked,
+ popover.background.touch-selection button.destructive-action.osd button:disabled:checked,
+ button.destructive-action.osd popover.background.magnifier button:disabled:checked,
+ popover.background.magnifier button.destructive-action.osd button:disabled:checked, popover.background.touch-selection button.destructive-action.osd
+ button:disabled:active, popover.background.magnifier button.destructive-action.osd
+ button:disabled:active, popover.background.touch-selection button.destructive-action.osd
+ button:disabled:checked, popover.background.magnifier button.destructive-action.osd
+ button:disabled:checked,
+ button.destructive-action.osd
+ button:disabled:active,
+ button.destructive-action.osd
+ button:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(229, 61, 44, 0.35), rgba(214, 44, 26, 0.35)); }
+ popover.background.touch-selection button.destructive-action:disabled:active > .label, popover.background.magnifier button.destructive-action:disabled:active > .label, popover.background.touch-selection button.destructive-action:disabled:checked > .label, popover.background.magnifier button.destructive-action:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd button:disabled:active > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:disabled:active > .label, popover.background.magnifier button.destructive-action.osd button:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd button:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd popover.background.touch-selection button:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd popover.background.magnifier button:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd button:disabled:checked > .label,
+ button.destructive-action:disabled:active > .label,
+ button.destructive-action:disabled:checked > .label,
+ button.destructive-action.osd popover.background.touch-selection button:disabled:active > .label,
+ popover.background.touch-selection button.destructive-action.osd button:disabled:active > .label,
+ button.destructive-action.osd popover.background.magnifier button:disabled:active > .label,
+ popover.background.magnifier button.destructive-action.osd button:disabled:active > .label,
+ button.destructive-action.osd popover.background.touch-selection button:disabled:checked > .label,
+ popover.background.touch-selection button.destructive-action.osd button:disabled:checked > .label,
+ button.destructive-action.osd popover.background.magnifier button:disabled:checked > .label,
+ popover.background.magnifier button.destructive-action.osd button:disabled:checked > .label, popover.background.touch-selection button.destructive-action.osd
+ button:disabled:active > .label, popover.background.magnifier button.destructive-action.osd
+ button:disabled:active > .label, popover.background.touch-selection button.destructive-action.osd
+ button:disabled:checked > .label, popover.background.magnifier button.destructive-action.osd
+ button:disabled:checked > .label,
+ button.destructive-action.osd
+ button:disabled:active > .label,
+ button.destructive-action.osd
+ button:disabled:checked > .label {
+ color: inherit; }
+popover.background.touch-selection .stack-switcher > button > label, popover.background.magnifier .stack-switcher > button > label, .stack-switcher >
+button > label {
+ padding-left: 6px;
+ padding-right: 6px; }
+popover.background.touch-selection .stack-switcher > button > image, popover.background.magnifier .stack-switcher > button > image, .stack-switcher >
+button > image {
+ padding-left: 6px;
+ padding-right: 6px;
+ padding-top: 3px;
+ padding-bottom: 3px; }
+popover.background.touch-selection .stack-switcher > button.text-button, popover.background.magnifier .stack-switcher > button.text-button, .stack-switcher >
+button.text-button {
+ padding: 6px; }
+popover.background.touch-selection .stack-switcher > button.image-button, popover.background.magnifier .stack-switcher > button.image-button, .stack-switcher >
+button.image-button {
+ padding: 3px 0px; }
+popover.background.touch-selection .stack-switcher > button.needs-attention:active > label, popover.background.magnifier .stack-switcher > button.needs-attention:active > label, popover.background.touch-selection .stack-switcher > button.needs-attention:active > image, popover.background.magnifier .stack-switcher > button.needs-attention:active > image, popover.background.touch-selection .stack-switcher > button.needs-attention:checked > label, popover.background.magnifier .stack-switcher > button.needs-attention:checked > label, popover.background.touch-selection .stack-switcher > button.needs-attention:checked > image, popover.background.magnifier .stack-switcher > button.needs-attention:checked > image, .stack-switcher >
+button.needs-attention:active > label, .stack-switcher >
+button.needs-attention:active > image, .stack-switcher >
+button.needs-attention:checked > label, .stack-switcher >
+button.needs-attention:checked > image {
+ animation: none;
+ background-image: none; }
+.inline-toolbar popover.background.touch-selection button, popover.background.touch-selection .inline-toolbar button, .inline-toolbar popover.background.magnifier button, popover.background.magnifier .inline-toolbar button, .inline-toolbar popover.background.touch-selection button:backdrop, popover.background.touch-selection .inline-toolbar button:backdrop, .inline-toolbar popover.background.magnifier button:backdrop, popover.background.magnifier .inline-toolbar button:backdrop, .inline-toolbar
+button, .inline-toolbar
+button:backdrop {
+ border-radius: 3px;
+ border-width: 1px; }
+.primary-toolbar popover.background.touch-selection button, popover.background.touch-selection .primary-toolbar button, .primary-toolbar popover.background.magnifier button, popover.background.magnifier .primary-toolbar button, .primary-toolbar
+button {
+ -gtk-icon-shadow: none; }
+
+/**************
+ * ComboBoxes *
+ **************/
+combobox arrow {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic");
+ min-height: 16px;
+ min-width: 16px; }
+
+popover.background.touch-selection .stack-switcher > button.needs-attention > label, popover.background.magnifier .stack-switcher > button.needs-attention > label, popover.background.touch-selection .stack-switcher > button.needs-attention > image, popover.background.magnifier .stack-switcher > button.needs-attention > image, .stack-switcher >
+button.needs-attention > label, .stack-switcher >
+button.needs-attention > image, stacksidebar.sidebar row.needs-attention > .label {
+ animation: needs_attention 150ms ease-in;
+ background-image: -gtk-gradient(radial, center center, 0, center center, 0.5, to(#FF5F57), to(transparent)), -gtk-gradient(radial, center center, 0, center center, 0.5, to(white), to(transparent));
+ background-size: 6px 6px, 6px 6px;
+ background-repeat: no-repeat;
+ background-position: right 3px, right 4px; }
+ .stack-switcher >
+ button.needs-attention > label:backdrop, .stack-switcher >
+ button.needs-attention > image:backdrop, stacksidebar.sidebar row.needs-attention > .label:backdrop {
+ background-size: 6px 6px, 0 0; }
+ .stack-switcher >
+ button.needs-attention > label:dir(rtl), .stack-switcher >
+ button.needs-attention > image:dir(rtl), stacksidebar.sidebar row.needs-attention > .label:dir(rtl) {
+ background-position: left 3px, left 4px; }
+
+.linked > combobox > box > button.combo:dir(ltr), .linked > combobox > box > button.combo:dir(rtl), .inline-toolbar popover.background.touch-selection button, popover.background.touch-selection .inline-toolbar button, .inline-toolbar popover.background.magnifier button, popover.background.magnifier .inline-toolbar button, .inline-toolbar
+button, .inline-toolbar
+button:backdrop, popover.background.touch-selection .linked > button, popover.background.magnifier .linked > button, .linked >
+button, .linked >
+button:hover, .linked >
+button:active, .linked >
+button:checked, .linked >
+button:backdrop {
+ border-radius: 3px; }
+ .linked > combobox > box > button.combo:dir(rtl), .inline-toolbar popover.background.touch-selection button:dir(rtl), popover.background.touch-selection .inline-toolbar button:dir(rtl), .inline-toolbar popover.background.magnifier button:dir(rtl), popover.background.magnifier .inline-toolbar button:dir(rtl), .inline-toolbar
+ button:dir(rtl), popover.background.touch-selection .linked > button:dir(rtl), popover.background.magnifier .linked > button:dir(rtl), .linked >
+ button:dir(rtl) {
+ border-radius: 3px; }
+
+.inline-toolbar popover.background.touch-selection button, popover.background.touch-selection .inline-toolbar button, .inline-toolbar popover.background.magnifier button, popover.background.magnifier .inline-toolbar button, .inline-toolbar
+button, .inline-toolbar
+button:backdrop, popover.background.touch-selection .linked > button, popover.background.magnifier .linked > button, .linked >
+button, .linked >
+button:hover, .linked >
+button:active, .linked >
+button:checked, .linked >
+button:backdrop {
+ margin-left: 2px;
+ margin-right: 2px; }
+ .inline-toolbar popover.background.touch-selection button:first-child, popover.background.touch-selection .inline-toolbar button:first-child, .inline-toolbar popover.background.magnifier button:first-child, popover.background.magnifier .inline-toolbar button:first-child, .inline-toolbar
+ button:first-child, popover.background.touch-selection .linked > button:first-child, popover.background.magnifier .linked > button:first-child, .linked >
+ button:first-child, combobox.linked button:nth-child(2):dir(rtl), .linked:not(.vertical) > combobox:first-child > box > button.combo {
+ border-radius: 3px;
+ border-style: solid; }
+ .inline-toolbar popover.background.touch-selection button:last-child, popover.background.touch-selection .inline-toolbar button:last-child, .inline-toolbar popover.background.magnifier button:last-child, popover.background.magnifier .inline-toolbar button:last-child, .inline-toolbar
+ button:last-child, popover.background.touch-selection .linked > button:last-child, popover.background.magnifier .linked > button:last-child, .linked >
+ button:last-child, combobox.linked button:nth-child(2):dir(ltr), .linked:not(.vertical) > combobox:last-child > box > button.combo {
+ border-radius: 3px; }
+ .inline-toolbar popover.background.touch-selection button:only-child, popover.background.touch-selection .inline-toolbar button:only-child, .inline-toolbar popover.background.magnifier button:only-child, popover.background.magnifier .inline-toolbar button:only-child, .inline-toolbar
+ button:only-child, popover.background.touch-selection .linked > button:only-child, popover.background.magnifier .linked > button:only-child, .linked >
+ button:only-child, .linked:not(.vertical) > combobox:only-child > box > button.combo {
+ border-radius: 3px;
+ border-style: solid; }
+
+.linked.vertical > combobox > box > button.combo, popover.background.touch-selection .linked.vertical > button, popover.background.magnifier .linked.vertical > button, .linked.vertical >
+button, .linked.vertical >
+button:hover, .linked.vertical >
+button:active, .linked.vertical >
+button:checked, .linked.vertical >
+button:backdrop {
+ border-style: solid;
+ border-radius: 3px; }
+
+popover.background.touch-selection .linked.vertical > button:first-child, popover.background.magnifier .linked.vertical > button:first-child, .linked.vertical >
+button:first-child, .linked.vertical > combobox:first-child > box > button.combo {
+ border-radius: 3px; }
+popover.background.touch-selection .linked.vertical > button:last-child, popover.background.magnifier .linked.vertical > button:last-child, .linked.vertical >
+button:last-child, .linked.vertical > combobox:last-child > box > button.combo {
+ border-radius: 3px;
+ border-style: solid; }
+popover.background.touch-selection .linked.vertical > button:only-child, popover.background.magnifier .linked.vertical > button:only-child, .linked.vertical >
+button:only-child, .linked.vertical > combobox:only-child > box > button.combo {
+ border-radius: 3px;
+ border-style: solid; }
+
+.app-notification button.flat,
+.app-notification.frame button.flat, .app-notification button.flat:hover,
+.app-notification.frame button.flat:hover, .app-notification button.flat:active,
+.app-notification.frame button.flat:active, .app-notification button.flat:backdrop, .app-notification button.flat:disabled, .app-notification button.flat:backdrop:disabled,
+.app-notification.frame button.flat:backdrop,
+.app-notification.frame button.flat:disabled,
+.app-notification.frame button.flat:backdrop:disabled, calendar.button, calendar.button:hover, calendar.button:active, calendar.button:backdrop,
+headerbar button.flat:disabled, button:link,
+button:visited, button:link:hover, button:link:active, button:link:checked,
+button:visited:hover,
+button:visited:active,
+button:visited:checked, modelbutton.flat, popover.background checkbutton,
+popover.background radiobutton,
+.menuitem.button.flat, modelbutton.flat:backdrop, popover.background checkbutton:backdrop,
+popover.background radiobutton:backdrop, modelbutton.flat:backdrop:hover, popover.background checkbutton:backdrop:hover,
+popover.background radiobutton:backdrop:hover,
+.menuitem.button.flat:backdrop,
+.menuitem.button.flat:backdrop:hover, scrollbar button:backdrop, button.sidebar-button {
+ border-color: transparent;
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+
+/****************
+ * Text Entries *
+ ****************/
+spinbutton:not(.vertical),
+entry {
+ min-height: 30px;
+ padding-left: 8px;
+ padding-right: 8px;
+ border: 1px solid;
+ border-radius: 3px;
+ transition: all 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34;
+ box-shadow: none; }
+ spinbutton:not(.vertical) image.left,
+ entry image.left {
+ padding-left: 0;
+ padding-right: 6px; }
+ spinbutton:not(.vertical) image.right,
+ entry image.right {
+ padding-left: 6px;
+ padding-right: 0; }
+ spinbutton.flat:focus:not(.vertical), spinbutton.flat:not(.vertical),
+ entry.flat:focus,
+ entry.flat {
+ min-height: 0;
+ padding: 2px;
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34;
+ box-shadow: none; }
+ spinbutton:focus:not(.vertical),
+ entry:focus {
+ border-color: #FF5F57; }
+ spinbutton:disabled:not(.vertical),
+ entry:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-color: #252b2f; }
+ spinbutton:backdrop:not(.vertical),
+ entry:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34; }
+ spinbutton:backdrop:disabled:not(.vertical),
+ entry:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-color: #252b2f; }
+ spinbutton.error:not(.vertical),
+ entry.error {
+ color: #e74c3c;
+ border-color: #e74c3c;
+ background-color: rgba(231, 76, 60, 0.5); }
+ spinbutton.error:focus:not(.vertical),
+ entry.error:focus {
+ border-color: #e74c3c;
+ background-color: rgba(231, 76, 60, 0.5); }
+ spinbutton.error:selected:not(.vertical), spinbutton.error:selected:focus:not(.vertical),
+ entry.error:selected,
+ entry.error:selected:focus {
+ background-color: #e74c3c; }
+ spinbutton.error:backdrop:not(.vertical),
+ entry.error:backdrop {
+ color: #e74c3c;
+ border-color: #e74c3c;
+ background-color: rgba(231, 76, 60, 0.5); }
+ spinbutton.warning:not(.vertical),
+ entry.warning {
+ color: #e67e22;
+ border-color: #e67e22;
+ background-color: rgba(230, 126, 34, 0.5); }
+ spinbutton.warning:focus:not(.vertical),
+ entry.warning:focus {
+ border-color: #e67e22;
+ background-color: rgba(230, 126, 34, 0.5); }
+ spinbutton.warning:selected:not(.vertical), spinbutton.warning:selected:focus:not(.vertical),
+ entry.warning:selected,
+ entry.warning:selected:focus {
+ background-color: #e67e22; }
+ spinbutton.warning:backdrop:not(.vertical),
+ entry.warning:backdrop {
+ color: #e67e22;
+ border-color: #e67e22;
+ background-color: rgba(230, 126, 34, 0.5); }
+ spinbutton:not(.vertical) image,
+ entry image {
+ color: white; }
+ spinbutton:not(.vertical) image:hover,
+ entry image:hover {
+ color: #FF5F57; }
+ spinbutton:not(.vertical) image:active,
+ entry image:active {
+ color: #FF5F57; }
+ spinbutton:not(.vertical) image:backdrop,
+ entry image:backdrop {
+ color: white; }
+spinbutton:not(.vertical) progress,
+entry progress {
+ margin: 1px;
+ border-radius: 0;
+ border-width: 0 0 2px;
+ border-color: #FF5F57;
+ border-style: solid;
+ background-image: none;
+ background-color: transparent;
+ box-shadow: none; }
+ spinbutton:not(.vertical) progress:backdrop,
+ entry progress:backdrop {
+ background-color: transparent;
+ border-color: rgba(255, 95, 87, 0.5); }
+
+treeview acceleditor > label {
+ background-color: #FF5F57; }
+
+treeview entry.flat, treeview entry {
+ border-radius: 0;
+ background-image: none;
+ background-color: #292f34; }
+ treeview entry.flat:focus, treeview entry:focus {
+ border-color: #FF5F57; }
+
+/*********************
+ * App Notifications *
+ *********************/
+.app-notification,
+.app-notification.frame {
+ padding: 10px;
+ border-top-width: 0px;
+ border-radius: 0px 0px 3px 3px; }
+ .app-notification:backdrop,
+ .app-notification.frame:backdrop {
+ background-image: none; }
+ .app-notification button,
+ .app-notification.frame button {
+ box-shadow: 1px 1px 1px rgba(0, 0, 0, 0.1);
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32); }
+ .app-notification button.flat,
+ .app-notification.frame button.flat {
+ -gtk-icon-shadow: none;
+ text-shadow: none; }
+ .app-notification button.flat:hover,
+ .app-notification.frame button.flat:hover {
+ color: #FF5F57; }
+ .app-notification button.flat:active,
+ .app-notification.frame button.flat:active {
+ color: #FF5F57; }
+ .app-notification button:hover,
+ .app-notification.frame button:hover {
+ color: white;
+ border-color: #FF5F57; }
+ .app-notification button:active, .app-notification button:checked, .app-notification button:backdrop:active, .app-notification button:backdrop:checked,
+ .app-notification.frame button:active,
+ .app-notification.frame button:checked,
+ .app-notification.frame button:backdrop:active,
+ .app-notification.frame button:backdrop:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ .app-notification button:disabled, .app-notification button:backdrop:disabled,
+ .app-notification.frame button:disabled,
+ .app-notification.frame button:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: linear-gradient(to bottom, #262b30, #24292e); }
+ .app-notification button:disabled > .label, .app-notification button:backdrop:disabled > .label,
+ .app-notification.frame button:disabled > .label,
+ .app-notification.frame button:backdrop:disabled > .label {
+ color: inherit; }
+ .app-notification button:backdrop,
+ .app-notification.frame button:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32); }
+ .app-notification border,
+ .app-notification.frame border {
+ border: none; }
+
+/************
+ * Calendar *
+ ***********/
+calendar {
+ color: white;
+ border: 1px solid #5f6367;
+ background-color: #292f34; }
+ calendar:selected {
+ background-color: #5f6367; }
+ calendar.header {
+ border: 1px solid #5f6367;
+ border-radius: 0;
+ color: white; }
+ calendar.header:backdrop {
+ color: white;
+ border-color: #5f6367; }
+ calendar.button {
+ color: white; }
+ calendar.button:hover {
+ color: #FF5F57; }
+ calendar.button:active {
+ color: #FF5F57; }
+ calendar.button:backdrop {
+ color: white; }
+ calendar:indeterminate, calendar.highlight {
+ color: rgba(255, 255, 255, 0.5); }
+ calendar:indeterminate:backdrop, calendar.highlight:backdrop {
+ color: rgba(255, 255, 255, 0.5); }
+ calendar:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34; }
+
+/*************************
+ * Check and Radio items *
+ *************************/
+checkbutton.text-button, radiobutton.text-button {
+ padding: 2px 0;
+ outline-offset: 0; }
+ checkbutton.text-button label:not(:only-child):first-child, radiobutton.text-button label:not(:only-child):first-child {
+ margin-left: 4px; }
+ checkbutton.text-button label:not(:only-child):last-child, radiobutton.text-button label:not(:only-child):last-child {
+ margin-right: 4px; }
+
+check {
+ margin: 0 4px;
+ min-height: 18px;
+ min-width: 18px;
+ animation: none;
+ background-color: #FFFFFF;
+ color: #292f34
+}
+
+radio {
+ margin: 0 4px;
+ min-height: 18px;
+ min-width: 18px;
+ animation: none;
+ background-color: transparent;
+}
+
+/*****************
+ * Color Chooser *
+ *****************/
+:selected colorswatch {
+ box-shadow: none; }
+ :selected colorswatch.overlay, :selected colorswatch.overlay:hover {
+ border-color: white; }
+colorswatch:selected {
+ box-shadow: none; }
+colorswatch.top, colorswatch.bottom, colorswatch.left, colorswatch:first-child:not(.overlay):not(.top), colorswatch.right, colorswatch:last-child:not(.overlay):not(.bottom), colorswatch:only-child:not(.overlay), colorswatch.top > .overlay, colorswatch.bottom > .overlay, colorswatch:first-child:not(.top) > .overlay, colorswatch:last-child:not(.bottom) > .overlay, colorswatch:only-child > .overlay {
+ border-radius: 3px; }
+colorswatch:hover, colorswatch:hover:selected {
+ background-image: linear-gradient(135deg, rgba(255, 255, 255, 0.7), rgba(255, 255, 255, 0) 50%);
+ box-shadow: inset 0 1px rgba(255, 255, 255, 0.4); }
+ colorswatch:hover.color-dark, colorswatch:hover:selected.color-dark {
+ background-image: linear-gradient(135deg, rgba(255, 255, 255, 0.5), rgba(255, 255, 255, 0) 50%); }
+colorswatch:backdrop, colorswatch:backdrop:selected
+colorswatch.color-dark:backdrop, colorswatch.color-dark:backdrop:selected {
+ background-image: none;
+ box-shadow: none; }
+GtkColorEditor colorswatch {
+ border-radius: 3px; }
+ GtkColorEditor colorswatch:hover {
+ background-image: none;
+ box-shadow: none; }
+ GtkColorEditor colorswatch:backdrop {
+ box-shadow: none; }
+colorswatch.color-dark {
+ color: white;
+ outline-color: rgba(0, 0, 0, 0.3); }
+ colorswatch.color-dark:backdrop {
+ color: rgba(255, 255, 255, 0.3); }
+colorswatch.color-light {
+ color: black;
+ outline-color: rgba(255, 255, 255, 0.5); }
+ colorswatch.color-light:backdrop {
+ color: rgba(0, 0, 0, 0.3); }
+colorswatch overlay,
+colorswatch overlay:selected {
+ border: 1px solid #5f6367; }
+ colorswatch overlay:hover,
+ colorswatch overlay:selected:hover {
+ border-color: #FF5F57; }
+colorswatch#add-color-button {
+ border-style: solid;
+ border-width: 1px;
+ box-shadow: 1px 1px 1px rgba(0, 0, 0, 0.1);
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32); }
+ colorswatch#add-color-button:hover {
+ color: white;
+ border-color: #FF5F57; }
+ colorswatch#add-color-button:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-image: linear-gradient(to bottom, #292f35, #282e32); }
+ colorswatch#add-color-button overlay {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+
+GtkColorButton.button {
+ padding: 5px; }
+ GtkColorButton.button GtkColorSwatch:first-child:last-child {
+ border-radius: 0;
+ box-shadow: none; }
+ GtkColorButton.button GtkColorSwatch:first-child:last-child:disabled, GtkColorButton.button GtkColorSwatch:first-child:last-child:backdrop {
+ box-shadow: none; }
+
+/***********
+ * Dialogs *
+ ***********/
+messagedialog.background {
+ background-color: #292f34; }
+messagedialog:backdrop {
+ background-color: #292f34; }
+messagedialog .titlebar {
+ min-height: 32px;
+ background-color: transparent;
+ background-image: linear-gradient(to bottom, #31383e, #292f34);
+ box-shadow: none; }
+messagedialog .dialog-action-area {
+ padding: 8px; }
+messagedialog button {
+ margin: 2px; }
+
+filechooser .search-bar {
+ background-color: #292f34;
+ border-color: #292f34;
+ box-shadow: none; }
+ filechooser .search-bar:backdrop {
+ background-color: #292f34;
+ border-color: #292f34;
+ color: white; }
+filechooser .dialog-action-box {
+ border-top: 1px solid #5f6367; }
+ filechooser .dialog-action-box:backdrop {
+ border-top-color: #5f6367; }
+filechooser #pathbarbox {
+ background-color: #292f34;
+ border-bottom: 1px solid #5f6367; }
+
+/***************
+ * Header bars *
+ ***************/
+headerbar {
+ transition: none;
+ padding: 0px 6px;
+ border-width: 0px 0px 1px 0px;
+ border-radius: 3px 3px 0px 0px;
+ border-style: solid;
+ border-color: #FF5F57;
+ color: white;
+ background-image: linear-gradient(to bottom, #31383e, #292f34); }
+ headerbar:backdrop {
+ border-color: transparent;
+ background-image: none;
+ background-color: #292f34;
+ color: #828282;
+ box-shadow: none; }
+ headerbar label {
+ font-weight: normal; }
+ headerbar label:backdrop {
+ color: #828282; }
+ headerbar .path-bar button {
+ color: white;
+ font-weight: normal; }
+ headerbar .path-bar button:backdrop {
+ color: #828282; }
+ headerbar button {
+ transition: none;
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+ headerbar button.flat {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+ headerbar button:hover {
+ color: white;
+ border-color: #FF5F57; }
+ headerbar button:hover:backdrop {
+ border-color: #292f34; }
+ headerbar button:active,
+ headerbar button:checked {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ headerbar button:active:hover,
+ headerbar button:checked:hover {
+ color: white;
+ border-color: #FF5F57;
+ background-image: linear-gradient(to bottom, #FF5F57, #FF5F57); }
+ headerbar button:active:backdrop,
+ headerbar button:checked:backdrop {
+ background-image: none;
+ background-color: #292f34;
+ border-color: #292f34;
+ color: #828282; }
+ headerbar button:backdrop {
+ border-color: transparent;
+ background-image: none;
+ background-color: #292f34;
+ color: #828282; }
+ headerbar button.flat:backdrop,
+ headerbar button.flat:backdrop:disabled,
+ headerbar button:disabled:backdrop {
+ background-image: none;
+ background-color: #292f34;
+ color: #828282;
+ border-color: transparent; }
+ headerbar button.flat:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ headerbar button:disabled {
+ background-color: transparent;
+ background-image: none;
+ border-color: transparent;
+ color: rgba(232, 232, 232, 0.35); }
+ headerbar button:disabled:active,
+ headerbar button:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ headerbar button:disabled:active > .label,
+ headerbar button:disabled:checked > .label {
+ color: inherit; }
+ headerbar .title {
+ font-weight: normal;
+ padding: 0px 12px; }
+ headerbar .title:backdrop {
+ color: #828282; }
+ headerbar .subtitle {
+ font-size: smaller;
+ padding: 0 12px; }
+ headerbar .subtitle:backdrop {
+ color: #828282; }
+ headerbar separator {
+ border-width: 0px;
+ background-color: transparent;
+ background-image: none;
+ border-color: transparent; }
+ headerbar.selection-mode .selection-menu {
+ padding: 4px 6px; }
+ headerbar.selection-mode .selection-menu GtkArrow {
+ -GtkArrow-arrow-scaling: 1; }
+ headerbar.selection-mode .selection-menu .arrow {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic");
+ -gtk-icon-shadow: none; }
+ .tiled
+ headerbar, .maximized
+ headerbar {
+ border-radius: 0; }
+
+headerbar entry,
+headerbar spinbutton,
+headerbar separator,
+headerbar button {
+ margin-top: 3px;
+ margin-bottom: 3px; }
+
+headerbar button.suggested-action,
+headerbar.selection-mode.suggested-action {
+ background-image: none;
+ background-color: #FF5F57; }
+ headerbar button.suggested-action:hover,
+ headerbar.selection-mode.suggested-action:hover {
+ background-color: #FF5F57;
+ color: white; }
+ headerbar button.suggested-action:disabled,
+ headerbar.selection-mode.suggested-action:disabled {
+ background-color: transparent;
+ background-image: none;
+ color: rgba(232, 232, 232, 0.35); }
+ headerbar button.suggested-action:disabled:active,
+ headerbar.selection-mode.suggested-action:disabled:active,
+ headerbar button.suggested-action:disabled:checked,
+ headerbar.selection-mode.suggested-action:disabled:checked {
+ color: rgba(232, 232, 232, 0.35);
+ border-color: rgba(24, 171, 142, 0.35);
+ background-image: linear-gradient(to bottom, rgba(255, 95, 87, 0.35), rgba(255, 95, 87, 0.35)); }
+ headerbar button.suggested-action:disabled:active > .label,
+ headerbar.selection-mode.suggested-action:disabled:active > .label,
+ headerbar button.suggested-action:disabled:checked > .label,
+ headerbar.selection-mode.suggested-action:disabled:checked > .label {
+ color: inherit; }
+ headerbar button.suggested-action:backdrop,
+ headerbar.selection-mode.suggested-action:backdrop {
+ background-color: #292f34;
+ border-color: transparent;
+ color: #828282; }
+ headerbar button.suggested-action:backdrop:disabled,
+ headerbar.selection-mode.suggested-action:backdrop:disabled {
+ color: rgba(118, 118, 118, 0.35); }
+
+/**************
+ * GtkInfoBar *
+ **************/
+infobar {
+ border-style: none;
+ border-bottom: 1px solid #5f6367;
+ background-color: #292f34;
+ background-image: none; }
+ infobar:backdrop {
+ border-bottom: 1px solid #5f6367; }
+
+.info,
+headerbar.selection-mode,
+.question,
+.warning,
+.error {
+ background-color: #292f34;
+ background-image: none;
+ color: #e67e22;
+ text-shadow: none; }
+ .info:backdrop,
+ headerbar.selection-mode:backdrop,
+ .question:backdrop,
+ .warning:backdrop,
+ .error:backdrop {
+ background-color: #292f34;
+ color: #e67e22; }
+ .info button,
+ headerbar.selection-mode button,
+ .question button,
+ .warning button,
+ .error button {
+ box-shadow: none;
+ background-image: none;
+ background-color: rgba(230, 126, 34, 0.5);
+ border-color: rgba(230, 126, 34, 0.5);
+ color: white; }
+ .info button:hover,
+ headerbar.selection-mode button:hover,
+ .question button:hover,
+ .warning button:hover,
+ .error button:hover {
+ background-color: rgba(230, 126, 34, 0.25);
+ border-color: #e67e22; }
+ .info button:active,
+ headerbar.selection-mode button:active, .info button:checked,
+ headerbar.selection-mode button:checked,
+ .question button:active,
+ .question button:checked,
+ .warning button:active,
+ .warning button:checked,
+ .error button:active,
+ .error button:checked {
+ background-image: linear-gradient(to bottom, #e67f24, #e57a1b);
+ color: #292f34;
+ border-color: #e67e22; }
+ .info button:disabled,
+ headerbar.selection-mode button:disabled,
+ .question button:disabled,
+ .warning button:disabled,
+ .error button:disabled {
+ background-color: rgba(216, 114, 24, 0);
+ border-color: rgba(216, 114, 24, 0);
+ color: rgba(232, 232, 232, 0.35); }
+ .info button:backdrop,
+ headerbar.selection-mode button:backdrop,
+ .question button:backdrop,
+ .warning button:backdrop,
+ .error button:backdrop {
+ background-color: rgba(230, 126, 34, 0.5);
+ border-color: rgba(230, 126, 34, 0.5);
+ color: white; }
+ .info button:backdrop:active,
+ headerbar.selection-mode button:backdrop:active, .info button:backdrop:checked,
+ headerbar.selection-mode button:backdrop:checked,
+ .question button:backdrop:active,
+ .question button:backdrop:checked,
+ .warning button:backdrop:active,
+ .warning button:backdrop:checked,
+ .error button:backdrop:active,
+ .error button:backdrop:checked {
+ background-image: linear-gradient(to bottom, #e67f24, #e57a1b);
+ color: #292f34;
+ border-color: #e67e22; }
+ .info button:backdrop:disabled,
+ headerbar.selection-mode button:backdrop:disabled,
+ .question button:backdrop:disabled,
+ .warning button:backdrop:disabled,
+ .error button:backdrop:disabled {
+ background-color: rgba(216, 114, 24, 0);
+ border-color: rgba(216, 114, 24, 0);
+ color: rgba(232, 232, 232, 0.35); }
+ .info button:backdrop:disabled:active,
+ headerbar.selection-mode button:backdrop:disabled:active, .info button:backdrop:disabled:checked,
+ headerbar.selection-mode button:backdrop:disabled:checked,
+ .question button:backdrop:disabled:active,
+ .question button:backdrop:disabled:checked,
+ .warning button:backdrop:disabled:active,
+ .warning button:backdrop:disabled:checked,
+ .error button:backdrop:disabled:active,
+ .error button:backdrop:disabled:checked {
+ background-image: linear-gradient(to bottom, rgba(218, 115, 25, 0.35), rgba(209, 111, 24, 0.35));
+ color: #252b2f;
+ border-color: rgba(216, 114, 24, 0.35); }
+
+/*********
+ * Links *
+ *********/
+button:link > label,
+button:visited > label,
+*:link,
+button:link,
+button:visited {
+ color: #4c6b8a; }
+ button:link > label:visited,
+ button:visited > label:visited,
+ *:link:visited,
+ button:visited {
+ color: #913d88; }
+ *:selected button:link > label:visited,
+ *:selected button:visited > label:visited, *:selected
+ *:link:visited, *:selected
+ button:visited:link,
+ *:selected button:visited {
+ color: #a3e4d7; }
+ button:link > label:hover,
+ button:visited > label:hover,
+ *:link:hover,
+ button:hover:link,
+ button:hover:visited {
+ color: #6185a8; }
+ *:selected button:link > label:hover,
+ *:selected button:visited > label:hover, *:selected
+ *:link:hover, *:selected
+ button:hover:link,
+ *:selected button:hover:visited {
+ color: #e8f8f5; }
+ button:link > label:active,
+ button:visited > label:active,
+ *:link:active,
+ button:active:link,
+ button:active:visited {
+ color: #4c6b8a; }
+ *:selected button:link > label:active,
+ *:selected button:visited > label:active, *:selected
+ *:link:active, *:selected
+ button:active:link,
+ *:selected button:active:visited {
+ color: #d1f2eb; }
+ button:link > label:backdrop,
+ button:visited > label:backdrop, button:link > label:backdrop:hover,
+ button:visited > label:backdrop:hover, button:link > label:backdrop:hover:selected,
+ button:visited > label:backdrop:hover:selected,
+ *:link:backdrop,
+ button:backdrop:link,
+ button:backdrop:visited,
+ *:link:backdrop:hover,
+ button:backdrop:hover:link,
+ button:backdrop:hover:visited,
+ *:link:backdrop:hover:selected,
+ headerbar.selection-mode .subtitle:backdrop:hover:link,
+ button:backdrop:hover:selected:link,
+ button:backdrop:hover:selected:visited {
+ color: rgba(255, 95, 87, 0.5); }
+ button:link > label:selected,
+ button:visited > label:selected, *:selected button:link > label,
+ *:selected button:visited > label,
+ *:link:selected,
+ headerbar.selection-mode .subtitle:link,
+ button:selected:link,
+ button:selected:visited, *:selected
+ *:link, *:selected
+ button:link,
+ *:selected button:visited {
+ color: #d1f2eb; }
+
+button:link,
+button:visited {
+ text-shadow: none; }
+ button:link:hover, button:link:active, button:link:checked,
+ button:visited:hover,
+ button:visited:active,
+ button:visited:checked {
+ text-shadow: none; }
+ button:link > label,
+ button:visited > label {
+ text-decoration-line: underline; }
+
+/*********
+ * Lists *
+ *********/
+list {
+ background-color: #292f34;
+ color: white;
+ border-width: 0px; }
+ list:backdrop {
+ background-color: #292f34;
+ color: white; }
+ list row {
+ padding: 2px; }
+
+row {
+ transition: all 150ms cubic-bezier(0.25, 0.46, 0.45, 0.94); }
+ row:hover {
+ transition: none; }
+ row.activatable.has-open-popup, row.activatable:hover {
+ background-color: rgba(255, 95, 87, 0.5); }
+ row.activatable:active {
+ box-shadow: none;
+ background-color: #FF5F57; }
+ row.activatable:selected:active {
+ box-shadow: none;
+ background-color: #FF5F57; }
+ row.activatable:selected.has-open-popup, row.activatable:selected:hover {
+ color: white;
+ background-color: #FF5F57; }
+ row.activatable:selected:backdrop {
+ background-color: #FF5F57; }
+
+/*********
+ * Menus *
+ *********/
+menubar,
+.menubar {
+ -GtkWidget-window-dragging: true;
+ padding: 0px;
+ box-shadow: none;
+ border-style: none;
+ background-color: #292f34; }
+ menubar:backdrop,
+ .menubar:backdrop {
+ background-color: #292f34; }
+ menubar > menuitem,
+ .menubar > menuitem {
+ min-height: 16px;
+ padding: 4px 6px;
+ border-style: solid;
+ border-width: 1px 0px;
+ border-color: #292f34; }
+ menubar > menuitem:hover,
+ .menubar > menuitem:hover {
+ background-color: #FF5F57;
+ color: white; }
+ menubar > menuitem:disabled,
+ .menubar > menuitem:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ box-shadow: none; }
+ menubar > menuitem:disabled:backdrop,
+ .menubar > menuitem:disabled:backdrop {
+ background-color: #292f34;
+ color: rgba(232, 232, 232, 0.35); }
+ menubar > menuitem:backdrop,
+ .menubar > menuitem:backdrop {
+ background-color: #292f34;
+ border-color: #292f34;
+ color: white; }
+
+menu,
+.menu {
+ padding: 0px;
+ background-color: #292f34;
+ border: 0px solid transparent;
+ box-shadow: inset 0px 0px 0px 1px #5f6367;
+ border-radius: 3px; }
+ .csd menu, .csd
+ .menu {
+ border: 0px solid;
+ border-radius: 3px; }
+ menu separator,
+ .menu separator {
+ color: #5f6367;
+ margin-top: 3px;
+ margin-bottom: 3px; }
+ menu menuitem,
+ .menu menuitem {
+ text-shadow: none;
+ min-height: 16px;
+ min-width: 40px;
+ padding: 4px 4px; }
+ menu menuitem:hover,
+ .menu menuitem:hover {
+ color: white;
+ background-color: #FF5F57; }
+ menu menuitem:disabled,
+ .menu menuitem:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ menu menuitem:disabled:backdrop,
+ .menu menuitem:disabled:backdrop {
+ color: rgba(232, 232, 232, 0.35); }
+ menu menuitem:backdrop, menu menuitem:backdrop:hover,
+ .menu menuitem:backdrop,
+ .menu menuitem:backdrop:hover {
+ color: white;
+ background-color: #292f34; }
+ menu menuitem arrow,
+ .menu menuitem arrow {
+ min-height: 16px;
+ min-width: 16px; }
+ menu menuitem arrow:dir(ltr),
+ .menu menuitem arrow:dir(ltr) {
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic");
+ margin-left: 10px; }
+ menu menuitem arrow:dir(rtl),
+ .menu menuitem arrow:dir(rtl) {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic");
+ margin-right: 10px; }
+ menu > arrow,
+ .menu > arrow {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ min-height: 16px;
+ min-width: 16px;
+ padding: 4px;
+ background-color: transparent;
+ border-radius: 0; }
+ menu > arrow.top,
+ .menu > arrow.top {
+ margin-top: -6px;
+ border: none;
+ -gtk-icon-source: -gtk-icontheme("pan-up-symbolic"); }
+ menu > arrow.bottom,
+ .menu > arrow.bottom {
+ margin-bottom: -6px;
+ border: none;
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic"); }
+ menu > arrow:hover,
+ .menu > arrow:hover {
+ color: #FF5F57; }
+ menu > arrow:active,
+ .menu > arrow:active {
+ color: #FF5F57; }
+ menu > arrow:backdrop,
+ .menu > arrow:backdrop {
+ background-color: #292f34; }
+ menu > arrow:disabled,
+ .menu > arrow:disabled {
+ color: transparent;
+ background-color: transparent;
+ border-color: transparent; }
+
+menuitem accelerator {
+ color: alpha(currentColor,0.55); }
+menuitem check,
+menuitem radio {
+ min-height: 18px;
+ min-width: 18px; }
+ menuitem check:dir(ltr),
+ menuitem radio:dir(ltr) {
+ margin-right: 6px; }
+ menuitem check:dir(rtl),
+ menuitem radio:dir(rtl) {
+ margin-left: 6px; }
+
+/***************
+ * Popovers *
+ ***************/
+/* menu buttons */
+modelbutton.flat, popover.background checkbutton,
+popover.background radiobutton,
+.menuitem.button.flat {
+ min-height: 16px;
+ padding: 4px 8px;
+ color: white; }
+ modelbutton.flat:hover, popover.background checkbutton:hover,
+ popover.background radiobutton:hover,
+ .menuitem.button.flat:hover {
+ background-color: #FF5F57;
+ color: white; }
+ modelbutton.flat:selected, popover.background checkbutton:selected,
+ popover.background radiobutton:selected,
+ .menuitem.button.flat:selected {
+ background-color: #FF5F57;
+ color: white; }
+ modelbutton.flat:backdrop, popover.background checkbutton:backdrop,
+ popover.background radiobutton:backdrop, modelbutton.flat:backdrop:hover, popover.background checkbutton:backdrop:hover,
+ popover.background radiobutton:backdrop:hover,
+ .menuitem.button.flat:backdrop,
+ .menuitem.button.flat:backdrop:hover {
+ color: white; }
+ modelbutton.flat check:hover, popover.background checkbutton check:hover,
+ popover.background radiobutton check:hover,
+ modelbutton.flat radio:hover, popover.background checkbutton radio:hover,
+ popover.background radiobutton radio:hover,
+ modelbutton.flat check:checked:hover, popover.background checkbutton check:checked:hover,
+ popover.background radiobutton check:checked:hover,
+ modelbutton.flat radio:checked:hover, popover.background checkbutton radio:checked:hover,
+ popover.background radiobutton radio:checked:hover,
+ modelbutton.flat check:indeterminate:hover, popover.background checkbutton check:indeterminate:hover,
+ popover.background radiobutton check:indeterminate:hover,
+ modelbutton.flat radio:indeterminate:hover, popover.background checkbutton radio:indeterminate:hover,
+ popover.background radiobutton radio:indeterminate:hover,
+ modelbutton.flat check:last-child, popover.background checkbutton check:last-child,
+ popover.background radiobutton check:last-child,
+ modelbutton.flat radio:last-child,
+ popover.background checkbutton radio:last-child,
+ popover.background radiobutton radio:last-child,
+ .menuitem.button.flat check:last-child,
+ .menuitem.button.flat radio:last-child {
+ margin-right: 0px; }
+ modelbutton.flat check:first-child, popover.background checkbutton check:first-child,
+ popover.background radiobutton check:first-child,
+ modelbutton.flat radio:first-child,
+ popover.background checkbutton radio:first-child,
+ popover.background radiobutton radio:first-child,
+ .menuitem.button.flat check:first-child,
+ .menuitem.button.flat radio:first-child {
+ margin-left: 0px; }
+
+modelbutton.flat arrow, popover.background checkbutton arrow,
+popover.background radiobutton arrow {
+ background: none; }
+ modelbutton.flat arrow:hover, popover.background checkbutton arrow:hover,
+ popover.background radiobutton arrow:hover {
+ background: none; }
+ modelbutton.flat arrow.left, popover.background checkbutton arrow.left,
+ popover.background radiobutton arrow.left {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic"); }
+ modelbutton.flat arrow.right, popover.background checkbutton arrow.right,
+ popover.background radiobutton arrow.right {
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic"); }
+
+popover.background {
+ margin: -10px;
+ padding: 0px;
+ border: 1px solid #5f6367;
+ border-radius: 3px;
+ background-color: #292f34;
+ box-shadow: 0 2px 3px rgba(0, 0, 0, 0.9); }
+ popover.background:backdrop {
+ box-shadow: none; }
+ popover.background > list,
+ popover.background > .view,
+ popover.background > toolbar {
+ border-style: none;
+ background-color: transparent; }
+ .csd popover.background.touch-selection, .csd popover.background.magnifier, popover.background.touch-selection, popover.background.magnifier {
+ border: 1px solid #5f6367; }
+ popover.background separator {
+ margin: 3px; }
+ popover.background list separator {
+ margin: 0px; }
+
+GtkVolumeButton.button {
+ padding: 5px; }
+
+/********
+ * Misc *
+ ********/
+/****************
+* Print dialog *
+*****************/
+printdialog paper {
+ color: white;
+ border: 1px solid #5f6367;
+ background: white;
+ padding: 0; }
+ printdialog paper:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background: white; }
+printdialog .dialog-action-box {
+ margin: 12px; }
+
+/**********
+* Frames *
+**********/
+frame > border,
+.frame {
+ box-shadow: none;
+ margin: 0;
+ padding: 0;
+ border-radius: 0;
+ border: 1px solid #5f6367; }
+ frame > border.flat,
+ .frame.flat {
+ border-style: none; }
+ frame > border:backdrop,
+ .frame:backdrop {
+ border-color: #5f6367; }
+
+actionbar > revealer > box {
+ padding: 6px;
+ border-top: 1px solid #5f6367; }
+ actionbar > revealer > box:backdrop {
+ border-color: #5f6367; }
+
+scrolledwindow viewport.frame {
+ border-style: none; }
+scrolledwindow junction {
+ border-color: transparent;
+ background-color: transparent;
+ background-image: none; }
+
+separator {
+ background: #5f6367;
+ min-width: 1px;
+ min-height: 1px; }
+
+/*************
+* Expanders *
+*************/
+expander arrow {
+ min-width: 16px;
+ min-height: 16px;
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic"); }
+ expander arrow:dir(rtl) {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic"); }
+ expander arrow:hover {
+ color: white; }
+ expander arrow:checked {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic"); }
+
+/*********
+* Paned *
+*********/
+paned > separator {
+ min-width: 1px;
+ min-height: 1px;
+ -gtk-icon-source: none;
+ border-style: none;
+ background-color: transparent;
+ background-image: image(#5f6367);
+ background-size: 1px 1px; }
+ paned > separator:backdrop {
+ background-image: image(#5f6367); }
+ paned > separator.wide {
+ min-width: 5px;
+ min-height: 5px;
+ background-color: #292f34;
+ background-image: image(#5f6367), image(#5f6367);
+ background-size: 1px 1px, 1px 1px; }
+ paned > separator.wide:backdrop {
+ background-color: #292f34;
+ background-image: image(#5f6367), image(#5f6367); }
+paned.horizontal > separator {
+ background-repeat: repeat-y; }
+ paned.horizontal > separator:dir(ltr) {
+ margin: 0 -8px 0 0;
+ padding: 0 8px 0 0;
+ background-position: left; }
+ paned.horizontal > separator:dir(rtl) {
+ margin: 0 0 0 -8px;
+ padding: 0 0 0 8px;
+ background-position: right; }
+ paned.horizontal > separator.wide {
+ margin: 0;
+ padding: 0;
+ background-repeat: repeat-y, repeat-y;
+ background-position: left, right; }
+paned.vertical > separator {
+ margin: 0 0 -8px 0;
+ padding: 0 0 8px 0;
+ background-repeat: repeat-x;
+ background-position: top; }
+ paned.vertical > separator.wide {
+ margin: 0;
+ padding: 0;
+ background-repeat: repeat-x, repeat-x;
+ background-position: bottom, top; }
+
+/*********************
+* Spinner Animation *
+*********************/
+@keyframes spin {
+ to {
+ -gtk-icon-transform: rotate(1turn); } }
+spinner {
+ background-image: none;
+ opacity: 0;
+ -gtk-icon-source: -gtk-icontheme("process-working-symbolic"); }
+ spinner:checked {
+ opacity: 1;
+ animation: spin 1s linear infinite; }
+ spinner:checked:disabled {
+ opacity: 0.5; }
+
+/*****************
+ * Notebooks and *
+ * Tabs *
+ *****************/
+/*************
+ * Notebooks *
+ *************/
+notebook.frame {
+ border: none;
+ padding: 0px;
+ box-shadow: inset 0px 0px 0px 1px #5f6367; }
+notebook > header {
+ padding: 0px;
+ border: none;
+ background-color: #292f34; }
+ notebook > header.top {
+ box-shadow: inset 0 -1px #5f6367; }
+ notebook > header.top:backdrop {
+ box-shadow: inset 0 -1px #5f6367; }
+ notebook > header.bottom {
+ box-shadow: inset 0 1px #5f6367; }
+ notebook > header.bottom:backdrop {
+ box-shadow: inset 0 1px #5f6367; }
+ notebook > header.right {
+ box-shadow: inset 1px 0 #5f6367; }
+ notebook > header.right:backdrop {
+ box-shadow: inset 1px 0 #5f6367; }
+ notebook > header.left {
+ box-shadow: inset -1px 0 #5f6367; }
+ notebook > header.left:backdrop {
+ box-shadow: inset -1px 0 #5f6367; }
+ notebook > header:backdrop {
+ background-color: #292f34; }
+ notebook > header tabs {
+ margin: 0px; }
+ notebook > header.top > tabs > tab {
+ padding: 4px 6px;
+ border: 1px solid rgba(255, 255, 255, 0.2);
+ background-color: rgba(255, 255, 255, 0.2);
+ border-radius: 3px 3px 0px 0px;
+ border-bottom-color: transparent; }
+ notebook > header.top > tabs > tab:hover, notebook > header.top > tabs > tab.prelight-page {
+ background-color: rgba(255, 95, 87, 0.2);
+ border-color: rgba(255, 95, 87, 0.2); }
+ notebook > header.top > tabs > tab:checked {
+ border-color: #5f6367;
+ border-bottom-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.top > tabs > tab:checked:backdrop {
+ border-color: #5f6367;
+ border-bottom-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.bottom > tabs > tab {
+ padding: 4px 6px;
+ border: 1px solid rgba(255, 255, 255, 0.2);
+ background-color: rgba(255, 255, 255, 0.2);
+ border-radius: 0px 0px 3px 3px;
+ border-top-color: transparent; }
+ notebook > header.bottom > tabs > tab:hover, notebook > header.bottom > tabs > tab.prelight-page {
+ background-color: rgba(255, 95, 87, 0.2);
+ border-color: rgba(255, 95, 87, 0.2); }
+ notebook > header.bottom > tabs > tab:checked {
+ border-color: #5f6367;
+ border-top-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.bottom > tabs > tab:checked:backdrop {
+ border-color: #5f6367;
+ border-top-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.left > tabs > tab {
+ padding: 4px 6px;
+ border: 1px solid rgba(255, 255, 255, 0.2);
+ background-color: rgba(255, 255, 255, 0.2);
+ border-radius: 3px 0px 0px 3px;
+ border-right-color: transparent; }
+ notebook > header.left > tabs > tab:hover, notebook > header.left > tabs > tab.prelight-page {
+ background-color: rgba(255, 95, 87, 0.2);
+ border-color: rgba(255, 95, 87, 0.2); }
+ notebook > header.left > tabs > tab:checked {
+ border-color: #5f6367;
+ border-right-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.left > tabs > tab:checked:backdrop {
+ border-color: #5f6367;
+ border-right-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.right > tabs > tab {
+ padding: 4px 6px;
+ border: 1px solid rgba(255, 255, 255, 0.2);
+ background-color: rgba(255, 255, 255, 0.2);
+ border-radius: 0px 3px 3px 0px;
+ border-left-color: transparent; }
+ notebook > header.right > tabs > tab:hover, notebook > header.right > tabs > tab.prelight-page {
+ background-color: rgba(255, 95, 87, 0.2);
+ border-color: rgba(255, 95, 87, 0.2); }
+ notebook > header.right > tabs > tab:checked {
+ border-color: #5f6367;
+ border-left-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.right > tabs > tab:checked:backdrop {
+ border-color: #5f6367;
+ border-left-color: #292f34;
+ background-color: #292f34; }
+ notebook > header.top > tabs > tab.reorderable-page {
+ border-width: 3px;
+ border-style: solid;
+ border-color: transparent;
+ background-color: #292f34;
+ background-clip: padding-box;
+ border-right-width: 1px;
+ border-right-color: #5f6367;
+ box-shadow: inset -3px 0px 0px 0px #292f34; }
+ notebook > header.top > tabs > tab.reorderable-page:hover, notebook > header.top > tabs > tab.reorderable-page.prelight-page {
+ box-shadow: inset 0px -3px 0px 0px rgba(255, 95, 87, 0.2), inset -3px 0px 0px 0px #292f34; }
+ notebook > header.top > tabs > tab.reorderable-page:checked {
+ box-shadow: inset 0px -3px 0px 0px #FF5F57, inset -3px 0px 0px 0px #292f34; }
+ notebook > header.top > tabs > tab.reorderable-page:checked:backdrop {
+ background-color: #292f34;
+ border-color: transparent;
+ border-right-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.top > tabs > tab.reorderable-page:backdrop {
+ background-color: #292f34;
+ border-right-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.bottom > tabs > tab.reorderable-page {
+ border-width: 3px;
+ border-style: solid;
+ border-color: transparent;
+ background-color: #292f34;
+ background-clip: padding-box;
+ border-right-width: 1px;
+ border-right-color: #5f6367;
+ box-shadow: inset -3px 0px 0px 0px #292f34; }
+ notebook > header.bottom > tabs > tab.reorderable-page:hover, notebook > header.bottom > tabs > tab.reorderable-page.prelight-page {
+ box-shadow: inset 0px -3px 0px 0px rgba(255, 95, 87, 0.2), inset -3px 0px 0px 0px #292f34; }
+ notebook > header.bottom > tabs > tab.reorderable-page:checked {
+ box-shadow: inset 0px -3px 0px 0px #FF5F57, inset -3px 0px 0px 0px #292f34; }
+ notebook > header.bottom > tabs > tab.reorderable-page:checked:backdrop {
+ background-color: #292f34;
+ border-color: transparent;
+ border-right-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.bottom > tabs > tab.reorderable-page:backdrop {
+ background-color: #292f34;
+ border-right-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.left > tabs > tab.reorderable-page {
+ border-width: 3px;
+ border-style: solid;
+ border-color: transparent;
+ background-color: #292f34;
+ background-clip: padding-box;
+ border-bottom-width: 1px;
+ border-bottom-color: #5f6367;
+ box-shadow: inset 0px -3px 0px 0px #292f34; }
+ notebook > header.left > tabs > tab.reorderable-page:hover, notebook > header.left > tabs > tab.reorderable-page.prelight-page {
+ box-shadow: inset 0px -3px 0px 0px rgba(255, 95, 87, 0.2), inset 0px -3px 0px 0px #292f34; }
+ notebook > header.left > tabs > tab.reorderable-page:checked {
+ box-shadow: inset 0px -3px 0px 0px #FF5F57, inset 0px -3px 0px 0px #292f34; }
+ notebook > header.left > tabs > tab.reorderable-page:checked:backdrop {
+ background-color: #292f34;
+ border-color: transparent;
+ border-bottom-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.left > tabs > tab.reorderable-page:backdrop {
+ background-color: #292f34;
+ border-bottom-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.right > tabs > tab.reorderable-page {
+ border-width: 3px;
+ border-style: solid;
+ border-color: transparent;
+ background-color: #292f34;
+ background-clip: padding-box;
+ border-bottom-width: 1px;
+ border-bottom-color: #5f6367;
+ box-shadow: inset 0px -3px 0px 0px #292f34; }
+ notebook > header.right > tabs > tab.reorderable-page:hover, notebook > header.right > tabs > tab.reorderable-page.prelight-page {
+ box-shadow: inset 0px -3px 0px 0px rgba(255, 95, 87, 0.2), inset 0px -3px 0px 0px #292f34; }
+ notebook > header.right > tabs > tab.reorderable-page:checked {
+ box-shadow: inset 0px -3px 0px 0px #FF5F57, inset 0px -3px 0px 0px #292f34; }
+ notebook > header.right > tabs > tab.reorderable-page:checked:backdrop {
+ background-color: #292f34;
+ border-color: transparent;
+ border-bottom-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.right > tabs > tab.reorderable-page:backdrop {
+ background-color: #292f34;
+ border-bottom-color: #5f6367;
+ box-shadow: none; }
+ notebook > header.top > tabs > arrow {
+ border-top-style: none; }
+ notebook > header.bottom > tabs > arrow {
+ border-bottom-style: none; }
+ notebook > header.top > tabs > arrow, notebook > header.bottom > tabs > arrow {
+ margin-left: -5px;
+ margin-right: -5px;
+ padding-left: 4px;
+ padding-right: 4px; }
+ notebook > header.top > tabs > arrow.down, notebook > header.bottom > tabs > arrow.down {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic"); }
+ notebook > header.top > tabs > arrow.up, notebook > header.bottom > tabs > arrow.up {
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic"); }
+ notebook > header.left > tabs > arrow {
+ border-left-style: none; }
+ notebook > header.right > tabs > arrow {
+ border-right-style: none; }
+ notebook > header.left > tabs > arrow, notebook > header.right > tabs > arrow {
+ margin-top: -5px;
+ margin-bottom: -5px;
+ padding-top: 4px;
+ padding-bottom: 4px; }
+ notebook > header.left > tabs > arrow.down, notebook > header.right > tabs > arrow.down {
+ -gtk-icon-source: -gtk-icontheme("pan-up-symbolic"); }
+ notebook > header.left > tabs > arrow.up, notebook > header.right > tabs > arrow.up {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic"); }
+ notebook > header > tabs > arrow {
+ min-height: 16px;
+ min-width: 16px;
+ border-radius: 0; }
+ notebook > header > tabs > arrow:hover:not(:active):not(:backdrop) {
+ background-clip: padding-box;
+ background-image: none;
+ background-color: rgba(255, 255, 255, 0.3);
+ border-color: transparent;
+ box-shadow: none; }
+ notebook > header > tabs > arrow:disabled {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none; }
+ notebook > header button.flat {
+ padding: 0;
+ margin: 4px;
+ min-width: 12px;
+ min-height: 12px;
+ border: 0px solid;
+ border-radius: 50%;
+ color: #292f34;
+ background-color: #5f6367;
+ background-image: none; }
+ notebook > header button.flat:hover {
+ background-color: #e74c3c; }
+ notebook > header button.flat:active {
+ background-color: #e74c3c; }
+ notebook > header button.flat:backdrop {
+ background-color: #5f6367;
+ color: #292f34; }
+notebook > stack:not(:only-child) {
+ background-color: transparent;
+ border-style: solid;
+ border-color: #5f6367;
+ border-width: 0px; }
+
+scrolledwindow overshoot.top {
+ background-image: -gtk-gradient(radial, center top, 0, center top, 0.5, to(#474a4c), to(rgba(71, 74, 76, 0))), -gtk-gradient(radial, center top, 0, center top, 0.6, from(rgba(255, 255, 255, 0.07)), to(rgba(255, 255, 255, 0)));
+ background-size: 100% 5%, 100% 100%;
+ background-repeat: no-repeat;
+ background-position: center top;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+ scrolledwindow overshoot.top:backdrop {
+ background-image: -gtk-gradient(radial, center top, 0, center top, 0.5, to(#5f6367), to(rgba(95, 99, 103, 0)));
+ background-size: 100% 5%;
+ background-repeat: no-repeat;
+ background-position: center top;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+scrolledwindow overshoot.bottom {
+ background-image: -gtk-gradient(radial, center bottom, 0, center bottom, 0.5, to(#474a4c), to(rgba(71, 74, 76, 0))), -gtk-gradient(radial, center bottom, 0, center bottom, 0.6, from(rgba(255, 255, 255, 0.07)), to(rgba(255, 255, 255, 0)));
+ background-size: 100% 5%, 100% 100%;
+ background-repeat: no-repeat;
+ background-position: center bottom;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+ scrolledwindow overshoot.bottom:backdrop {
+ background-image: -gtk-gradient(radial, center bottom, 0, center bottom, 0.5, to(#5f6367), to(rgba(95, 99, 103, 0)));
+ background-size: 100% 5%;
+ background-repeat: no-repeat;
+ background-position: center bottom;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+scrolledwindow overshoot.left {
+ background-image: -gtk-gradient(radial, left center, 0, left center, 0.5, to(#474a4c), to(rgba(71, 74, 76, 0))), -gtk-gradient(radial, left center, 0, left center, 0.6, from(rgba(255, 255, 255, 0.07)), to(rgba(255, 255, 255, 0)));
+ background-size: 5% 100%, 100% 100%;
+ background-repeat: no-repeat;
+ background-position: left center;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+ scrolledwindow overshoot.left:backdrop {
+ background-image: -gtk-gradient(radial, left center, 0, left center, 0.5, to(#5f6367), to(rgba(95, 99, 103, 0)));
+ background-size: 5% 100%;
+ background-repeat: no-repeat;
+ background-position: left center;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+scrolledwindow overshoot.right {
+ background-image: -gtk-gradient(radial, right center, 0, right center, 0.5, to(#474a4c), to(rgba(71, 74, 76, 0))), -gtk-gradient(radial, right center, 0, right center, 0.6, from(rgba(255, 255, 255, 0.07)), to(rgba(255, 255, 255, 0)));
+ background-size: 5% 100%, 100% 100%;
+ background-repeat: no-repeat;
+ background-position: right center;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+ scrolledwindow overshoot.right:backdrop {
+ background-image: -gtk-gradient(radial, right center, 0, right center, 0.5, to(#5f6367), to(rgba(95, 99, 103, 0)));
+ background-size: 5% 100%;
+ background-repeat: no-repeat;
+ background-position: right center;
+ background-color: transparent;
+ border: none;
+ box-shadow: none; }
+scrolledwindow undershoot {
+ background-image: none;
+ border: none; }
+
+/************
+ * Pathbars *
+ ************/
+.path-bar {
+ background-color: #292f34;
+ border-bottom: 1px solid #5f6367; }
+
+.path-bar button {
+ border-color: rgba(255, 255, 255, 0);
+ background-color: transparent;
+ background-image: none;
+ box-shadow: none;
+ color: white;
+ text-shadow: none;
+ -gtk-icon-shadow: none;
+ padding: 4px 8px;
+ color: white; }
+ .path-bar button:hover {
+ border-color: #FF5F57; }
+ .path-bar button:active, .path-bar button:checked {
+ background-color: #5f6367;
+ font-weight: normal; }
+ .path-bar button.text-button, .path-bar button.image-button, .path-bar button {
+ padding-left: 4px;
+ padding-right: 4px; }
+ .path-bar button.text-button.image-button label {
+ padding-left: 0;
+ padding-right: 0; }
+ .path-bar button.text-button.image-button label:last-child, .path-bar button label:last-child {
+ padding-right: 8px; }
+ .path-bar button.text-button.image-button label:first-child, .path-bar button label:first-child {
+ padding-left: 8px; }
+ .path-bar button image {
+ padding-left: 4px;
+ padding-right: 4px; }
+ .path-bar button.slider-button {
+ padding-left: 0;
+ padding-right: 0; }
+
+/*****************
+ * Progress bars *
+ *****************/
+progressbar {
+ font-size: smaller;
+ color: rgba(255, 255, 255, 0.3); }
+ progressbar.horizontal trough,
+ progressbar.horizontal progress {
+ min-height: 6px; }
+ progressbar.vertical trough,
+ progressbar.vertical progress {
+ min-width: 6px; }
+ progressbar trough {
+ border: 0px solid transparent;
+ border-radius: 3px;
+ background-color: rgba(255, 255, 255, 0.3); }
+ progressbar:backdrop trough {
+ background-color: rgba(255, 255, 255, 0.3); }
+ progressbar progress {
+ background-color: #FF5F57;
+ border: 0px solid transparent;
+ border-radius: 3px;
+ box-shadow: none; }
+ progressbar:backdrop progress {
+ background-color: #FF5F57; }
+ progressbar.osd {
+ background-color: transparent; }
+
+treeview.view.progressbar {
+ border: 0px solid transparent;
+ border-radius: 3px;
+ background-color: #FF5F57;
+ color: white;
+ background-image: none; }
+ treeview.view.progressbar:selected:focus, treeview.view.progressbar:selected {
+ background-color: rgba(255, 255, 255, 0.25); }
+treeview.view.trough {
+ background-color: #696d71; }
+ treeview.view.trough:selected:focus, treeview.view.trough:selected {
+ background-color: rgba(255, 255, 255, 0.3); }
+
+/*************
+ * Level Bar *
+ *************/
+levelbar block {
+ min-width: 32px;
+ min-height: 6px; }
+levelbar.vertical block {
+ min-width: 6px;
+ min-height: 32px; }
+levelbar trough {
+ border: 1px solid;
+ padding: 2px;
+ border-radius: 3px;
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34;
+ box-shadow: none; }
+ levelbar trough:backdrop {
+ color: white;
+ border-color: #5f6367;
+ background-color: #292f34; }
+levelbar.horizontal.discrete block {
+ margin: 0 1px; }
+levelbar.vertical.discrete block {
+ margin: 1px 0; }
+levelbar block:not(.empty) {
+ border: 1px solid #FF5F57;
+ background-color: #FF5F57;
+ box-shadow: none;
+ border-radius: 1px; }
+ levelbar block:not(.empty):backdrop {
+ border-color: #FF5F57;
+ background-color: #FF5F57; }
+levelbar block.low {
+ border-color: #e67e22;
+ background-color: #e67e22; }
+ levelbar block.low:backdrop {
+ background-color: #e67e22;
+ border-color: #e67e22; }
+levelbar block.high {
+ border-color: #3498db;
+ background-color: #3498db; }
+ levelbar block.high:backdrop {
+ background-color: #3498db;
+ border-color: #3498db; }
+levelbar block.full {
+ border-color: #3498db;
+ background-color: #3498db; }
+ levelbar block.full:backdrop {
+ background-color: #3498db;
+ border-color: #3498db; }
+levelbar block.empty {
+ background-color: rgba(255, 255, 255, 0.3);
+ border-color: transparent;
+ box-shadow: none; }
+ levelbar block.empty:backdrop {
+ background-color: rgba(255, 255, 255, 0.3); }
+
+/************
+ * GtkScale *
+ ************/
+scale.fine-tune.trough {
+ margin: 8px;
+ border-radius: 3px; }
+scale slider {
+ min-width: 18px;
+ min-height: 18px;
+ background-color: #292f34;
+ border: 1px solid #5f6367;
+ border-radius: 50%;
+ box-shadow: none;
+ margin: -9px; }
+ scale slider:hover {
+ border-style: solid;
+ border-width: 2px;
+ border-color: #FF5F57;
+ border-radius: 50%; }
+ scale slider:hover:backdrop {
+ background-color: #292f34;
+ border-color: #FF5F57; }
+ scale slider:disabled {
+ border-style: solid;
+ border-radius: 50%;
+ background-color: #292f34;
+ border-color: rgba(86, 90, 94, 0.35); }
+ scale slider:disabled:backdrop {
+ background-color: #292f34;
+ border-color: rgba(86, 90, 94, 0.35); }
+ scale slider:active {
+ border: 2px solid #FF5F57; }
+ scale slider:active:backdrop {
+ background-color: #292f34;
+ border-color: #FF5F57; }
+ scale slider:backdrop {
+ background-color: #292f34;
+ border-color: #5f6367; }
+scale trough {
+ min-width: 6px;
+ min-height: 6px;
+ margin: 9px;
+ border: 0px solid;
+ border-radius: 3px;
+ background-color: #696d71;
+ box-shadow: none; }
+ scale trough:disabled, scale trough.vertical:disabled {
+ border-color: rgba(95, 99, 103, 0.35);
+ background-color: rgba(95, 99, 103, 0.35);
+ box-shadow: none; }
+ scale trough:disabled:backdrop, scale trough.vertical:disabled:backdrop {
+ background-color: rgba(95, 99, 103, 0.35);
+ border-color: rgba(95, 99, 103, 0.35); }
+ scale trough:backdrop {
+ background-color: #696d71;
+ border-color: #696d71; }
+scale highlight {
+ border: 0px solid;
+ border-radius: 3px;
+ background-color: #FF5F57;
+ border-color: #FF5F57; }
+ scale highlight.vertical {
+ background-color: #FF5F57;
+ border-color: #FF5F57; }
+ scale highlight:disabled {
+ background-color: rgba(24, 171, 142, 0.35); }
+ scale highlight:backdrop {
+ background-color: rgba(255, 95, 87, 0.5);
+ border-color: rgba(255, 95, 87, 0.5); }
+ scale highlight:backdrop:disabled {
+ background-color: rgba(24, 171, 142, 0.35); }
+
+/**************
+ * Scrollbars *
+ **************/
+scrollbar {
+ -GtkScrollbar-has-backward-stepper: true;
+ -GtkScrollbar-has-forward-stepper: true;
+ background-color: #292f34;
+ border-width: 3px 0px;
+ border-color: #292f34;
+ margin: 0px; }
+ scrollbar button {
+ min-width: 14px;
+ min-height: 14px;
+ margin: 0px;
+ padding: 0px 3px;
+ border: none;
+ border-radius: 0px;
+ background-image: none;
+ background-color: #292f34;
+ color: white;
+ box-shadow: none; }
+ scrollbar button:hover {
+ border: none;
+ background-image: none;
+ background-color: #292f34;
+ color: #FF5F57; }
+ scrollbar button:active, scrollbar button:active:hover {
+ border: none;
+ background-image: none;
+ background-color: #292f34;
+ color: #FF5F57; }
+ scrollbar button:disabled {
+ border: none;
+ background-color: #292f34;
+ background-image: none;
+ color: rgba(232, 232, 232, 0.35); }
+ scrollbar button:backdrop {
+ color: white; }
+ scrollbar button:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ scrollbar.dragging, scrollbar.hovering {
+ opacity: 0.9910; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering) {
+ opacity: 0.999; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering) {
+ -GtkScrollbar-has-backward-stepper: false;
+ -GtkScrollbar-has-forward-stepper: false;
+ background: none; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering) slider {
+ min-width: 4px;
+ margin: 2px;
+ border: none;
+ border-radius: 2px;
+ background-color: #b4b6b8; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering) slider:backdrop {
+ background-color: #b4b6b8; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering) trough {
+ min-width: 4px;
+ min-height: 4px;
+ border: none;
+ background: none;
+ box-shadow: none; }
+ scrollbar.overlay-indicator:not(.dragging):not(.hovering).horizontal slider {
+ min-height: 4px; }
+ scrollbar trough {
+ min-width: 16px;
+ min-height: 16px;
+ border: 0px solid transparent;
+ border-radius: 8px;
+ background-color: #696d71;
+ box-shadow: inset 0px 0px 0px 3px #292f34; }
+ scrollbar slider {
+ min-width: 10px;
+ min-height: 30px;
+ border: 2px solid transparent;
+ border-radius: 8px;
+ background-clip: padding-box;
+ background-color: #b4b6b8; }
+ scrollbar slider:hover {
+ background-color: #FF5F57; }
+ scrollbar slider:active {
+ background-color: #FF5F57; }
+ scrollbar slider:disabled {
+ background-color: rgba(163, 165, 168, 0.35); }
+ scrollbar slider:backdrop {
+ background-color: #b4b6b8; }
+ scrollbar slider:backdrop:disabled {
+ background-color: rgba(163, 165, 168, 0.35); }
+ scrollbar.horizontal slider {
+ min-width: 30px;
+ min-height: 10px; }
+ scrollbar.vertical button.down {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic"); }
+ scrollbar.vertical button.up {
+ -gtk-icon-source: -gtk-icontheme("pan-up-symbolic"); }
+ scrollbar.horizontal button.down {
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic"); }
+ scrollbar.horizontal button.up {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic"); }
+
+/***********
+ * Sidebar *
+ ***********/
+.sidebar {
+ border: none;
+ background-color: #292f34; }
+ .sidebar:backdrop {
+ background-color: #292f34; }
+
+placessidebar > viewport.frame {
+ border-style: none; }
+placessidebar row {
+ min-height: 36px;
+ padding: 0px; }
+ placessidebar row > revealer {
+ padding: 0 14px; }
+ placessidebar row:selected {
+ color: white; }
+ placessidebar row:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ placessidebar row:backdrop {
+ color: white; }
+ placessidebar row:backdrop:selected {
+ color: #FF5F57; }
+ placessidebar row:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ placessidebar row image.sidebar-icon:dir(ltr) {
+ padding-right: 8px; }
+ placessidebar row image.sidebar-icon:dir(rtl) {
+ padding-left: 8px; }
+ placessidebar row label.sidebar-label:dir(ltr) {
+ padding-right: 2px; }
+ placessidebar row label.sidebar-label:dir(rtl) {
+ padding-left: 2px; }
+ button.sidebar-button {
+ min-height: 26px;
+ min-width: 26px;
+ margin-top: 3px;
+ margin-bottom: 3px;
+ padding: 0; }
+ placessidebar row:selected:active {
+ box-shadow: none; }
+ placessidebar row.sidebar-placeholder-row {
+ padding: 0 8px;
+ min-height: 2px;
+ background-image: none;
+ background-clip: content-box; }
+ placessidebar row.sidebar-new-bookmark-row {
+ color: #FF5F57; }
+
+placesview .server-list-button > image {
+ transition: 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ -gtk-icon-transform: rotate(0turn); }
+placesview .server-list-button:checked > image {
+ transition: 200ms cubic-bezier(0.25, 0.46, 0.45, 0.94);
+ -gtk-icon-transform: rotate(-0.5turn); }
+placesview row.activatable:hover {
+ background-color: transparent; }
+placesview > actionbar > revealer > box > label {
+ padding-left: 8px;
+ padding-right: 8px; }
+
+stacksidebar.sidebar row {
+ padding: 10px 4px; }
+ stacksidebar.sidebar row > label {
+ padding-left: 6px;
+ padding-right: 6px; }
+ stacksidebar.sidebar row.needs-attention > .label {
+ background-size: 6px 6px, 0 0; }
+
+/*****************
+ * GtkSpinButton *
+ *****************/
+spinbutton:not(.vertical) {
+ padding: 0; }
+ spinbutton:not(.vertical) entry {
+ min-width: 28px;
+ margin: 0;
+ background: none;
+ background-color: transparent;
+ border: none;
+ border-radius: 0;
+ box-shadow: none; }
+ spinbutton:not(.vertical) entry:backdrop:disabled {
+ background-color: transparent; }
+ spinbutton:not(.vertical) button {
+ min-height: 16px;
+ margin: 0;
+ padding-bottom: 0;
+ padding-top: 0;
+ color: white;
+ background-image: none;
+ background-color: transparent;
+ border-style: none;
+ box-shadow: none; }
+ spinbutton:not(.vertical) button:hover {
+ color: #FF5F57; }
+ spinbutton:not(.vertical) button:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+ spinbutton:not(.vertical) button:active {
+ color: #FF5F57;
+ box-shadow: none; }
+ spinbutton:not(.vertical) button:backdrop {
+ color: white;
+ background-color: transparent; }
+ spinbutton:not(.vertical) button:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ background-color: transparent;
+ border-style: none; }
+ spinbutton:not(.vertical) button:dir(ltr):last-child {
+ border-radius: 0 3px 3px 0; }
+ spinbutton:not(.vertical) button:dir(rtl):first-child {
+ border-radius: 3px 0 0 3px; }
+spinbutton.vertical:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+spinbutton.vertical:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35); }
+spinbutton.vertical:drop(active) {
+ border-color: transparent;
+ box-shadow: none; }
+spinbutton.vertical entry {
+ margin: 0px;
+ min-height: 26px;
+ min-width: 26px;
+ border-style: none solid none solid;
+ border-color: #5f6367;
+ padding: 0;
+ border-radius: 0; }
+ spinbutton.vertical entry:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ background-color: #252b2f;
+ border-color: rgba(86, 90, 94, 0.35); }
+ spinbutton.vertical entry:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ background-color: #252b2f;
+ border-color: rgba(86, 90, 94, 0.35); }
+spinbutton.vertical button {
+ min-height: 26px;
+ min-width: 26px;
+ padding: 0;
+ box-shadow: none;
+ background-image: none;
+ background-color: #292f34;
+ color: white;
+ border-color: #5f6367; }
+ spinbutton.vertical button:hover {
+ color: #FF5F57; }
+ spinbutton.vertical button:active {
+ color: #FF5F57; }
+ spinbutton.vertical button:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ background-color: #252b2f;
+ border-color: rgba(86, 90, 94, 0.35); }
+ spinbutton.vertical button:backdrop:disabled {
+ color: rgba(232, 232, 232, 0.35);
+ background-color: #252b2f;
+ border-color: rgba(86, 90, 94, 0.35); }
+spinbutton.vertical button.up {
+ border-radius: 3px 3px 0 0;
+ border-style: solid solid none solid; }
+spinbutton.vertical button.down {
+ border-radius: 0 0 3px 3px;
+ border-style: none solid solid solid; }
+treeview spinbutton:not(.vertical) {
+ min-height: 0;
+ border-style: none;
+ border-radius: 0; }
+ treeview spinbutton:not(.vertical) entry {
+ min-height: 0;
+ padding: 1px 2px; }
+
+/**********
+ * Switch *
+ **********/
+switch {
+ margin: 2px;
+ font-weight: bold;
+ font-size: smaller;
+ min-width: 48px;
+ min-height: 24px;
+ border: 0px solid;
+ border-radius: 12px;
+ color: transparent;
+ background-color: rgba(255, 255, 255, 0.3);
+ text-shadow: none; }
+ switch:checked {
+ background-color: #FF5F57; }
+ switch:backdrop {
+ background-color: rgba(255, 255, 255, 0.3);
+ text-shadow: none; }
+ switch:backdrop:checked {
+ background-color: #FF5F57; }
+ switch slider {
+ min-width: 22px;
+ min-height: 22px;
+ border: 1px solid;
+ border-radius: 11px;
+ background-color: #292f34;
+ border-color: #5f6367; }
+ switch:hover slider {
+ border-color: #FF5F57; }
+ switch:disabled slider {
+ background-color: #252b2f; }
+ switch:backdrop slider {
+ background-color: #292f34; }
+ switch:backdrop:disabled slider {
+ background-color: #252b2f; }
+
+/************
+ * Toolbars *
+ ************/
+toolbar, .inline-toolbar, searchbar,
+.location-bar {
+ -GtkWidget-window-dragging: true;
+ padding: 4px;
+ background-color: #292f34; }
+
+toolbar {
+ padding: 4px 3px 3px 4px; }
+ toolbar:backdrop {
+ background-color: #292f34;
+ box-shadow: none; }
+ toolbar button {
+ margin: 2px;
+ padding: 3px; }
+ toolbar button.image-button, toolbar button.text-button.image-button {
+ padding: 3px; }
+ toolbar separator {
+ margin-left: 3px;
+ margin-right: 3px; }
+ toolbar entry {
+ margin: 3px; }
+ .osd toolbar {
+ background-color: transparent; }
+ toolbar.osd {
+ padding: 13px;
+ border: none;
+ border-radius: 3px;
+ background-color: #292f34; }
+ toolbar.osd:backdrop {
+ border-color: #5f6367;
+ background-color: #292f34;
+ box-shadow: none; }
+ toolbar.osd.left, toolbar.osd.right, toolbar.osd.top, toolbar.osd.bottom {
+ border-radius: 0; }
+
+.inline-toolbar {
+ border-width: 0px 0px 1px 0px;
+ padding: 3px;
+ border-radius: 0; }
+
+searchbar,
+.location-bar {
+ border-width: 0px 0px 1px 0px;
+ padding: 3px; }
+
+.inline-toolbar, searchbar,
+.location-bar {
+ border-style: solid;
+ border-color: #5f6367;
+ text-shadow: none;
+ background-color: #292f34; }
+
+/************
+ * Tooltips *
+ ************/
+tooltip {
+ color: #f7f7f7;
+ padding: 4px;
+ /* not working */
+ border-radius: 3px;
+ box-shadow: none;
+ text-shadow: none; }
+ tooltip.background {
+ background-color: #292f34;
+ background-clip: padding-box; }
+ tooltip.window-frame.csd {
+ background-color: transparent;
+ box-shadow: none; }
+ tooltip decoration {
+ background-color: transparent; }
+
+tooltip * {
+ padding: 0px;
+ background-color: transparent;
+ color: #f7f7f7; }
+
+/**************
+ * Tree Views *
+ **************/
+treeview.view {
+ -GtkTreeView-grid-line-width: 0;
+ -GtkTreeView-grid-line-pattern: '';
+ -GtkTreeView-tree-line-width: 1;
+ -GtkTreeView-tree-line-pattern: '';
+ -GtkTreeView-expander-size: 16;
+ border-left-color: #5f6367;
+ border-top-color: transparent; }
+ treeview.view:selected {
+ border-radius: 0; }
+ treeview.view:selected {
+ background-color: #FF5F57;
+ border-left-color: white;
+ border-top-color: white; }
+ treeview.view:backdrop:selected {
+ background-color: rgba(255, 95, 87, 0.5);
+ border-left-color: white;
+ border-top-color: white; }
+ treeview.view:disabled {
+ color: rgba(86, 90, 94, 0.35); }
+ treeview.view:disabled:selected {
+ color: rgba(232, 232, 232, 0.35); }
+ treeview.view:disabled:selected:backdrop {
+ color: rgba(232, 232, 232, 0.35); }
+ treeview.view:disabled:backdrop {
+ color: rgba(86, 90, 94, 0.35); }
+ treeview.view.seperator {
+ min-height: 2px;
+ color: #5f6367; }
+ treeview.view.separator:backdrop {
+ color: #5f6367; }
+ treeview.view:backdrop {
+ border-left-color: #5f6367; }
+ treeview.view:drop(active) {
+ border-style: solid none;
+ border-width: 1px;
+ border-color: #FF5F57; }
+ treeview.view.expander {
+ -gtk-icon-source: -gtk-icontheme("pan-end-symbolic");
+ color: white; }
+ treeview.view.expander:dir(rtl) {
+ -gtk-icon-source: -gtk-icontheme("pan-start-symbolic"); }
+ treeview.view.expander:hover {
+ color: #FF5F57; }
+ treeview.view.expander:selected {
+ color: white; }
+ treeview.view.expander:checked {
+ -gtk-icon-source: -gtk-icontheme("pan-down-symbolic"); }
+ treeview.view.expander:checked:selected {
+ color: white; }
+ treeview.view.expander:checked:backdrop {
+ color: #292f34; }
+ treeview.view.expander:backdrop {
+ color: #292f34; }
+ treeview.view header button {
+ color: white;
+ background-color: #292f34;
+ text-shadow: none;
+ box-shadow: none; }
+ treeview.view header button:hover {
+ color: white;
+ background-color: rgba(255, 95, 87, 0.5);
+ box-shadow: none;
+ transition: none; }
+ treeview.view header button:active {
+ color: white;
+ background-color: rgba(255, 95, 87, 0.5);
+ transition: none; }
+ treeview.view header button:last-child:backdrop, treeview.view header button:last-child {
+ border-right-style: none; }
+ treeview.view button.dnd:active, treeview.view button.dnd:selected, treeview.view button.dnd:hover, treeview.view button.dnd,
+ treeview.view header.button.dnd:active,
+ treeview.view header.button.dnd:selected,
+ treeview.view header.button.dnd:hover,
+ treeview.view header.button.dnd {
+ padding: 0 6px;
+ color: white;
+ background-image: none;
+ background-color: #FF5F57;
+ border-style: none;
+ border-radius: 0;
+ box-shadow: none;
+ text-shadow: none;
+ transition: none; }
+
+treeview.view header button, treeview.view header button:hover, treeview.view header button:active {
+ padding: 6px;
+ border-style: none solid solid none;
+ border-radius: 0;
+ background-image: none;
+ border-color: #5f6367;
+ text-shadow: none; }
+ treeview.view header button:disabled {
+ border-color: rgba(86, 90, 94, 0.35);
+ color: rgba(232, 232, 232, 0.35);
+ background-color: #252b2f;
+ background-image: none; }
+ treeview.view header button:backdrop {
+ border-color: #5f6367;
+ border-style: none solid solid none;
+ color: white;
+ background-image: none;
+ background-color: #292f34; }
+ treeview.view header button:backdrop:disabled {
+ border-color: rgba(86, 90, 94, 0.35);
+ background-image: none;
+ background-color: #252b2f;
+ color: rgba(232, 232, 232, 0.35); }
+
+/**********************
+ * Window Decorations *
+ *********************/
+decoration {
+ border-radius: 3px 3px 0 0;
+ border-width: 0px;
+ box-shadow: 0 2px 6px 1px rgba(0, 0, 0, 0.5);
+ /* this is used for the resize cursor area */
+ margin: 10px; }
+ .maximized decoration, .fullscreen decoration, .tiled decoration {
+ border-radius: 0; }
+ .popup decoration {
+ border-radius: 3px;
+ box-shadow: 2px 2px 2px 1px rgba(0, 0, 0, 0.1); }
+ .ssd decoration {
+ box-shadow: 0 2px 6px 1px rgba(0, 0, 0, 0.1); }
+ .csd decoration {
+ border-radius: 3px; }
+ .csd decoration.popup {
+ box-shadow: 2px 2px 2px 1px rgba(0, 0, 0, 0.1); }
+ .csd decoration.tooltip {
+ box-shadow: none; }
+ .csd decoration.message-dialog {
+ box-shadow: 0 2px 6px 1px rgba(0, 0, 0, 0.5); }
+ .solid-csd decoration {
+ border-radius: 0;
+ margin: 0;
+ padding: 1px;
+ border: none;
+ background-color: #5f6367;
+ box-shadow: none; }
+
+headerbar.default-decoration button.titlebutton,
+.titlebar.default-decoration button.titlebutton {
+ padding: 6px 1px;
+ min-height: 18px;
+ min-width: 18px;
+ margin: 0; }
+headerbar button.titlebutton,
+.titlebar button.titlebutton {
+ padding: 6px; }
+ headerbar button.titlebutton:hover, headerbar button.titlebutton:active, headerbar button.titlebutton:checked, headerbar button.titlebutton:backdrop, headerbar button.titlebutton:active:hover,
+ .titlebar button.titlebutton:hover,
+ .titlebar button.titlebutton:active,
+ .titlebar button.titlebutton:checked,
+ .titlebar button.titlebutton:backdrop,
+ .titlebar button.titlebutton:active:hover {
+ transition: none; }
+ headerbar button.titlebutton.close,
+ .titlebar button.titlebutton.close {
+ padding: 6px 1px;
+ color: transparent;
+ border-image: none;
+ box-shadow: none;
+ background-position: center;
+ background-repeat: no-repeat
+ }
+ headerbar button.titlebutton.close:hover,
+ .titlebar button.titlebutton.close:hover {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.close:active,
+ .titlebar button.titlebutton.close:active {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.close:backdrop,
+ .titlebar button.titlebutton.close:backdrop {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.maximize,
+ .titlebar button.titlebutton.maximize {
+ padding: 6px 1px;
+ color: transparent;
+ border-image: none;
+ box-shadow: none;
+ background-position: center;
+ background-repeat: no-repeat;
+ }
+ headerbar button.titlebutton.maximize:hover,
+ .titlebar button.titlebutton.maximize:hover {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.maximize:active,
+ .titlebar button.titlebutton.maximize:active {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.maximize:backdrop,
+ .titlebar button.titlebutton.maximize:backdrop {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.minimize,
+ .titlebar button.titlebutton.minimize {
+ padding: 6px 1px;
+ color: transparent;
+ border-image: none;
+ box-shadow: none;
+ background-position: center;
+ background-repeat: no-repeat;
+ }
+ headerbar button.titlebutton.minimize:hover,
+ .titlebar button.titlebutton.minimize:hover {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.minimize:active,
+ .titlebar button.titlebutton.minimize:active {
+ border-color: transparent;
+ background-color: transparent;
+ }
+ headerbar button.titlebutton.minimize:backdrop,
+ .titlebar button.titlebutton.minimize:backdrop {
+ border-color: transparent;
+ background-color: transparent;
+ }
+.maximized headerbar button.titlebutton.maximize, .maximized
+.titlebar button.titlebutton.maximize {
+ padding: 6px 1px;
+ color: transparent;
+ border-image: none;
+ box-shadow: none;
+ background-position: center;
+ background-repeat: no-repeat;
+ }
+.maximized headerbar button.titlebutton.maximize:hover, .maximized
+.titlebar button.titlebutton.maximize:hover {
+ border-color: transparent;
+ background-color: transparent;
+ }
+.maximized headerbar button.titlebutton.maximize:active, .maximized
+.titlebar button.titlebutton.maximize:active {
+ border-color: transparent;
+ background-color: transparent;
+ }
+.maximized headerbar button.titlebutton.maximize:backdrop, .maximized
+.titlebar button.titlebutton.maximize:backdrop {
+ border-color: transparent;
+ background-color: transparent;
+ }
+
+headerbar.selection-mode button.titlebutton,
+.titlebar.selection-mode button.titlebutton {
+ text-shadow: none; }
+ headerbar.selection-mode button.titlebutton:backdrop,
+ .titlebar.selection-mode button.titlebutton:backdrop {
+ -gtk-icon-shadow: none; }
+
+/*
+ Original theme source: https://gitlab.manjaro.org/artwork/themes/breath-gtk
+ Changes to original:
+ - all refrences to assets have been removed
+ - green hex codes been changed to #FF5F57
+*/
+
+/*
+ GNU LESSER GENERAL PUBLIC LICENSE
+ Version 2.1, February 1999
+
+ Copyright (C) 1991, 1999 Free Software Foundation, Inc.
+ 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ Everyone is permitted to copy and distribute verbatim copies
+ of this license document, but changing it is not allowed.
+
+(This is the first released version of the Lesser GPL. It also counts
+ as the successor of the GNU Library Public License, version 2, hence
+ the version number 2.1.)
+
+ Preamble
+
+ The licenses for most software are designed to take away your
+freedom to share and change it. By contrast, the GNU General Public
+Licenses are intended to guarantee your freedom to share and change
+free software--to make sure the software is free for all its users.
+
+ This license, the Lesser General Public License, applies to some
+specially designated software packages--typically libraries--of the
+Free Software Foundation and other authors who decide to use it. You
+can use it too, but we suggest you first think carefully about whether
+this license or the ordinary General Public License is the better
+strategy to use in any particular case, based on the explanations below.
+
+ When we speak of free software, we are referring to freedom of use,
+not price. Our General Public Licenses are designed to make sure that
+you have the freedom to distribute copies of free software (and charge
+for this service if you wish); that you receive source code or can get
+it if you want it; that you can change the software and use pieces of
+it in new free programs; and that you are informed that you can do
+these things.
+
+ To protect your rights, we need to make restrictions that forbid
+distributors to deny you these rights or to ask you to surrender these
+rights. These restrictions translate to certain responsibilities for
+you if you distribute copies of the library or if you modify it.
+
+ For example, if you distribute copies of the library, whether gratis
+or for a fee, you must give the recipients all the rights that we gave
+you. You must make sure that they, too, receive or can get the source
+code. If you link other code with the library, you must provide
+complete object files to the recipients, so that they can relink them
+with the library after making changes to the library and recompiling
+it. And you must show them these terms so they know their rights.
+
+ We protect your rights with a two-step method: (1) we copyright the
+library, and (2) we offer you this license, which gives you legal
+permission to copy, distribute and/or modify the library.
+
+ To protect each distributor, we want to make it very clear that
+there is no warranty for the free library. Also, if the library is
+modified by someone else and passed on, the recipients should know
+that what they have is not the original version, so that the original
+author's reputation will not be affected by problems that might be
+introduced by others.
+
+ Finally, software patents pose a constant threat to the existence of
+any free program. We wish to make sure that a company cannot
+effectively restrict the users of a free program by obtaining a
+restrictive license from a patent holder. Therefore, we insist that
+any patent license obtained for a version of the library must be
+consistent with the full freedom of use specified in this license.
+
+ Most GNU software, including some libraries, is covered by the
+ordinary GNU General Public License. This license, the GNU Lesser
+General Public License, applies to certain designated libraries, and
+is quite different from the ordinary General Public License. We use
+this license for certain libraries in order to permit linking those
+libraries into non-free programs.
+
+ When a program is linked with a library, whether statically or using
+a shared library, the combination of the two is legally speaking a
+combined work, a derivative of the original library. The ordinary
+General Public License therefore permits such linking only if the
+entire combination fits its criteria of freedom. The Lesser General
+Public License permits more lax criteria for linking other code with
+the library.
+
+ We call this license the "Lesser" General Public License because it
+does Less to protect the user's freedom than the ordinary General
+Public License. It also provides other free software developers Less
+of an advantage over competing non-free programs. These disadvantages
+are the reason we use the ordinary General Public License for many
+libraries. However, the Lesser license provides advantages in certain
+special circumstances.
+
+ For example, on rare occasions, there may be a special need to
+encourage the widest possible use of a certain library, so that it becomes
+a de-facto standard. To achieve this, non-free programs must be
+allowed to use the library. A more frequent case is that a free
+library does the same job as widely used non-free libraries. In this
+case, there is little to gain by limiting the free library to free
+software only, so we use the Lesser General Public License.
+
+ In other cases, permission to use a particular library in non-free
+programs enables a greater number of people to use a large body of
+free software. For example, permission to use the GNU C Library in
+non-free programs enables many more people to use the whole GNU
+operating system, as well as its variant, the GNU/Linux operating
+system.
+
+ Although the Lesser General Public License is Less protective of the
+users' freedom, it does ensure that the user of a program that is
+linked with the Library has the freedom and the wherewithal to run
+that program using a modified version of the Library.
+
+ The precise terms and conditions for copying, distribution and
+modification follow. Pay close attention to the difference between a
+"work based on the library" and a "work that uses the library". The
+former contains code derived from the library, whereas the latter must
+be combined with the library in order to run.
+
+ GNU LESSER GENERAL PUBLIC LICENSE
+ TERMS AND CONDITIONS FOR COPYING, DISTRIBUTION AND MODIFICATION
+
+ 0. This License Agreement applies to any software library or other
+program which contains a notice placed by the copyright holder or
+other authorized party saying it may be distributed under the terms of
+this Lesser General Public License (also called "this License").
+Each licensee is addressed as "you".
+
+ A "library" means a collection of software functions and/or data
+prepared so as to be conveniently linked with application programs
+(which use some of those functions and data) to form executables.
+
+ The "Library", below, refers to any such software library or work
+which has been distributed under these terms. A "work based on the
+Library" means either the Library or any derivative work under
+copyright law: that is to say, a work containing the Library or a
+portion of it, either verbatim or with modifications and/or translated
+straightforwardly into another language. (Hereinafter, translation is
+included without limitation in the term "modification".)
+
+ "Source code" for a work means the preferred form of the work for
+making modifications to it. For a library, complete source code means
+all the source code for all modules it contains, plus any associated
+interface definition files, plus the scripts used to control compilation
+and installation of the library.
+
+ Activities other than copying, distribution and modification are not
+covered by this License; they are outside its scope. The act of
+running a program using the Library is not restricted, and output from
+such a program is covered only if its contents constitute a work based
+on the Library (independent of the use of the Library in a tool for
+writing it). Whether that is true depends on what the Library does
+and what the program that uses the Library does.
+
+ 1. You may copy and distribute verbatim copies of the Library's
+complete source code as you receive it, in any medium, provided that
+you conspicuously and appropriately publish on each copy an
+appropriate copyright notice and disclaimer of warranty; keep intact
+all the notices that refer to this License and to the absence of any
+warranty; and distribute a copy of this License along with the
+Library.
+
+ You may charge a fee for the physical act of transferring a copy,
+and you may at your option offer warranty protection in exchange for a
+fee.
+
+ 2. You may modify your copy or copies of the Library or any portion
+of it, thus forming a work based on the Library, and copy and
+distribute such modifications or work under the terms of Section 1
+above, provided that you also meet all of these conditions:
+
+ a) The modified work must itself be a software library.
+
+ b) You must cause the files modified to carry prominent notices
+ stating that you changed the files and the date of any change.
+
+ c) You must cause the whole of the work to be licensed at no
+ charge to all third parties under the terms of this License.
+
+ d) If a facility in the modified Library refers to a function or a
+ table of data to be supplied by an application program that uses
+ the facility, other than as an argument passed when the facility
+ is invoked, then you must make a good faith effort to ensure that,
+ in the event an application does not supply such function or
+ table, the facility still operates, and performs whatever part of
+ its purpose remains meaningful.
+
+ (For example, a function in a library to compute square roots has
+ a purpose that is entirely well-defined independent of the
+ application. Therefore, Subsection 2d requires that any
+ application-supplied function or table used by this function must
+ be optional: if the application does not supply it, the square
+ root function must still compute square roots.)
+
+These requirements apply to the modified work as a whole. If
+identifiable sections of that work are not derived from the Library,
+and can be reasonably considered independent and separate works in
+themselves, then this License, and its terms, do not apply to those
+sections when you distribute them as separate works. But when you
+distribute the same sections as part of a whole which is a work based
+on the Library, the distribution of the whole must be on the terms of
+this License, whose permissions for other licensees extend to the
+entire whole, and thus to each and every part regardless of who wrote
+it.
+
+Thus, it is not the intent of this section to claim rights or contest
+your rights to work written entirely by you; rather, the intent is to
+exercise the right to control the distribution of derivative or
+collective works based on the Library.
+
+In addition, mere aggregation of another work not based on the Library
+with the Library (or with a work based on the Library) on a volume of
+a storage or distribution medium does not bring the other work under
+the scope of this License.
+
+ 3. You may opt to apply the terms of the ordinary GNU General Public
+License instead of this License to a given copy of the Library. To do
+this, you must alter all the notices that refer to this License, so
+that they refer to the ordinary GNU General Public License, version 2,
+instead of to this License. (If a newer version than version 2 of the
+ordinary GNU General Public License has appeared, then you can specify
+that version instead if you wish.) Do not make any other change in
+these notices.
+
+ Once this change is made in a given copy, it is irreversible for
+that copy, so the ordinary GNU General Public License applies to all
+subsequent copies and derivative works made from that copy.
+
+ This option is useful when you wish to copy part of the code of
+the Library into a program that is not a library.
+
+ 4. You may copy and distribute the Library (or a portion or
+derivative of it, under Section 2) in object code or executable form
+under the terms of Sections 1 and 2 above provided that you accompany
+it with the complete corresponding machine-readable source code, which
+must be distributed under the terms of Sections 1 and 2 above on a
+medium customarily used for software interchange.
+
+ If distribution of object code is made by offering access to copy
+from a designated place, then offering equivalent access to copy the
+source code from the same place satisfies the requirement to
+distribute the source code, even though third parties are not
+compelled to copy the source along with the object code.
+
+ 5. A program that contains no derivative of any portion of the
+Library, but is designed to work with the Library by being compiled or
+linked with it, is called a "work that uses the Library". Such a
+work, in isolation, is not a derivative work of the Library, and
+therefore falls outside the scope of this License.
+
+ However, linking a "work that uses the Library" with the Library
+creates an executable that is a derivative of the Library (because it
+contains portions of the Library), rather than a "work that uses the
+library". The executable is therefore covered by this License.
+Section 6 states terms for distribution of such executables.
+
+ When a "work that uses the Library" uses material from a header file
+that is part of the Library, the object code for the work may be a
+derivative work of the Library even though the source code is not.
+Whether this is true is especially significant if the work can be
+linked without the Library, or if the work is itself a library. The
+threshold for this to be true is not precisely defined by law.
+
+ If such an object file uses only numerical parameters, data
+structure layouts and accessors, and small macros and small inline
+functions (ten lines or less in length), then the use of the object
+file is unrestricted, regardless of whether it is legally a derivative
+work. (Executables containing this object code plus portions of the
+Library will still fall under Section 6.)
+
+ Otherwise, if the work is a derivative of the Library, you may
+distribute the object code for the work under the terms of Section 6.
+Any executables containing that work also fall under Section 6,
+whether or not they are linked directly with the Library itself.
+
+ 6. As an exception to the Sections above, you may also combine or
+link a "work that uses the Library" with the Library to produce a
+work containing portions of the Library, and distribute that work
+under terms of your choice, provided that the terms permit
+modification of the work for the customer's own use and reverse
+engineering for debugging such modifications.
+
+ You must give prominent notice with each copy of the work that the
+Library is used in it and that the Library and its use are covered by
+this License. You must supply a copy of this License. If the work
+during execution displays copyright notices, you must include the
+copyright notice for the Library among them, as well as a reference
+directing the user to the copy of this License. Also, you must do one
+of these things:
+
+ a) Accompany the work with the complete corresponding
+ machine-readable source code for the Library including whatever
+ changes were used in the work (which must be distributed under
+ Sections 1 and 2 above); and, if the work is an executable linked
+ with the Library, with the complete machine-readable "work that
+ uses the Library", as object code and/or source code, so that the
+ user can modify the Library and then relink to produce a modified
+ executable containing the modified Library. (It is understood
+ that the user who changes the contents of definitions files in the
+ Library will not necessarily be able to recompile the application
+ to use the modified definitions.)
+
+ b) Use a suitable shared library mechanism for linking with the
+ Library. A suitable mechanism is one that (1) uses at run time a
+ copy of the library already present on the user's computer system,
+ rather than copying library functions into the executable, and (2)
+ will operate properly with a modified version of the library, if
+ the user installs one, as long as the modified version is
+ interface-compatible with the version that the work was made with.
+
+ c) Accompany the work with a written offer, valid for at
+ least three years, to give the same user the materials
+ specified in Subsection 6a, above, for a charge no more
+ than the cost of performing this distribution.
+
+ d) If distribution of the work is made by offering access to copy
+ from a designated place, offer equivalent access to copy the above
+ specified materials from the same place.
+
+ e) Verify that the user has already received a copy of these
+ materials or that you have already sent this user a copy.
+
+ For an executable, the required form of the "work that uses the
+Library" must include any data and utility programs needed for
+reproducing the executable from it. However, as a special exception,
+the materials to be distributed need not include anything that is
+normally distributed (in either source or binary form) with the major
+components (compiler, kernel, and so on) of the operating system on
+which the executable runs, unless that component itself accompanies
+the executable.
+
+ It may happen that this requirement contradicts the license
+restrictions of other proprietary libraries that do not normally
+accompany the operating system. Such a contradiction means you cannot
+use both them and the Library together in an executable that you
+distribute.
+
+ 7. You may place library facilities that are a work based on the
+Library side-by-side in a single library together with other library
+facilities not covered by this License, and distribute such a combined
+library, provided that the separate distribution of the work based on
+the Library and of the other library facilities is otherwise
+permitted, and provided that you do these two things:
+
+ a) Accompany the combined library with a copy of the same work
+ based on the Library, uncombined with any other library
+ facilities. This must be distributed under the terms of the
+ Sections above.
+
+ b) Give prominent notice with the combined library of the fact
+ that part of it is a work based on the Library, and explaining
+ where to find the accompanying uncombined form of the same work.
+
+ 8. You may not copy, modify, sublicense, link with, or distribute
+the Library except as expressly provided under this License. Any
+attempt otherwise to copy, modify, sublicense, link with, or
+distribute the Library is void, and will automatically terminate your
+rights under this License. However, parties who have received copies,
+or rights, from you under this License will not have their licenses
+terminated so long as such parties remain in full compliance.
+
+ 9. You are not required to accept this License, since you have not
+signed it. However, nothing else grants you permission to modify or
+distribute the Library or its derivative works. These actions are
+prohibited by law if you do not accept this License. Therefore, by
+modifying or distributing the Library (or any work based on the
+Library), you indicate your acceptance of this License to do so, and
+all its terms and conditions for copying, distributing or modifying
+the Library or works based on it.
+
+ 10. Each time you redistribute the Library (or any work based on the
+Library), the recipient automatically receives a license from the
+original licensor to copy, distribute, link with or modify the Library
+subject to these terms and conditions. You may not impose any further
+restrictions on the recipients' exercise of the rights granted herein.
+You are not responsible for enforcing compliance by third parties with
+this License.
+
+ 11. If, as a consequence of a court judgment or allegation of patent
+infringement or for any other reason (not limited to patent issues),
+conditions are imposed on you (whether by court order, agreement or
+otherwise) that contradict the conditions of this License, they do not
+excuse you from the conditions of this License. If you cannot
+distribute so as to satisfy simultaneously your obligations under this
+License and any other pertinent obligations, then as a consequence you
+may not distribute the Library at all. For example, if a patent
+license would not permit royalty-free redistribution of the Library by
+all those who receive copies directly or indirectly through you, then
+the only way you could satisfy both it and this License would be to
+refrain entirely from distribution of the Library.
+
+If any portion of this section is held invalid or unenforceable under any
+particular circumstance, the balance of the section is intended to apply,
+and the section as a whole is intended to apply in other circumstances.
+
+It is not the purpose of this section to induce you to infringe any
+patents or other property right claims or to contest validity of any
+such claims; this section has the sole purpose of protecting the
+integrity of the free software distribution system which is
+implemented by public license practices. Many people have made
+generous contributions to the wide range of software distributed
+through that system in reliance on consistent application of that
+system; it is up to the author/donor to decide if he or she is willing
+to distribute software through any other system and a licensee cannot
+impose that choice.
+
+This section is intended to make thoroughly clear what is believed to
+be a consequence of the rest of this License.
+
+ 12. If the distribution and/or use of the Library is restricted in
+certain countries either by patents or by copyrighted interfaces, the
+original copyright holder who places the Library under this License may add
+an explicit geographical distribution limitation excluding those countries,
+so that distribution is permitted only in or among countries not thus
+excluded. In such case, this License incorporates the limitation as if
+written in the body of this License.
+
+ 13. The Free Software Foundation may publish revised and/or new
+versions of the Lesser General Public License from time to time.
+Such new versions will be similar in spirit to the present version,
+but may differ in detail to address new problems or concerns.
+
+Each version is given a distinguishing version number. If the Library
+specifies a version number of this License which applies to it and
+"any later version", you have the option of following the terms and
+conditions either of that version or of any later version published by
+the Free Software Foundation. If the Library does not specify a
+license version number, you may choose any version ever published by
+the Free Software Foundation.
+
+ 14. If you wish to incorporate parts of the Library into other free
+programs whose distribution conditions are incompatible with these,
+write to the author to ask for permission. For software which is
+copyrighted by the Free Software Foundation, write to the Free
+Software Foundation; we sometimes make exceptions for this. Our
+decision will be guided by the two goals of preserving the free status
+of all derivatives of our free software and of promoting the sharing
+and reuse of software generally.
+
+ NO WARRANTY
+
+ 15. BECAUSE THE LIBRARY IS LICENSED FREE OF CHARGE, THERE IS NO
+WARRANTY FOR THE LIBRARY, TO THE EXTENT PERMITTED BY APPLICABLE LAW.
+EXCEPT WHEN OTHERWISE STATED IN WRITING THE COPYRIGHT HOLDERS AND/OR
+OTHER PARTIES PROVIDE THE LIBRARY "AS IS" WITHOUT WARRANTY OF ANY
+KIND, EITHER EXPRESSED OR IMPLIED, INCLUDING, BUT NOT LIMITED TO, THE
+IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR
+PURPOSE. THE ENTIRE RISK AS TO THE QUALITY AND PERFORMANCE OF THE
+LIBRARY IS WITH YOU. SHOULD THE LIBRARY PROVE DEFECTIVE, YOU ASSUME
+THE COST OF ALL NECESSARY SERVICING, REPAIR OR CORRECTION.
+
+ 16. IN NO EVENT UNLESS REQUIRED BY APPLICABLE LAW OR AGREED TO IN
+WRITING WILL ANY COPYRIGHT HOLDER, OR ANY OTHER PARTY WHO MAY MODIFY
+AND/OR REDISTRIBUTE THE LIBRARY AS PERMITTED ABOVE, BE LIABLE TO YOU
+FOR DAMAGES, INCLUDING ANY GENERAL, SPECIAL, INCIDENTAL OR
+CONSEQUENTIAL DAMAGES ARISING OUT OF THE USE OR INABILITY TO USE THE
+LIBRARY (INCLUDING BUT NOT LIMITED TO LOSS OF DATA OR DATA BEING
+RENDERED INACCURATE OR LOSSES SUSTAINED BY YOU OR THIRD PARTIES OR A
+FAILURE OF THE LIBRARY TO OPERATE WITH ANY OTHER SOFTWARE), EVEN IF
+SUCH HOLDER OR OTHER PARTY HAS BEEN ADVISED OF THE POSSIBILITY OF SUCH
+DAMAGES.
+
+ END OF TERMS AND CONDITIONS
+*/ \ No newline at end of file
diff --git a/Ryujinx/Ui/AboutWindow.cs b/Ryujinx/Ui/AboutWindow.cs
new file mode 100644
index 00000000..6f31b9cd
--- /dev/null
+++ b/Ryujinx/Ui/AboutWindow.cs
@@ -0,0 +1,116 @@
+using Gtk;
+using GUI = Gtk.Builder.ObjectAttribute;
+using System;
+using System.Diagnostics;
+using System.Reflection;
+using System.Runtime.InteropServices;
+using Utf8Json;
+using Utf8Json.Resolvers;
+using System.IO;
+
+namespace Ryujinx.UI
+{
+ public struct Info
+ {
+ public string InstallVersion;
+ public string InstallCommit;
+ public string InstallBranch;
+ }
+
+ public class AboutWindow : Window
+ {
+ public static Info Information { get; private set; }
+
+#pragma warning disable 649
+ [GUI] Window _aboutWin;
+ [GUI] Label _versionText;
+ [GUI] Image _ryujinxLogo;
+ [GUI] Image _patreonLogo;
+ [GUI] Image _gitHubLogo;
+ [GUI] Image _discordLogo;
+ [GUI] Image _twitterLogo;
+#pragma warning restore 649
+
+ public AboutWindow() : this(new Builder("Ryujinx.Ui.AboutWindow.glade")) { }
+
+ private AboutWindow(Builder builder) : base(builder.GetObject("_aboutWin").Handle)
+ {
+ builder.Autoconnect(this);
+
+ _aboutWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.RyujinxIcon.png");
+ _ryujinxLogo.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.RyujinxIcon.png", 100, 100);
+ _patreonLogo.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.PatreonLogo.png", 30 , 30 );
+ _gitHubLogo.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.GitHubLogo.png" , 30 , 30 );
+ _discordLogo.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.DiscordLogo.png", 30 , 30 );
+ _twitterLogo.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.TwitterLogo.png", 30 , 30 );
+
+ try
+ {
+ IJsonFormatterResolver resolver = CompositeResolver.Create(new[] { StandardResolver.AllowPrivateSnakeCase });
+
+ using (Stream stream = File.OpenRead(System.IO.Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFS", "Installer", "Config", "Config.json")))
+ {
+ Information = JsonSerializer.Deserialize<Info>(stream, resolver);
+ }
+
+ _versionText.Text = $"Version {Information.InstallVersion} - {Information.InstallBranch} ({Information.InstallCommit})";
+ }
+ catch
+ {
+ _versionText.Text = "Unknown Version";
+ }
+ }
+
+ public void OpenUrl(string url)
+ {
+ if (RuntimeInformation.IsOSPlatform(OSPlatform.Windows))
+ {
+ Process.Start(new ProcessStartInfo("cmd", $"/c start {url}"));
+ }
+ else if (RuntimeInformation.IsOSPlatform(OSPlatform.Linux))
+ {
+ Process.Start("xdg-open", url);
+ }
+ else if (RuntimeInformation.IsOSPlatform(OSPlatform.OSX))
+ {
+ Process.Start("open", url);
+ }
+ }
+
+ //Events
+ private void RyujinxButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://ryujinx.org");
+ }
+
+ private void PatreonButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://www.patreon.com/ryujinx");
+ }
+
+ private void GitHubButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://github.com/Ryujinx/Ryujinx");
+ }
+
+ private void DiscordButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://discordapp.com/invite/N2FmfVc");
+ }
+
+ private void TwitterButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://twitter.com/RyujinxEmu");
+ }
+
+ private void ContributersButton_Pressed(object obj, ButtonPressEventArgs args)
+ {
+ OpenUrl("https://github.com/Ryujinx/Ryujinx/graphs/contributors?type=a");
+ }
+
+ private void CloseToggle_Activated(object obj, EventArgs args)
+ {
+ Destroy();
+ }
+ }
+}
diff --git a/Ryujinx/Ui/AboutWindow.glade b/Ryujinx/Ui/AboutWindow.glade
new file mode 100644
index 00000000..28a80072
--- /dev/null
+++ b/Ryujinx/Ui/AboutWindow.glade
@@ -0,0 +1,574 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!-- Generated with glade 3.22.1 -->
+<interface>
+ <requires lib="gtk+" version="3.20"/>
+ <object class="GtkDialog" id="_aboutWin">
+ <property name="can_focus">False</property>
+ <property name="resizable">False</property>
+ <property name="modal">True</property>
+ <property name="window_position">center</property>
+ <property name="default_width">800</property>
+ <property name="default_height">350</property>
+ <property name="type_hint">dialog</property>
+ <child type="titlebar">
+ <placeholder/>
+ </child>
+ <child internal-child="vbox">
+ <object class="GtkBox">
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child internal-child="action_area">
+ <object class="GtkButtonBox">
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="bigBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkBox" id="leftBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">15</property>
+ <property name="margin_top">10</property>
+ <property name="margin_bottom">15</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="valign">start</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkImage" id="_ryujinxLogo">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="margin_top">10</property>
+ <property name="margin_bottom">10</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="valign">center</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Ryujinx</property>
+ <property name="justify">center</property>
+ <attributes>
+ <attribute name="scale" value="2.7000000000000002"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">(REE-YOU-JI-NX)</property>
+ <property name="justify">center</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEventBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <signal name="button-press-event" handler="RyujinxButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Click to open the Ryujinx website in your default browser</property>
+ <property name="label" translatable="yes">www.ryujinx.org</property>
+ <property name="justify">center</property>
+ <attributes>
+ <attribute name="underline" value="True"/>
+ </attributes>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel" id="_versionText">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Version x.x.x (Commit Number)</property>
+ <property name="justify">center</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">2</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Unlicenced</property>
+ <property name="justify">center</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Ryujinx is not affiliated with Nintendo,
+or any of its partners, in any way</property>
+ <property name="justify">center</property>
+ <attributes>
+ <attribute name="scale" value="0.80000000000000004"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_top">25</property>
+ <child>
+ <object class="GtkEventBox" id="PatreonButton">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Click to open the Ryujinx Patreon page in your default browser</property>
+ <signal name="button-press-event" handler="PatreonButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkImage" id="_patreonLogo">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Patreon</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEventBox" id="GitHubButton">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Click to open the Ryujinx GitHub page in your default browser</property>
+ <signal name="button-press-event" handler="GitHubButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkImage" id="_gitHubLogo">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">GitHub</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEventBox" id="DiscordButton">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Click to open an invite to the Ryujinx Discord server in your default browser</property>
+ <signal name="button-press-event" handler="DiscordButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkImage" id="_discordLogo">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Discord</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEventBox" id="TwitterButton">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Click to open the Ryujinx Twitter page in your default browser</property>
+ <signal name="button-press-event" handler="TwitterButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkImage" id="_twitterLogo">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Twitter</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="pack_type">end</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">False</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSeparator">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_top">10</property>
+ <property name="margin_bottom">10</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="rightBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">15</property>
+ <property name="margin_right">10</property>
+ <property name="margin_top">40</property>
+ <property name="margin_bottom">15</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="label" translatable="yes">About</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_left">10</property>
+ <property name="label" translatable="yes">Ryujinx is an emulator for the Nintendo Switch.
+Please support us on Patreon.
+Get all the latest news on our Twitter or Discord.
+Developers interested in contributing can find out more on our Discord.</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="label" translatable="yes">Created By:</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkScrolledWindow">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="shadow_type">in</property>
+ <child>
+ <object class="GtkViewport">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="baseline_position">top</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="label" translatable="yes">gdkchan
+LDj3SNuD
+Ac_K
+Thog</property>
+ <property name="yalign">0</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="label" translatable="yes">»jD«
+emmaus
+Thealexbarney
+Andy A (BaronKiko)</property>
+ <property name="yalign">0</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEventBox" id="ContributersButton">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="valign">start</property>
+ <signal name="button-press-event" handler="ContributersButton_Pressed" swapped="no"/>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">end</property>
+ <property name="margin_right">5</property>
+ <property name="label" translatable="yes">All Contributors...</property>
+ <attributes>
+ <attribute name="underline" value="True"/>
+ </attributes>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+</interface>
diff --git a/Ryujinx/Ui/ApplicationLibrary.cs b/Ryujinx/Ui/ApplicationLibrary.cs
new file mode 100644
index 00000000..7e731f79
--- /dev/null
+++ b/Ryujinx/Ui/ApplicationLibrary.cs
@@ -0,0 +1,450 @@
+using LibHac;
+using LibHac.Fs;
+using LibHac.Fs.NcaUtils;
+using Ryujinx.Common.Logging;
+using System;
+using System.Collections.Generic;
+using System.IO;
+using System.Linq;
+using System.Reflection;
+using System.Text;
+using SystemState = Ryujinx.HLE.HOS.SystemState;
+
+namespace Ryujinx.UI
+{
+ public class ApplicationLibrary
+ {
+ private static Keyset KeySet;
+ private static SystemState.TitleLanguage DesiredTitleLanguage;
+
+ private const double SecondsPerMinute = 60.0;
+ private const double SecondsPerHour = SecondsPerMinute * 60;
+ private const double SecondsPerDay = SecondsPerHour * 24;
+
+ public static byte[] RyujinxNspIcon { get; private set; }
+ public static byte[] RyujinxXciIcon { get; private set; }
+ public static byte[] RyujinxNcaIcon { get; private set; }
+ public static byte[] RyujinxNroIcon { get; private set; }
+ public static byte[] RyujinxNsoIcon { get; private set; }
+
+ public static List<ApplicationData> ApplicationLibraryData { get; private set; }
+
+ public struct ApplicationData
+ {
+ public byte[] Icon;
+ public string TitleName;
+ public string TitleId;
+ public string Developer;
+ public string Version;
+ public string TimePlayed;
+ public string LastPlayed;
+ public string FileExt;
+ public string FileSize;
+ public string Path;
+ }
+
+ public static void Init(List<string> AppDirs, Keyset keySet, SystemState.TitleLanguage desiredTitleLanguage)
+ {
+ KeySet = keySet;
+ DesiredTitleLanguage = desiredTitleLanguage;
+
+ // Loads the default application Icons
+ RyujinxNspIcon = GetResourceBytes("Ryujinx.Ui.assets.ryujinxNSPIcon.png");
+ RyujinxXciIcon = GetResourceBytes("Ryujinx.Ui.assets.ryujinxXCIIcon.png");
+ RyujinxNcaIcon = GetResourceBytes("Ryujinx.Ui.assets.ryujinxNCAIcon.png");
+ RyujinxNroIcon = GetResourceBytes("Ryujinx.Ui.assets.ryujinxNROIcon.png");
+ RyujinxNsoIcon = GetResourceBytes("Ryujinx.Ui.assets.ryujinxNSOIcon.png");
+
+ // Builds the applications list with paths to found applications
+ List<string> applications = new List<string>();
+ foreach (string appDir in AppDirs)
+ {
+ if (Directory.Exists(appDir) == false)
+ {
+ Logger.PrintWarning(LogClass.Application, $"The \"game_dirs\" section in \"Config.json\" contains an invalid directory: \"{appDir}\"");
+
+ continue;
+ }
+
+ DirectoryInfo AppDirInfo = new DirectoryInfo(appDir);
+ foreach (FileInfo App in AppDirInfo.GetFiles())
+ {
+ if ((Path.GetExtension(App.ToString()) == ".xci") ||
+ (Path.GetExtension(App.ToString()) == ".nca") ||
+ (Path.GetExtension(App.ToString()) == ".nsp") ||
+ (Path.GetExtension(App.ToString()) == ".pfs0") ||
+ (Path.GetExtension(App.ToString()) == ".nro") ||
+ (Path.GetExtension(App.ToString()) == ".nso"))
+ {
+ applications.Add(App.ToString());
+ }
+ }
+ }
+
+ // Loops through applications list, creating a struct for each application and then adding the struct to a list of structs
+ ApplicationLibraryData = new List<ApplicationData>();
+ foreach (string applicationPath in applications)
+ {
+ double filesize = new FileInfo(applicationPath).Length * 0.000000000931;
+ string titleName = null;
+ string titleId = null;
+ string developer = null;
+ string version = null;
+ byte[] applicationIcon = null;
+
+ using (FileStream file = new FileStream(applicationPath, FileMode.Open, FileAccess.Read))
+ {
+ if ((Path.GetExtension(applicationPath) == ".nsp") ||
+ (Path.GetExtension(applicationPath) == ".pfs0") ||
+ (Path.GetExtension(applicationPath) == ".xci"))
+ {
+ try
+ {
+ IFileSystem controlFs = null;
+
+ // Store the ControlFS in variable called controlFs
+ if (Path.GetExtension(applicationPath) == ".xci")
+ {
+ Xci xci = new Xci(KeySet, file.AsStorage());
+
+ controlFs = GetControlFs(xci.OpenPartition(XciPartitionType.Secure));
+ }
+ else
+ {
+ controlFs = GetControlFs(new PartitionFileSystem(file.AsStorage()));
+ }
+
+ // Creates NACP class from the NACP file
+ IFile controlNacp = controlFs.OpenFile("/control.nacp", OpenMode.Read);
+ Nacp controlData = new Nacp(controlNacp.AsStream());
+
+ // Get the title name, title ID, developer name and version number from the NACP
+ version = controlData.DisplayVersion;
+
+ titleName = controlData.Descriptions[(int)DesiredTitleLanguage].Title;
+
+ if (string.IsNullOrWhiteSpace(titleName))
+ {
+ titleName = controlData.Descriptions.ToList().Find(x => !string.IsNullOrWhiteSpace(x.Title)).Title;
+ }
+
+ titleId = controlData.PresenceGroupId.ToString("x16");
+
+ if (string.IsNullOrWhiteSpace(titleId))
+ {
+ titleId = controlData.SaveDataOwnerId.ToString("x16");
+ }
+
+ if (string.IsNullOrWhiteSpace(titleId))
+ {
+ titleId = (controlData.AddOnContentBaseId - 0x1000).ToString("x16");
+ }
+
+ developer = controlData.Descriptions[(int)DesiredTitleLanguage].Developer;
+
+ if (string.IsNullOrWhiteSpace(developer))
+ {
+ developer = controlData.Descriptions.ToList().Find(x => !string.IsNullOrWhiteSpace(x.Developer)).Developer;
+ }
+
+ // Read the icon from the ControlFS and store it as a byte array
+ try
+ {
+ IFile icon = controlFs.OpenFile($"/icon_{DesiredTitleLanguage}.dat", OpenMode.Read);
+ using (MemoryStream stream = new MemoryStream())
+ {
+ icon.AsStream().CopyTo(stream);
+ applicationIcon = stream.ToArray();
+ }
+ }
+ catch (HorizonResultException)
+ {
+ IDirectory controlDir = controlFs.OpenDirectory("./", OpenDirectoryMode.All);
+ foreach (DirectoryEntry entry in controlDir.Read())
+ {
+ if (entry.Name == "control.nacp")
+ {
+ continue;
+ }
+
+ IFile icon = controlFs.OpenFile(entry.FullPath, OpenMode.Read);
+ using (MemoryStream stream = new MemoryStream())
+ {
+ icon.AsStream().CopyTo(stream);
+ applicationIcon = stream.ToArray();
+ }
+
+ if (applicationIcon != null)
+ {
+ break;
+ }
+ }
+
+ if (applicationIcon == null)
+ {
+ applicationIcon = NspOrXciIcon(applicationPath);
+ }
+ }
+ }
+ catch (MissingKeyException exception)
+ {
+ titleName = "Unknown";
+ titleId = "Unknown";
+ developer = "Unknown";
+ version = "?";
+ applicationIcon = NspOrXciIcon(applicationPath);
+
+ Logger.PrintWarning(LogClass.Application, $"Your key set is missing a key with the name: {exception.Name}");
+ }
+ catch (InvalidDataException)
+ {
+ titleName = "Unknown";
+ titleId = "Unknown";
+ developer = "Unknown";
+ version = "?";
+ applicationIcon = NspOrXciIcon(applicationPath);
+
+ Logger.PrintWarning(LogClass.Application, $"The file is not an NCA file or the header key is incorrect. Errored File: {applicationPath}");
+ }
+ catch (Exception exception)
+ {
+ Logger.PrintWarning(LogClass.Application, $"This warning usualy means that you have a DLC in one of you game directories\n{exception}");
+
+ continue;
+ }
+ }
+ else if (Path.GetExtension(applicationPath) == ".nro")
+ {
+ BinaryReader reader = new BinaryReader(file);
+
+ byte[] Read(long Position, int Size)
+ {
+ file.Seek(Position, SeekOrigin.Begin);
+
+ return reader.ReadBytes(Size);
+ }
+
+ file.Seek(24, SeekOrigin.Begin);
+ int AssetOffset = reader.ReadInt32();
+
+ if (Encoding.ASCII.GetString(Read(AssetOffset, 4)) == "ASET")
+ {
+ byte[] IconSectionInfo = Read(AssetOffset + 8, 0x10);
+
+ long iconOffset = BitConverter.ToInt64(IconSectionInfo, 0);
+ long iconSize = BitConverter.ToInt64(IconSectionInfo, 8);
+
+ ulong nacpOffset = reader.ReadUInt64();
+ ulong nacpSize = reader.ReadUInt64();
+
+ // Reads and stores game icon as byte array
+ applicationIcon = Read(AssetOffset + iconOffset, (int)iconSize);
+
+ // Creates memory stream out of byte array which is the NACP
+ using (MemoryStream stream = new MemoryStream(Read(AssetOffset + (int)nacpOffset, (int)nacpSize)))
+ {
+ // Creates NACP class from the memory stream
+ Nacp controlData = new Nacp(stream);
+
+ // Get the title name, title ID, developer name and version number from the NACP
+ version = controlData.DisplayVersion;
+
+ titleName = controlData.Descriptions[(int)DesiredTitleLanguage].Title;
+
+ if (string.IsNullOrWhiteSpace(titleName))
+ {
+ titleName = controlData.Descriptions.ToList().Find(x => !string.IsNullOrWhiteSpace(x.Title)).Title;
+ }
+
+ titleId = controlData.PresenceGroupId.ToString("x16");
+
+ if (string.IsNullOrWhiteSpace(titleId))
+ {
+ titleId = controlData.SaveDataOwnerId.ToString("x16");
+ }
+
+ if (string.IsNullOrWhiteSpace(titleId))
+ {
+ titleId = (controlData.AddOnContentBaseId - 0x1000).ToString("x16");
+ }
+
+ developer = controlData.Descriptions[(int)DesiredTitleLanguage].Developer;
+
+ if (string.IsNullOrWhiteSpace(developer))
+ {
+ developer = controlData.Descriptions.ToList().Find(x => !string.IsNullOrWhiteSpace(x.Developer)).Developer;
+ }
+ }
+ }
+ else
+ {
+ applicationIcon = RyujinxNroIcon;
+ titleName = "Application";
+ titleId = "0000000000000000";
+ developer = "Unknown";
+ version = "?";
+ }
+ }
+ // If its an NCA or NSO we just set defaults
+ else if ((Path.GetExtension(applicationPath) == ".nca") || (Path.GetExtension(applicationPath) == ".nso"))
+ {
+ if (Path.GetExtension(applicationPath) == ".nca")
+ {
+ applicationIcon = RyujinxNcaIcon;
+ }
+ else if (Path.GetExtension(applicationPath) == ".nso")
+ {
+ applicationIcon = RyujinxNsoIcon;
+ }
+
+ string fileName = Path.GetFileName(applicationPath);
+ string fileExt = Path.GetExtension(applicationPath);
+
+ StringBuilder titlename = new StringBuilder();
+ titlename.Append(fileName);
+ titlename.Remove(fileName.Length - fileExt.Length, fileExt.Length);
+
+ titleName = titlename.ToString();
+ titleId = "0000000000000000";
+ version = "?";
+ developer = "Unknown";
+ }
+ }
+
+ string[] playedData = GetPlayedData(titleId, "00000000000000000000000000000001");
+
+ ApplicationData data = new ApplicationData()
+ {
+ Icon = applicationIcon,
+ TitleName = titleName,
+ TitleId = titleId,
+ Developer = developer,
+ Version = version,
+ TimePlayed = playedData[0],
+ LastPlayed = playedData[1],
+ FileExt = Path.GetExtension(applicationPath).ToUpper().Remove(0 ,1),
+ FileSize = (filesize < 1) ? (filesize * 1024).ToString("0.##") + "MB" : filesize.ToString("0.##") + "GB",
+ Path = applicationPath,
+ };
+
+ ApplicationLibraryData.Add(data);
+ }
+ }
+
+ private static byte[] GetResourceBytes(string resourceName)
+ {
+ Stream resourceStream = Assembly.GetCallingAssembly().GetManifestResourceStream(resourceName);
+ byte[] resourceByteArray = new byte[resourceStream.Length];
+
+ resourceStream.Read(resourceByteArray);
+
+ return resourceByteArray;
+ }
+
+ private static IFileSystem GetControlFs(PartitionFileSystem Pfs)
+ {
+ Nca controlNca = null;
+
+ // Add keys to keyset if needed
+ foreach (DirectoryEntry ticketEntry in Pfs.EnumerateEntries("*.tik"))
+ {
+ Ticket ticket = new Ticket(Pfs.OpenFile(ticketEntry.FullPath, OpenMode.Read).AsStream());
+
+ if (!KeySet.TitleKeys.ContainsKey(ticket.RightsId))
+ {
+ KeySet.TitleKeys.Add(ticket.RightsId, ticket.GetTitleKey(KeySet));
+ }
+ }
+
+ // Find the Control NCA and store it in variable called controlNca
+ foreach (DirectoryEntry fileEntry in Pfs.EnumerateEntries("*.nca"))
+ {
+ Nca nca = new Nca(KeySet, Pfs.OpenFile(fileEntry.FullPath, OpenMode.Read).AsStorage());
+ if (nca.Header.ContentType == ContentType.Control)
+ {
+ controlNca = nca;
+ }
+ }
+
+ // Return the ControlFS
+ return controlNca.OpenFileSystem(NcaSectionType.Data, IntegrityCheckLevel.None);
+ }
+
+ private static string[] GetPlayedData(string TitleId, string UserId)
+ {
+ try
+ {
+ string[] playedData = new string[2];
+ string savePath = Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFS", "nand", "user", "save", "0000000000000000", UserId, TitleId);
+
+ if (File.Exists(Path.Combine(savePath, "TimePlayed.dat")) == false)
+ {
+ Directory.CreateDirectory(savePath);
+ using (FileStream file = File.OpenWrite(Path.Combine(savePath, "TimePlayed.dat")))
+ {
+ file.Write(Encoding.ASCII.GetBytes("0"));
+ }
+ }
+ using (FileStream fs = File.OpenRead(Path.Combine(savePath, "TimePlayed.dat")))
+ {
+ using (StreamReader sr = new StreamReader(fs))
+ {
+ float timePlayed = float.Parse(sr.ReadLine());
+
+ if (timePlayed < SecondsPerMinute)
+ {
+ playedData[0] = $"{timePlayed}s";
+ }
+ else if (timePlayed < SecondsPerHour)
+ {
+ playedData[0] = $"{Math.Round(timePlayed / SecondsPerMinute, 2, MidpointRounding.AwayFromZero)} mins";
+ }
+ else if (timePlayed < SecondsPerDay)
+ {
+ playedData[0] = $"{Math.Round(timePlayed / SecondsPerHour , 2, MidpointRounding.AwayFromZero)} hrs";
+ }
+ else
+ {
+ playedData[0] = $"{Math.Round(timePlayed / SecondsPerDay , 2, MidpointRounding.AwayFromZero)} days";
+ }
+ }
+ }
+
+ if (File.Exists(Path.Combine(savePath, "LastPlayed.dat")) == false)
+ {
+ Directory.CreateDirectory(savePath);
+ using (FileStream file = File.OpenWrite(Path.Combine(savePath, "LastPlayed.dat")))
+ {
+ file.Write(Encoding.ASCII.GetBytes("Never"));
+ }
+ }
+
+ using (FileStream fs = File.OpenRead(Path.Combine(savePath, "LastPlayed.dat")))
+ {
+ using (StreamReader sr = new StreamReader(fs))
+ {
+ playedData[1] = sr.ReadLine();
+ }
+ }
+
+ return playedData;
+ }
+ catch
+ {
+ return new string[] { "Unknown", "Unknown" };
+ }
+ }
+
+ private static byte[] NspOrXciIcon(string applicationPath)
+ {
+ if (Path.GetExtension(applicationPath) == ".xci")
+ {
+ return RyujinxXciIcon;
+ }
+ else
+ {
+ return RyujinxNspIcon;
+ }
+ }
+ }
+}
diff --git a/Ryujinx/Ui/GLScreen.cs b/Ryujinx/Ui/GLScreen.cs
index a881959c..7c394630 100644
--- a/Ryujinx/Ui/GLScreen.cs
+++ b/Ryujinx/Ui/GLScreen.cs
@@ -10,7 +10,7 @@ using System.Threading;
using Stopwatch = System.Diagnostics.Stopwatch;
-namespace Ryujinx
+namespace Ryujinx.UI
{
public class GlScreen : GameWindow
{
diff --git a/Ryujinx/Ui/MainWindow.cs b/Ryujinx/Ui/MainWindow.cs
new file mode 100644
index 00000000..132c90e6
--- /dev/null
+++ b/Ryujinx/Ui/MainWindow.cs
@@ -0,0 +1,601 @@
+using DiscordRPC;
+using Gtk;
+using GUI = Gtk.Builder.ObjectAttribute;
+using Ryujinx.Audio;
+using Ryujinx.Common.Logging;
+using Ryujinx.Graphics.Gal;
+using Ryujinx.Graphics.Gal.OpenGL;
+using Ryujinx.Profiler;
+using System;
+using System.Diagnostics;
+using System.IO;
+using System.Linq;
+using System.Reflection;
+using System.Text;
+using System.Threading;
+
+namespace Ryujinx.UI
+{
+ public class MainWindow : Window
+ {
+ internal static HLE.Switch _device;
+
+ private static IGalRenderer _renderer;
+
+ private static IAalOutput _audioOut;
+
+ private static Application _gtkApplication;
+
+ private static ListStore _tableStore;
+
+ private static bool _gameLoaded = false;
+
+ private static string _userId = "00000000000000000000000000000001";
+
+ public static bool DiscordIntegrationEnabled { get; set; }
+
+ public static DiscordRpcClient DiscordClient;
+
+ public static RichPresence DiscordPresence;
+
+#pragma warning disable 649
+ [GUI] Window _mainWin;
+ [GUI] CheckMenuItem _fullScreen;
+ [GUI] MenuItem _stopEmulation;
+ [GUI] CheckMenuItem _iconToggle;
+ [GUI] CheckMenuItem _titleToggle;
+ [GUI] CheckMenuItem _developerToggle;
+ [GUI] CheckMenuItem _versionToggle;
+ [GUI] CheckMenuItem _timePlayedToggle;
+ [GUI] CheckMenuItem _lastPlayedToggle;
+ [GUI] CheckMenuItem _fileExtToggle;
+ [GUI] CheckMenuItem _fileSizeToggle;
+ [GUI] CheckMenuItem _pathToggle;
+ [GUI] Box _box;
+ [GUI] TreeView _gameTable;
+ [GUI] GLArea _glScreen;
+#pragma warning restore 649
+
+ public MainWindow(string[] args, Application gtkApplication) : this(new Builder("Ryujinx.Ui.MainWindow.glade"), args, gtkApplication) { }
+
+ private MainWindow(Builder builder, string[] args, Application gtkApplication) : base(builder.GetObject("_mainWin").Handle)
+ {
+ _renderer = new OglRenderer();
+
+ _audioOut = InitializeAudioEngine();
+
+ _device = new HLE.Switch(_renderer, _audioOut);
+
+ Configuration.Load(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ Configuration.InitialConfigure(_device);
+
+ ApplicationLibrary.Init(SwitchSettings.SwitchConfig.GameDirs, _device.System.KeySet, _device.System.State.DesiredTitleLanguage);
+
+ _gtkApplication = gtkApplication;
+
+ ApplyTheme();
+
+ if (DiscordIntegrationEnabled)
+ {
+ DiscordClient = new DiscordRpcClient("568815339807309834");
+ DiscordPresence = new RichPresence
+ {
+ Assets = new Assets
+ {
+ LargeImageKey = "ryujinx",
+ LargeImageText = "Ryujinx is an emulator for the Nintendo Switch"
+ },
+ Details = "Main Menu",
+ State = "Idling",
+ Timestamps = new Timestamps(DateTime.UtcNow)
+ };
+
+ DiscordClient.Initialize();
+ DiscordClient.SetPresence(DiscordPresence);
+ }
+
+ builder.Autoconnect(this);
+
+ DeleteEvent += Window_Close;
+
+ _mainWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.RyujinxIcon.png");
+ _stopEmulation.Sensitive = false;
+
+ if (SwitchSettings.SwitchConfig.GuiColumns[0]) { _iconToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[1]) { _titleToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[2]) { _developerToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[3]) { _versionToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[4]) { _timePlayedToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[5]) { _lastPlayedToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[6]) { _fileExtToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[7]) { _fileSizeToggle.Active = true; }
+ if (SwitchSettings.SwitchConfig.GuiColumns[8]) { _pathToggle.Active = true; }
+
+ if (args.Length == 1)
+ {
+ // Temporary code section start, remove this section when game is rendered to the GLArea in the GUI
+ _box.Remove(_glScreen);
+
+ if (SwitchSettings.SwitchConfig.GuiColumns[0]) { _gameTable.AppendColumn("Icon", new CellRendererPixbuf(), "pixbuf", 0); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[1]) { _gameTable.AppendColumn("Application", new CellRendererText(), "text", 1); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[2]) { _gameTable.AppendColumn("Developer", new CellRendererText(), "text", 2); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[3]) { _gameTable.AppendColumn("Version", new CellRendererText(), "text", 3); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[4]) { _gameTable.AppendColumn("Time Played", new CellRendererText(), "text", 4); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[5]) { _gameTable.AppendColumn("Last Played", new CellRendererText(), "text", 5); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[6]) { _gameTable.AppendColumn("File Ext", new CellRendererText(), "text", 6); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[7]) { _gameTable.AppendColumn("File Size", new CellRendererText(), "text", 7); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[8]) { _gameTable.AppendColumn("Path", new CellRendererText(), "text", 8); }
+
+ _tableStore = new ListStore(typeof(Gdk.Pixbuf), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string));
+ _gameTable.Model = _tableStore;
+
+ UpdateGameTable();
+ // Temporary code section end
+
+ LoadApplication(args[0]);
+ }
+ else
+ {
+ _box.Remove(_glScreen);
+
+ if (SwitchSettings.SwitchConfig.GuiColumns[0]) { _gameTable.AppendColumn("Icon", new CellRendererPixbuf(), "pixbuf", 0); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[1]) { _gameTable.AppendColumn("Application", new CellRendererText(), "text", 1); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[2]) { _gameTable.AppendColumn("Developer", new CellRendererText(), "text", 2); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[3]) { _gameTable.AppendColumn("Version", new CellRendererText(), "text", 3); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[4]) { _gameTable.AppendColumn("Time Played", new CellRendererText(), "text", 4); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[5]) { _gameTable.AppendColumn("Last Played", new CellRendererText(), "text", 5); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[6]) { _gameTable.AppendColumn("File Ext", new CellRendererText(), "text", 6); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[7]) { _gameTable.AppendColumn("File Size", new CellRendererText(), "text", 7); }
+ if (SwitchSettings.SwitchConfig.GuiColumns[8]) { _gameTable.AppendColumn("Path", new CellRendererText(), "text", 8); }
+
+ _tableStore = new ListStore(typeof(Gdk.Pixbuf), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string), typeof(string));
+ _gameTable.Model = _tableStore;
+
+ UpdateGameTable();
+ }
+ }
+
+ public static void CreateErrorDialog(string errorMessage)
+ {
+ MessageDialog errorDialog = new MessageDialog(null, DialogFlags.Modal, MessageType.Error, ButtonsType.Ok, errorMessage)
+ {
+ Title = "Ryujinx - Error",
+ Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.RyujinxIcon.png"),
+ WindowPosition = WindowPosition.Center
+ };
+ errorDialog.SetSizeRequest(100, 20);
+ errorDialog.Run();
+ errorDialog.Destroy();
+ }
+
+ public static void UpdateGameTable()
+ {
+ _tableStore.Clear();
+ ApplicationLibrary.Init(SwitchSettings.SwitchConfig.GameDirs, _device.System.KeySet, _device.System.State.DesiredTitleLanguage);
+
+ foreach (ApplicationLibrary.ApplicationData AppData in ApplicationLibrary.ApplicationLibraryData)
+ {
+ _tableStore.AppendValues(new Gdk.Pixbuf(AppData.Icon, 75, 75), $"{AppData.TitleName}\n{AppData.TitleId.ToUpper()}", AppData.Developer, AppData.Version, AppData.TimePlayed, AppData.LastPlayed, AppData.FileExt, AppData.FileSize, AppData.Path);
+ }
+ }
+
+ public static void ApplyTheme()
+ {
+ CssProvider cssProvider = new CssProvider();
+
+ if (SwitchSettings.SwitchConfig.EnableCustomTheme)
+ {
+ if (File.Exists(SwitchSettings.SwitchConfig.CustomThemePath) && (System.IO.Path.GetExtension(SwitchSettings.SwitchConfig.CustomThemePath) == ".css"))
+ {
+ cssProvider.LoadFromPath(SwitchSettings.SwitchConfig.CustomThemePath);
+ }
+ else
+ {
+ Logger.PrintWarning(LogClass.Application, $"The \"custom_theme_path\" section in \"Config.json\" contains an invalid path: \"{SwitchSettings.SwitchConfig.CustomThemePath}\"");
+ }
+ }
+ else
+ {
+ cssProvider.LoadFromPath(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Theme.css"));
+ }
+
+ StyleContext.AddProviderForScreen(Gdk.Screen.Default, cssProvider, 800);
+ }
+
+ private void LoadApplication(string path)
+ {
+ if (_gameLoaded)
+ {
+ CreateErrorDialog("A game has already been loaded. Please close the emulator and try again");
+ }
+ else
+ {
+ if (Directory.Exists(path))
+ {
+ string[] romFsFiles = Directory.GetFiles(path, "*.istorage");
+
+ if (romFsFiles.Length == 0)
+ {
+ romFsFiles = Directory.GetFiles(path, "*.romfs");
+ }
+
+ if (romFsFiles.Length > 0)
+ {
+ Logger.PrintInfo(LogClass.Application, "Loading as cart with RomFS.");
+ _device.LoadCart(path, romFsFiles[0]);
+ }
+ else
+ {
+ Logger.PrintInfo(LogClass.Application, "Loading as cart WITHOUT RomFS.");
+ _device.LoadCart(path);
+ }
+ }
+
+ else if (File.Exists(path))
+ {
+ switch (System.IO.Path.GetExtension(path).ToLowerInvariant())
+ {
+ case ".xci":
+ Logger.PrintInfo(LogClass.Application, "Loading as XCI.");
+ _device.LoadXci(path);
+ break;
+ case ".nca":
+ Logger.PrintInfo(LogClass.Application, "Loading as NCA.");
+ _device.LoadNca(path);
+ break;
+ case ".nsp":
+ case ".pfs0":
+ Logger.PrintInfo(LogClass.Application, "Loading as NSP.");
+ _device.LoadNsp(path);
+ break;
+ default:
+ Logger.PrintInfo(LogClass.Application, "Loading as homebrew.");
+ try
+ {
+ _device.LoadProgram(path);
+ }
+ catch (ArgumentOutOfRangeException)
+ {
+ Logger.PrintError(LogClass.Application, $"The file which you have specified is unsupported by Ryujinx");
+ }
+ break;
+ }
+ }
+ else
+ {
+ Logger.PrintWarning(LogClass.Application, "Please specify a valid XCI/NCA/NSP/PFS0/NRO file");
+ End();
+ }
+
+ new Thread(new ThreadStart(CreateGameWindow)).Start();
+
+ _gameLoaded = true;
+ _stopEmulation.Sensitive = true;
+
+ if (DiscordIntegrationEnabled)
+ {
+ if (File.ReadAllLines(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "RPsupported.dat")).Contains(_device.System.TitleID))
+ {
+ DiscordPresence.Assets.LargeImageKey = _device.System.TitleID;
+ }
+
+ string state = _device.System.TitleID;
+
+ if (state == null)
+ {
+ state = "Ryujinx";
+ }
+ else
+ {
+ state = state.ToUpper();
+ }
+
+ string details = "Idling";
+
+ if (_device.System.TitleName != null)
+ {
+ details = $"Playing {_device.System.TitleName}";
+ }
+
+ DiscordPresence.Details = details;
+ DiscordPresence.State = state;
+ DiscordPresence.Assets.LargeImageText = _device.System.TitleName;
+ DiscordPresence.Assets.SmallImageKey = "ryujinx";
+ DiscordPresence.Assets.SmallImageText = "Ryujinx is an emulator for the Nintendo Switch";
+ DiscordPresence.Timestamps = new Timestamps(DateTime.UtcNow);
+
+ DiscordClient.SetPresence(DiscordPresence);
+ }
+
+ try
+ {
+ string savePath = System.IO.Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFS", "nand", "user", "save", "0000000000000000", _userId, _device.System.TitleID);
+
+ if (File.Exists(System.IO.Path.Combine(savePath, "TimePlayed.dat")) == false)
+ {
+ Directory.CreateDirectory(savePath);
+ using (FileStream stream = File.OpenWrite(System.IO.Path.Combine(savePath, "TimePlayed.dat")))
+ {
+ stream.Write(Encoding.ASCII.GetBytes("0"));
+ }
+ }
+
+ if (File.Exists(System.IO.Path.Combine(savePath, "LastPlayed.dat")) == false)
+ {
+ Directory.CreateDirectory(savePath);
+ using (FileStream stream = File.OpenWrite(System.IO.Path.Combine(savePath, "LastPlayed.dat")))
+ {
+ stream.Write(Encoding.ASCII.GetBytes("Never"));
+ }
+ }
+
+ using (FileStream stream = File.OpenWrite(System.IO.Path.Combine(savePath, "LastPlayed.dat")))
+ {
+ using (StreamWriter writer = new StreamWriter(stream))
+ {
+ writer.WriteLine(DateTime.UtcNow);
+ }
+ }
+ }
+ catch (ArgumentNullException)
+ {
+ Logger.PrintWarning(LogClass.Application, $"Could not access save path to retrieve time/last played data using: UserID: {_userId}, TitleID: {_device.System.TitleID}");
+ }
+ }
+ }
+
+ private static void CreateGameWindow()
+ {
+ Configuration.ConfigureHid(_device, SwitchSettings.SwitchConfig);
+
+ using (GlScreen screen = new GlScreen(_device, _renderer))
+ {
+ screen.MainLoop();
+
+ End();
+ }
+ }
+
+ private static void End()
+ {
+ if (_gameLoaded)
+ {
+ try
+ {
+ string savePath = System.IO.Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFS", "nand", "user", "save", "0000000000000000", _userId, _device.System.TitleID);
+ double currentPlayTime = 0;
+
+ using (FileStream stream = File.OpenRead(System.IO.Path.Combine(savePath, "LastPlayed.dat")))
+ {
+ using (StreamReader reader = new StreamReader(stream))
+ {
+ DateTime startTime = DateTime.Parse(reader.ReadLine());
+
+ using (FileStream lastPlayedStream = File.OpenRead(System.IO.Path.Combine(savePath, "TimePlayed.dat")))
+ {
+ using (StreamReader lastPlayedReader = new StreamReader(lastPlayedStream))
+ {
+ currentPlayTime = double.Parse(lastPlayedReader.ReadLine());
+ }
+ }
+
+ using (FileStream timePlayedStream = File.OpenWrite(System.IO.Path.Combine(savePath, "TimePlayed.dat")))
+ {
+ using (StreamWriter timePlayedWriter = new StreamWriter(timePlayedStream))
+ {
+ timePlayedWriter.WriteLine(currentPlayTime + Math.Round(DateTime.UtcNow.Subtract(startTime).TotalSeconds, MidpointRounding.AwayFromZero));
+ }
+ }
+ }
+ }
+ }
+ catch (ArgumentNullException)
+ {
+ Logger.PrintWarning(LogClass.Application, $"Could not access save path to retrieve time/last played data using: UserID: {_userId}, TitleID: {_device.System.TitleID}");
+ }
+ }
+
+ Profile.FinishProfiling();
+ _device.Dispose();
+ _audioOut.Dispose();
+ DiscordClient.Dispose();
+ Logger.Shutdown();
+ Environment.Exit(0);
+ }
+
+ /// <summary>
+ /// Picks an <see cref="IAalOutput"/> audio output renderer supported on this machine
+ /// </summary>
+ /// <returns>An <see cref="IAalOutput"/> supported by this machine</returns>
+ private static IAalOutput InitializeAudioEngine()
+ {
+ if (SoundIoAudioOut.IsSupported)
+ {
+ return new SoundIoAudioOut();
+ }
+ else if (OpenALAudioOut.IsSupported)
+ {
+ return new OpenALAudioOut();
+ }
+ else
+ {
+ return new DummyAudioOut();
+ }
+ }
+
+ //Events
+ private void Row_Activated(object o, RowActivatedArgs args)
+ {
+ _tableStore.GetIter(out TreeIter treeIter, new TreePath(args.Path.ToString()));
+ string path = (string)_tableStore.GetValue(treeIter, 8);
+
+ LoadApplication(path);
+ }
+
+ private void Load_Application_File(object o, EventArgs args)
+ {
+ FileChooserDialog fileChooser = new FileChooserDialog("Choose the file to open", this, FileChooserAction.Open, "Cancel", ResponseType.Cancel, "Open", ResponseType.Accept);
+
+ fileChooser.Filter = new FileFilter();
+ fileChooser.Filter.AddPattern("*.nsp" );
+ fileChooser.Filter.AddPattern("*.pfs0");
+ fileChooser.Filter.AddPattern("*.xci" );
+ fileChooser.Filter.AddPattern("*.nca" );
+ fileChooser.Filter.AddPattern("*.nro" );
+ fileChooser.Filter.AddPattern("*.nso" );
+
+ if (fileChooser.Run() == (int)ResponseType.Accept)
+ {
+ LoadApplication(fileChooser.Filename);
+ }
+
+ fileChooser.Destroy();
+ }
+
+ private void Load_Application_Folder(object o, EventArgs args)
+ {
+ FileChooserDialog fileChooser = new FileChooserDialog("Choose the folder to open", this, FileChooserAction.SelectFolder, "Cancel", ResponseType.Cancel, "Open", ResponseType.Accept);
+
+ if (fileChooser.Run() == (int)ResponseType.Accept)
+ {
+ LoadApplication(fileChooser.Filename);
+ }
+
+ fileChooser.Destroy();
+ }
+
+ private void Open_Ryu_Folder(object o, EventArgs args)
+ {
+ Process.Start(new ProcessStartInfo()
+ {
+ FileName = System.IO.Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFs"),
+ UseShellExecute = true,
+ Verb = "open"
+ });
+ }
+
+ private void Exit_Pressed(object o, EventArgs args)
+ {
+ End();
+ }
+
+ private void Window_Close(object o, DeleteEventArgs args)
+ {
+ End();
+ }
+
+ private void StopEmulation_Pressed(object o, EventArgs args)
+ {
+ // TODO: Write logic to kill running game
+ }
+
+ private void FullScreen_Toggled(object o, EventArgs args)
+ {
+ if (_fullScreen.Active)
+ {
+ Fullscreen();
+ }
+ else
+ {
+ Unfullscreen();
+ }
+ }
+
+ private void Settings_Pressed(object o, EventArgs args)
+ {
+ SwitchSettings SettingsWin = new SwitchSettings(_device);
+
+ _gtkApplication.Register(GLib.Cancellable.Current);
+ _gtkApplication.AddWindow(SettingsWin);
+
+ SettingsWin.Show();
+ }
+
+ private void Update_Pressed(object o, EventArgs args)
+ {
+ string ryuUpdater = System.IO.Path.Combine(Environment.GetFolderPath(Environment.SpecialFolder.ApplicationData), "RyuFS", "RyuUpdater.exe");
+
+ try
+ {
+ Process.Start(new ProcessStartInfo(ryuUpdater, "/U") { UseShellExecute = true });
+ }
+ catch(System.ComponentModel.Win32Exception)
+ {
+ CreateErrorDialog("Update canceled by user or updater was not found");
+ }
+ }
+
+ private void About_Pressed(object o, EventArgs args)
+ {
+ AboutWindow AboutWin = new AboutWindow();
+
+ _gtkApplication.Register(GLib.Cancellable.Current);
+ _gtkApplication.AddWindow(AboutWin);
+
+ AboutWin.Show();
+ }
+
+ private void Icon_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[0] = _iconToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void Title_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[1] = _titleToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void Developer_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[2] = _developerToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void Version_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[3] = _versionToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void TimePlayed_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[4] = _timePlayedToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void LastPlayed_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[5] = _lastPlayedToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void FileExt_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[6] = _fileExtToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void FileSize_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[7] = _fileSizeToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+
+ private void Path_Toggled(object o, EventArgs args)
+ {
+ SwitchSettings.SwitchConfig.GuiColumns[8] = _pathToggle.Active;
+
+ Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ }
+ }
+}
diff --git a/Ryujinx/Ui/MainWindow.glade b/Ryujinx/Ui/MainWindow.glade
new file mode 100644
index 00000000..e12a7b1b
--- /dev/null
+++ b/Ryujinx/Ui/MainWindow.glade
@@ -0,0 +1,347 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!-- Generated with glade 3.22.1 -->
+<interface>
+ <requires lib="gtk+" version="3.20"/>
+ <object class="GtkApplicationWindow" id="_mainWin">
+ <property name="can_focus">False</property>
+ <property name="title" translatable="yes">Ryujinx</property>
+ <property name="window_position">center</property>
+ <property name="default_width">1280</property>
+ <property name="default_height">750</property>
+ <child>
+ <placeholder/>
+ </child>
+ <child>
+ <object class="GtkBox" id="_box">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkMenuBar" id="MenuBar">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkMenuItem" id="FileMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">File</property>
+ <property name="use_underline">True</property>
+ <child type="submenu">
+ <object class="GtkMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkMenuItem" id="LoadApplicationFile">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Open a file chooser to chose a switch compatible file to load</property>
+ <property name="label" translatable="yes">Load Application from File</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Load_Application_File" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="LoadApplicationFolder">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Open a file chooser to chose a switch compatible, unpacked application to load</property>
+ <property name="label" translatable="yes">Load Unpacked Game</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Load_Application_Folder" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkSeparatorMenuItem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="OpenRyuFolder">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Open Ryujinx filesystem folder</property>
+ <property name="label" translatable="yes">Open Ryujinx Folder</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Open_Ryu_Folder" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkSeparatorMenuItem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="Exit">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Exit Ryujinx</property>
+ <property name="label" translatable="yes">Exit</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Exit_Pressed" swapped="no"/>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="OptionsMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Options</property>
+ <property name="use_underline">True</property>
+ <child type="submenu">
+ <object class="GtkMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkCheckMenuItem" id="_fullScreen">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Fullscreens the window</property>
+ <property name="label" translatable="yes">Fullscreen</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="FullScreen_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="_stopEmulation">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Stop emualtion of the current game and return to game selection</property>
+ <property name="label" translatable="yes">Stop Emulation</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="StopEmulation_Pressed" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkSeparatorMenuItem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="GUIColumns">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Select which GUI columns to enable (restart Ryujinx for these changes to take effect)</property>
+ <property name="label" translatable="yes">Enable GUI Columns</property>
+ <property name="use_underline">True</property>
+ <child type="submenu">
+ <object class="GtkMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkCheckMenuItem" id="_iconToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Icon Column in the game list</property>
+ <property name="label" translatable="yes">Enable Icon Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="Icon_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_titleToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Title Name/ID Column in the game list</property>
+ <property name="label" translatable="yes">Enable Title Name/ID Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="Title_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_developerToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Developer Column in the game list</property>
+ <property name="label" translatable="yes">Enable Developer Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="Developer_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_versionToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Version Column in the game list</property>
+ <property name="label" translatable="yes">Enable Version Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="Version_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_timePlayedToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Time Played Column in the game list</property>
+ <property name="label" translatable="yes">Enable Time Played Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="TimePlayed_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_lastPlayedToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Last Played Column in the game list</property>
+ <property name="label" translatable="yes">Enable Last Played Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="LastPlayed_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_fileExtToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable file extension column in the game list</property>
+ <property name="label" translatable="yes">Enable File Ext Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="FileExt_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_fileSizeToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable File Size Column in the game list</property>
+ <property name="label" translatable="yes">Enable File Size Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="FileSize_Toggled" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkCheckMenuItem" id="_pathToggle">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or Disable Path Column in the game list</property>
+ <property name="label" translatable="yes">Enable Path Column</property>
+ <property name="use_underline">True</property>
+ <signal name="toggled" handler="Path_Toggled" swapped="no"/>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ <child>
+ <object class="GtkSeparatorMenuItem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="SettingsMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Open settings window</property>
+ <property name="label" translatable="yes">Settings</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Settings_Pressed" swapped="no"/>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="ToolsMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Tools</property>
+ <property name="use_underline">True</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="HelpMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Help</property>
+ <property name="use_underline">True</property>
+ <child type="submenu">
+ <object class="GtkMenu">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkMenuItem" id="CheckUpdates">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Check for updates to Ryujinx (requires Ryujinx Installer)</property>
+ <property name="label" translatable="yes">Check for Updates</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="Update_Pressed" swapped="no"/>
+ </object>
+ </child>
+ <child>
+ <object class="GtkSeparatorMenuItem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ </child>
+ <child>
+ <object class="GtkMenuItem" id="About">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Open about window</property>
+ <property name="label" translatable="yes">About</property>
+ <property name="use_underline">True</property>
+ <signal name="activate" handler="About_Pressed" swapped="no"/>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkScrolledWindow" id="_gameTableWindow">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="shadow_type">in</property>
+ <child>
+ <object class="GtkTreeView" id="_gameTable">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="headers_clickable">False</property>
+ <property name="reorderable">True</property>
+ <property name="hover_selection">True</property>
+ <signal name="row-activated" handler="Row_Activated" swapped="no"/>
+ <child internal-child="selection">
+ <object class="GtkTreeSelection"/>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkGLArea" id="_glScreen">
+ <property name="width_request">1280</property>
+ <property name="height_request">720</property>
+ <property name="visible">True</property>
+ <property name="app_paintable">True</property>
+ <property name="can_focus">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+</interface>
diff --git a/Ryujinx/Ui/NpadKeyboard.cs b/Ryujinx/Ui/NpadKeyboard.cs
index 79d6330c..ac739c08 100644
--- a/Ryujinx/Ui/NpadKeyboard.cs
+++ b/Ryujinx/Ui/NpadKeyboard.cs
@@ -45,12 +45,12 @@ namespace Ryujinx.UI.Input
/// <summary>
/// Left JoyCon Keyboard Bindings
/// </summary>
- public NpadKeyboardLeft LeftJoycon { get; private set; }
+ public NpadKeyboardLeft LeftJoycon { get; set; }
/// <summary>
/// Right JoyCon Keyboard Bindings
/// </summary>
- public NpadKeyboardRight RightJoycon { get; private set; }
+ public NpadKeyboardRight RightJoycon { get; set; }
/// <summary>
/// Hotkey Keyboard Bindings
diff --git a/Ryujinx/Ui/SwitchSettings.cs b/Ryujinx/Ui/SwitchSettings.cs
new file mode 100644
index 00000000..8f42fcbf
--- /dev/null
+++ b/Ryujinx/Ui/SwitchSettings.cs
@@ -0,0 +1,424 @@
+using Gtk;
+using GUI = Gtk.Builder.ObjectAttribute;
+using Ryujinx.HLE.HOS.SystemState;
+using Ryujinx.HLE.Input;
+using Ryujinx.UI.Input;
+using System;
+using System.Collections.Generic;
+using System.IO;
+using System.Linq;
+using System.Reflection;
+
+namespace Ryujinx.UI
+{
+ public class SwitchSettings : Window
+ {
+ internal static Configuration SwitchConfig { get; set; }
+
+ internal HLE.Switch Device { get; set; }
+
+ private static ListStore _gameDirsBoxStore;
+
+ private static bool _listeningForKeypress;
+
+#pragma warning disable 649
+ [GUI] Window _settingsWin;
+ [GUI] CheckButton _errorLogToggle;
+ [GUI] CheckButton _warningLogToggle;
+ [GUI] CheckButton _infoLogToggle;
+ [GUI] CheckButton _stubLogToggle;
+ [GUI] CheckButton _debugLogToggle;
+ [GUI] CheckButton _fileLogToggle;
+ [GUI] CheckButton _guestLogToggle;
+ [GUI] CheckButton _fsAccessLogToggle;
+ [GUI] Adjustment _fsLogSpinAdjustment;
+ [GUI] CheckButton _dockedModeToggle;
+ [GUI] CheckButton _discordToggle;
+ [GUI] CheckButton _vSyncToggle;
+ [GUI] CheckButton _multiSchedToggle;
+ [GUI] CheckButton _fsicToggle;
+ [GUI] CheckButton _legacyJitToggle;
+ [GUI] CheckButton _ignoreToggle;
+ [GUI] CheckButton _directKeyboardAccess;
+ [GUI] ComboBoxText _systemLanguageSelect;
+ [GUI] CheckButton _custThemeToggle;
+ [GUI] Entry _custThemePath;
+ [GUI] ToggleButton _browseThemePath;
+ [GUI] Label _custThemePathLabel;
+ [GUI] TreeView _gameDirsBox;
+ [GUI] Entry _addGameDirBox;
+ [GUI] ToggleButton _addDir;
+ [GUI] ToggleButton _browseDir;
+ [GUI] ToggleButton _removeDir;
+ [GUI] Entry _logPath;
+ [GUI] Entry _graphicsShadersDumpPath;
+ [GUI] Image _controllerImage;
+
+ [GUI] ComboBoxText _controller1Type;
+ [GUI] ToggleButton _lStickUp1;
+ [GUI] ToggleButton _lStickDown1;
+ [GUI] ToggleButton _lStickLeft1;
+ [GUI] ToggleButton _lStickRight1;
+ [GUI] ToggleButton _lStickButton1;
+ [GUI] ToggleButton _dpadUp1;
+ [GUI] ToggleButton _dpadDown1;
+ [GUI] ToggleButton _dpadLeft1;
+ [GUI] ToggleButton _dpadRight1;
+ [GUI] ToggleButton _minus1;
+ [GUI] ToggleButton _l1;
+ [GUI] ToggleButton _zL1;
+ [GUI] ToggleButton _rStickUp1;
+ [GUI] ToggleButton _rStickDown1;
+ [GUI] ToggleButton _rStickLeft1;
+ [GUI] ToggleButton _rStickRight1;
+ [GUI] ToggleButton _rStickButton1;
+ [GUI] ToggleButton _a1;
+ [GUI] ToggleButton _b1;
+ [GUI] ToggleButton _x1;
+ [GUI] ToggleButton _y1;
+ [GUI] ToggleButton _plus1;
+ [GUI] ToggleButton _r1;
+ [GUI] ToggleButton _zR1;
+#pragma warning restore 649
+
+ public static void ConfigureSettings(Configuration Instance) { SwitchConfig = Instance; }
+
+ public SwitchSettings(HLE.Switch device) : this(new Builder("Ryujinx.Ui.SwitchSettings.glade"), device) { }
+
+ private SwitchSettings(Builder builder, HLE.Switch device) : base(builder.GetObject("_settingsWin").Handle)
+ {
+ Device = device;
+
+ builder.Autoconnect(this);
+
+ _settingsWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.RyujinxIcon.png");
+ _controllerImage.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.JoyCon.png", 500, 500);
+
+ //Bind Events
+ _lStickUp1.Clicked += (o, args) => Button_Pressed(o, args, _lStickUp1);
+ _lStickDown1.Clicked += (o, args) => Button_Pressed(o, args, _lStickDown1);
+ _lStickLeft1.Clicked += (o, args) => Button_Pressed(o, args, _lStickLeft1);
+ _lStickRight1.Clicked += (o, args) => Button_Pressed(o, args, _lStickRight1);
+ _lStickButton1.Clicked += (o, args) => Button_Pressed(o, args, _lStickButton1);
+ _dpadUp1.Clicked += (o, args) => Button_Pressed(o, args, _dpadUp1);
+ _dpadDown1.Clicked += (o, args) => Button_Pressed(o, args, _dpadDown1);
+ _dpadLeft1.Clicked += (o, args) => Button_Pressed(o, args, _dpadLeft1);
+ _dpadRight1.Clicked += (o, args) => Button_Pressed(o, args, _dpadRight1);
+ _minus1.Clicked += (o, args) => Button_Pressed(o, args, _minus1);
+ _l1.Clicked += (o, args) => Button_Pressed(o, args, _l1);
+ _zL1.Clicked += (o, args) => Button_Pressed(o, args, _zL1);
+ _rStickUp1.Clicked += (o, args) => Button_Pressed(o, args, _rStickUp1);
+ _rStickDown1.Clicked += (o, args) => Button_Pressed(o, args, _rStickDown1);
+ _rStickLeft1.Clicked += (o, args) => Button_Pressed(o, args, _rStickLeft1);
+ _rStickRight1.Clicked += (o, args) => Button_Pressed(o, args, _rStickRight1);
+ _rStickButton1.Clicked += (o, args) => Button_Pressed(o, args, _rStickButton1);
+ _a1.Clicked += (o, args) => Button_Pressed(o, args, _a1);
+ _b1.Clicked += (o, args) => Button_Pressed(o, args, _b1);
+ _x1.Clicked += (o, args) => Button_Pressed(o, args, _x1);
+ _y1.Clicked += (o, args) => Button_Pressed(o, args, _y1);
+ _plus1.Clicked += (o, args) => Button_Pressed(o, args, _plus1);
+ _r1.Clicked += (o, args) => Button_Pressed(o, args, _r1);
+ _zR1.Clicked += (o, args) => Button_Pressed(o, args, _zR1);
+
+ //Setup Currents
+ if (SwitchConfig.EnableFileLog) { _fileLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableError) { _errorLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableWarn) { _warningLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableInfo) { _infoLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableStub) { _stubLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableDebug) { _debugLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableGuest) { _guestLogToggle.Click(); }
+ if (SwitchConfig.LoggingEnableFsAccessLog) { _fsAccessLogToggle.Click(); }
+ if (SwitchConfig.DockedMode) { _dockedModeToggle.Click(); }
+ if (SwitchConfig.EnableDiscordIntegration) { _discordToggle.Click(); }
+ if (SwitchConfig.EnableVsync) { _vSyncToggle.Click(); }
+ if (SwitchConfig.EnableMulticoreScheduling) { _multiSchedToggle.Click(); }
+ if (SwitchConfig.EnableFsIntegrityChecks) { _fsicToggle.Click(); }
+ if (SwitchConfig.EnableLegacyJit) { _legacyJitToggle.Click(); }
+ if (SwitchConfig.IgnoreMissingServices) { _ignoreToggle.Click(); }
+ if (SwitchConfig.EnableKeyboard) { _directKeyboardAccess.Click(); }
+ if (SwitchConfig.EnableCustomTheme) { _custThemeToggle.Click(); }
+
+ _systemLanguageSelect.SetActiveId(SwitchConfig.SystemLanguage.ToString());
+ _controller1Type .SetActiveId(SwitchConfig.ControllerType.ToString());
+
+ _lStickUp1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickUp.ToString();
+ _lStickDown1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickDown.ToString();
+ _lStickLeft1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickLeft.ToString();
+ _lStickRight1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickRight.ToString();
+ _lStickButton1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickButton.ToString();
+ _dpadUp1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadUp.ToString();
+ _dpadDown1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadDown.ToString();
+ _dpadLeft1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadLeft.ToString();
+ _dpadRight1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadRight.ToString();
+ _minus1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonMinus.ToString();
+ _l1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonL.ToString();
+ _zL1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonZl.ToString();
+ _rStickUp1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickUp.ToString();
+ _rStickDown1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickDown.ToString();
+ _rStickLeft1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickLeft.ToString();
+ _rStickRight1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickRight.ToString();
+ _rStickButton1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickButton.ToString();
+ _a1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonA.ToString();
+ _b1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonB.ToString();
+ _x1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonX.ToString();
+ _y1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonY.ToString();
+ _plus1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonPlus.ToString();
+ _r1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonR.ToString();
+ _zR1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonZr.ToString();
+
+ _custThemePath.Buffer.Text = SwitchConfig.CustomThemePath;
+ _graphicsShadersDumpPath.Buffer.Text = SwitchConfig.GraphicsShadersDumpPath;
+ _fsLogSpinAdjustment.Value = SwitchConfig.FsGlobalAccessLogMode;
+
+ _gameDirsBox.AppendColumn("", new CellRendererText(), "text", 0);
+ _gameDirsBoxStore = new ListStore(typeof(string));
+ _gameDirsBox.Model = _gameDirsBoxStore;
+ foreach (string gameDir in SwitchConfig.GameDirs)
+ {
+ _gameDirsBoxStore.AppendValues(gameDir);
+ }
+
+ if (_custThemeToggle.Active == false)
+ {
+ _custThemePath.Sensitive = false;
+ _custThemePathLabel.Sensitive = false;
+ _browseThemePath.Sensitive = false;
+ }
+
+ _logPath.Buffer.Text = System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Ryujinx.log");
+
+ _listeningForKeypress = false;
+ }
+
+ //Events
+ private void Button_Pressed(object obj, EventArgs args, ToggleButton Button)
+ {
+ if (_listeningForKeypress == false)
+ {
+ KeyPressEvent += On_KeyPress;
+
+ _listeningForKeypress = true;
+
+ void On_KeyPress(object Obj, KeyPressEventArgs KeyPressed)
+ {
+ string key = KeyPressed.Event.Key.ToString();
+ string capKey = key.First().ToString().ToUpper() + key.Substring(1);
+
+ if (Enum.IsDefined(typeof(OpenTK.Input.Key), capKey))
+ {
+ Button.Label = capKey;
+ }
+ else if (GdkToOpenTKInput.ContainsKey(key))
+ {
+ Button.Label = GdkToOpenTKInput[key];
+ }
+ else
+ {
+ Button.Label = "Space";
+ }
+
+ Button.SetStateFlags(0, true);
+
+ KeyPressEvent -= On_KeyPress;
+
+ _listeningForKeypress = false;
+ }
+ }
+ else
+ {
+ Button.SetStateFlags(0, true);
+ }
+ }
+
+ private void AddDir_Pressed(object obj, EventArgs args)
+ {
+ if (Directory.Exists(_addGameDirBox.Buffer.Text))
+ {
+ _gameDirsBoxStore.AppendValues(_addGameDirBox.Buffer.Text);
+ }
+
+ _addDir.SetStateFlags(0, true);
+ }
+
+ private void BrowseDir_Pressed(object obj, EventArgs args)
+ {
+ FileChooserDialog fileChooser = new FileChooserDialog("Choose the game directory to add to the list", this, FileChooserAction.SelectFolder, "Cancel", ResponseType.Cancel, "Add", ResponseType.Accept);
+
+ if (fileChooser.Run() == (int)ResponseType.Accept)
+ {
+ _gameDirsBoxStore.AppendValues(fileChooser.Filename);
+ }
+
+ fileChooser.Destroy();
+
+ _browseDir.SetStateFlags(0, true);
+ }
+
+ private void RemoveDir_Pressed(object obj, EventArgs args)
+ {
+ TreeSelection selection = _gameDirsBox.Selection;
+
+ selection.GetSelected(out TreeIter treeIter);
+ _gameDirsBoxStore.Remove(ref treeIter);
+
+ _removeDir.SetStateFlags(0, true);
+ }
+
+ private void CustThemeToggle_Activated(object obj, EventArgs args)
+ {
+ _custThemePath.Sensitive = _custThemeToggle.Active;
+ _custThemePathLabel.Sensitive = _custThemeToggle.Active;
+ _browseThemePath.Sensitive = _custThemeToggle.Active;
+ }
+
+ private void BrowseThemeDir_Pressed(object obj, EventArgs args)
+ {
+ FileChooserDialog fileChooser = new FileChooserDialog("Choose the theme to load", this, FileChooserAction.Open, "Cancel", ResponseType.Cancel, "Select", ResponseType.Accept);
+
+ fileChooser.Filter = new FileFilter();
+ fileChooser.Filter.AddPattern("*.css");
+
+ if (fileChooser.Run() == (int)ResponseType.Accept)
+ {
+ _custThemePath.Buffer.Text = fileChooser.Filename;
+ }
+
+ fileChooser.Destroy();
+
+ _browseThemePath.SetStateFlags(0, true);
+ }
+
+ private void SaveToggle_Activated(object obj, EventArgs args)
+ {
+ List<string> gameDirs = new List<string>();
+
+ _gameDirsBoxStore.GetIterFirst(out TreeIter treeIter);
+ for (int i = 0; i < _gameDirsBoxStore.IterNChildren(); i++)
+ {
+ _gameDirsBoxStore.GetValue(treeIter, i);
+
+ gameDirs.Add((string)_gameDirsBoxStore.GetValue(treeIter, 0));
+
+ _gameDirsBoxStore.IterNext(ref treeIter);
+ }
+
+ SwitchConfig.LoggingEnableError = _errorLogToggle.Active;
+ SwitchConfig.LoggingEnableWarn = _warningLogToggle.Active;
+ SwitchConfig.LoggingEnableInfo = _infoLogToggle.Active;
+ SwitchConfig.LoggingEnableStub = _stubLogToggle.Active;
+ SwitchConfig.LoggingEnableDebug = _debugLogToggle.Active;
+ SwitchConfig.LoggingEnableGuest = _guestLogToggle.Active;
+ SwitchConfig.LoggingEnableFsAccessLog = _fsAccessLogToggle.Active;
+ SwitchConfig.EnableFileLog = _fileLogToggle.Active;
+ SwitchConfig.DockedMode = _dockedModeToggle.Active;
+ SwitchConfig.EnableDiscordIntegration = _discordToggle.Active;
+ SwitchConfig.EnableVsync = _vSyncToggle.Active;
+ SwitchConfig.EnableMulticoreScheduling = _multiSchedToggle.Active;
+ SwitchConfig.EnableFsIntegrityChecks = _fsicToggle.Active;
+ SwitchConfig.EnableLegacyJit = _legacyJitToggle.Active;
+ SwitchConfig.IgnoreMissingServices = _ignoreToggle.Active;
+ SwitchConfig.EnableKeyboard = _directKeyboardAccess.Active;
+ SwitchConfig.EnableCustomTheme = _custThemeToggle.Active;
+
+ SwitchConfig.KeyboardControls.LeftJoycon = new NpadKeyboardLeft()
+ {
+ StickUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickUp1.Label),
+ StickDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickDown1.Label),
+ StickLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickLeft1.Label),
+ StickRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickRight1.Label),
+ StickButton = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickButton1.Label),
+ DPadUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadUp1.Label),
+ DPadDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadDown1.Label),
+ DPadLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadLeft1.Label),
+ DPadRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadRight1.Label),
+ ButtonMinus = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _minus1.Label),
+ ButtonL = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _l1.Label),
+ ButtonZl = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _zL1.Label),
+ };
+
+ SwitchConfig.KeyboardControls.RightJoycon = new NpadKeyboardRight()
+ {
+ StickUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickUp1.Label),
+ StickDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickDown1.Label),
+ StickLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickLeft1.Label),
+ StickRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickRight1.Label),
+ StickButton = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickButton1.Label),
+ ButtonA = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _a1.Label),
+ ButtonB = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _b1.Label),
+ ButtonX = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _x1.Label),
+ ButtonY = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _y1.Label),
+ ButtonPlus = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _plus1.Label),
+ ButtonR = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _r1.Label),
+ ButtonZr = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _zR1.Label),
+ };
+
+ SwitchConfig.SystemLanguage = (SystemLanguage)Enum.Parse(typeof(SystemLanguage), _systemLanguageSelect.ActiveId);
+ SwitchConfig.ControllerType = (ControllerStatus)Enum.Parse(typeof(ControllerStatus), _controller1Type.ActiveId);
+ SwitchConfig.CustomThemePath = _custThemePath.Buffer.Text;
+ SwitchConfig.GraphicsShadersDumpPath = _graphicsShadersDumpPath.Buffer.Text;
+ SwitchConfig.GameDirs = gameDirs;
+ SwitchConfig.FsGlobalAccessLogMode = (int)_fsLogSpinAdjustment.Value;
+
+ Configuration.SaveConfig(SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
+ Configuration.Configure(Device, SwitchConfig);
+
+ MainWindow.ApplyTheme();
+ MainWindow.UpdateGameTable();
+
+ Destroy();
+ }
+
+ private void CloseToggle_Activated(object obj, EventArgs args)
+ {
+ Destroy();
+ }
+
+ public readonly Dictionary<string, string> GdkToOpenTKInput = new Dictionary<string, string>()
+ {
+ { "Key_0", "Number0" },
+ { "Key_1", "Number1" },
+ { "Key_2", "Number2" },
+ { "Key_3", "Number3" },
+ { "Key_4", "Number4" },
+ { "Key_5", "Number5" },
+ { "Key_6", "Number6" },
+ { "Key_7", "Number7" },
+ { "Key_8", "Number8" },
+ { "Key_9", "Number9" },
+ { "equal", "Plus" },
+ { "uparrow", "Up" },
+ { "downarrow", "Down" },
+ { "leftarrow", "Left" },
+ { "rightarrow", "Right" },
+ { "Control_L", "ControlLeft" },
+ { "Control_R", "ControlRight" },
+ { "Shift_L", "ShiftLeft" },
+ { "Shift_R", "ShiftRight" },
+ { "Alt_L", "AltLeft" },
+ { "Alt_R", "AltRight" },
+ { "Page_Up", "PageUp" },
+ { "Page_Down", "PageDown" },
+ { "KP_Enter", "KeypadEnter" },
+ { "KP_Up", "Up" },
+ { "KP_Down", "Down" },
+ { "KP_Left", "Left" },
+ { "KP_Right", "Right" },
+ { "KP_Divide", "KeypadDivide" },
+ { "KP_Multiply", "KeypadMultiply" },
+ { "KP_Subtract", "KeypadSubtract" },
+ { "KP_Add", "KeypadAdd" },
+ { "KP_Decimal", "KeypadDecimal" },
+ { "KP_0", "Keypad0" },
+ { "KP_1", "Keypad1" },
+ { "KP_2", "Keypad2" },
+ { "KP_3", "Keypad3" },
+ { "KP_4", "Keypad4" },
+ { "KP_5", "Keypad5" },
+ { "KP_6", "Keypad6" },
+ { "KP_7", "Keypad7" },
+ { "KP_8", "Keypad8" },
+ { "KP_9", "Keypad9" },
+ };
+ }
+}
diff --git a/Ryujinx/Ui/SwitchSettings.glade b/Ryujinx/Ui/SwitchSettings.glade
new file mode 100644
index 00000000..30a689a8
--- /dev/null
+++ b/Ryujinx/Ui/SwitchSettings.glade
@@ -0,0 +1,1989 @@
+<?xml version="1.0" encoding="UTF-8"?>
+<!-- Generated with glade 3.22.1 -->
+<interface>
+ <requires lib="gtk+" version="3.20"/>
+ <object class="GtkAdjustment" id="_fsLogSpinAdjustment">
+ <property name="upper">3</property>
+ <property name="step_increment">1</property>
+ <property name="page_increment">10</property>
+ </object>
+ <object class="GtkDialog" id="_settingsWin">
+ <property name="can_focus">False</property>
+ <property name="title" translatable="yes">Ryujinx - Settings</property>
+ <property name="modal">True</property>
+ <property name="window_position">center</property>
+ <property name="default_width">910</property>
+ <property name="default_height">790</property>
+ <property name="type_hint">dialog</property>
+ <child>
+ <placeholder/>
+ </child>
+ <child internal-child="vbox">
+ <object class="GtkBox">
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <property name="spacing">2</property>
+ <child internal-child="action_area">
+ <object class="GtkButtonBox">
+ <property name="can_focus">False</property>
+ <property name="margin_right">5</property>
+ <property name="margin_top">3</property>
+ <property name="margin_bottom">3</property>
+ <property name="layout_style">end</property>
+ <child>
+ <object class="GtkToggleButton" id="SaveToggle">
+ <property name="label" translatable="yes">Save</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <signal name="toggled" handler="SaveToggle_Activated" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="CloseToggle">
+ <property name="label" translatable="yes">Close</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <signal name="toggled" handler="CloseToggle_Activated" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkScrolledWindow">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="shadow_type">in</property>
+ <child>
+ <object class="GtkViewport">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkNotebook">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <child>
+ <object class="GtkBox" id="TabGeneral">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">10</property>
+ <property name="margin_top">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox" id="CatGeneral">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">General</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="box1">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Change System Language</property>
+ <property name="halign">end</property>
+ <property name="label" translatable="yes">System Language:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkComboBoxText" id="_systemLanguageSelect">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Change System Language</property>
+ <items>
+ <item id="AmericanEnglish" translatable="yes">American English</item>
+ <item id="BritishEnglish" translatable="yes">British English</item>
+ <item id="CanadianFrench" translatable="yes">Canadian French</item>
+ <item id="Chinese" translatable="yes">Chinese</item>
+ <item id="Dutch" translatable="yes">Dutch</item>
+ <item id="French" translatable="yes">French</item>
+ <item id="German" translatable="yes">German</item>
+ <item id="Italian" translatable="yes">Italian</item>
+ <item id="Japanese" translatable="yes">Japanese</item>
+ <item id="Korean" translatable="yes">Korean</item>
+ <item id="LatinAmericanSpanish" translatable="yes">Latin American Spanish</item>
+ <item id="Portuguese" translatable="yes">Portuguese</item>
+ <item id="Russian" translatable="yes">Russian</item>
+ <item id="SimplifiedChinese" translatable="yes">Simplified Chinese</item>
+ <item id="Spanish" translatable="yes">Spanish</item>
+ <item id="Taiwanese" translatable="yes">Taiwanese</item>
+ <item id="TraditionalChinese" translatable="yes">Traditional Chinese</item>
+ </items>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_discordToggle">
+ <property name="label" translatable="yes">Enable Discord Integration</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables or disables Discord Rich Presense</property>
+ <property name="halign">start</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSeparator">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="CatGameDir">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Game Directories</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkScrolledWindow">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="margin_bottom">10</property>
+ <property name="shadow_type">in</property>
+ <child>
+ <object class="GtkTreeView" id="_gameDirsBox">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="headers_visible">False</property>
+ <property name="headers_clickable">False</property>
+ <child internal-child="selection">
+ <object class="GtkTreeSelection"/>
+ </child>
+ </object>
+ </child>
+ <style>
+ <class name="GameDir"/>
+ </style>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkEntry" id="_addGameDirBox">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="tooltip_text" translatable="yes">Enter a game directroy to add to the list</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_addDir">
+ <property name="label" translatable="yes">Add</property>
+ <property name="width_request">80</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <property name="tooltip_text" translatable="yes"> Add a game directory to the list</property>
+ <property name="margin_left">5</property>
+ <signal name="toggled" handler="AddDir_Pressed" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_browseDir">
+ <property name="label" translatable="yes">Browse...</property>
+ <property name="width_request">80</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <property name="tooltip_text" translatable="yes">Browse for a game directory</property>
+ <property name="margin_left">5</property>
+ <signal name="toggled" handler="BrowseDir_Pressed" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_removeDir">
+ <property name="label" translatable="yes">Remove</property>
+ <property name="width_request">80</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <property name="tooltip_text" translatable="yes">Remove selected game directory</property>
+ <property name="margin_left">5</property>
+ <signal name="toggled" handler="RemoveDir_Pressed" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSeparator">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="CatThemes">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Themes</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkCheckButton" id="_custThemeToggle">
+ <property name="label" translatable="yes">Use Custom Theme</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or disable custom themes in the GUI</property>
+ <property name="halign">start</property>
+ <property name="draw_indicator">True</property>
+ <signal name="toggled" handler="CustThemeToggle_Activated" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel" id="_custThemePathLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Path to custom GUI theme</property>
+ <property name="label" translatable="yes">Custom Theme Path:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEntry" id="_custThemePath">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="tooltip_text" translatable="yes">Path to custom GUI theme</property>
+ <property name="valign">center</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_browseThemePath">
+ <property name="label" translatable="yes">Browse...</property>
+ <property name="width_request">80</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ <property name="tooltip_text" translatable="yes">Browse for a custom GUI theme</property>
+ <property name="margin_left">5</property>
+ <signal name="toggled" handler="BrowseThemeDir_Pressed" swapped="no"/>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">10</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">6</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">General</property>
+ </object>
+ <packing>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="TabController">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">10</property>
+ <child>
+ <object class="GtkCheckButton" id="_dockedModeToggle">
+ <property name="label" translatable="yes">Enable Docked Mode</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or disable Docked Mode</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">10</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_directKeyboardAccess">
+ <property name="label" translatable="yes">Direct Keyboard Access</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or disable "direct keyboard access (HID) support" (Provides games access to your keyboard as a text entry device)</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">False</property>
+ <property name="padding">10</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkNotebook">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">The primary controller's type</property>
+ <property name="halign">center</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Controller Type:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkComboBoxText" id="_controller1Type">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">The primary controller's type</property>
+ <property name="margin_left">5</property>
+ <property name="active">0</property>
+ <items>
+ <item id="Handheld" translatable="yes">Handheld</item>
+ <item id="ProController" translatable="yes">Pro Controller</item>
+ <item id="NpadPair" translatable="yes">Paired Joycons</item>
+ <item id="NpadLeft" translatable="yes">Left Joycon</item>
+ <item id="NpadRight" translatable="yes">Right Joycon</item>
+ </items>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="padding">10</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkGrid">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="row_spacing">2</property>
+ <property name="column_spacing">5</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">LStick Up</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">LStick Down</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">LStick Left</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">LStick Right</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">LStick Button</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Dpad Up</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Dpad Down</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">6</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Dpad Left</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">7</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Dpad Right</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">8</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">-</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">9</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">L</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">10</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">ZL</property>
+ </object>
+ <packing>
+ <property name="left_attach">0</property>
+ <property name="top_attach">11</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">ZR</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">11</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">R</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">10</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">+</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">9</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Y</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">8</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">X</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">7</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">B</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">6</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">A</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">RStick Button</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">RStick Right</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">RStick Left</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">RStick Down</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">RStick Up</property>
+ </object>
+ <packing>
+ <property name="left_attach">2</property>
+ <property name="top_attach">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_lStickUp1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_lStickDown1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_lStickLeft1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_lStickRight1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_lStickButton1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_dpadUp1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_dpadDown1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">6</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_dpadLeft1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">7</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_dpadRight1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">8</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_minus1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">9</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_l1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">10</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_zL1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">1</property>
+ <property name="top_attach">11</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_rStickUp1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_rStickDown1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_rStickLeft1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_rStickRight1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_rStickButton1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_a1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_b1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">6</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_x1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">7</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_y1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">8</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_plus1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">9</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_r1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">10</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkToggleButton" id="_zR1">
+ <property name="label" translatable="yes"> </property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">True</property>
+ </object>
+ <packing>
+ <property name="left_attach">3</property>
+ <property name="top_attach">11</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">10</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkImage" id="_controllerImage">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller1">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 1</property>
+ </object>
+ <packing>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">1</property>
+ <property name="tab_expand">True</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller2">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 2</property>
+ </object>
+ <packing>
+ <property name="position">1</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller3">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 3</property>
+ </object>
+ <packing>
+ <property name="position">2</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller4">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 4</property>
+ </object>
+ <packing>
+ <property name="position">3</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">4</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller5">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 5</property>
+ </object>
+ <packing>
+ <property name="position">4</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">5</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller6">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 6</property>
+ </object>
+ <packing>
+ <property name="position">5</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">6</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller7">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 7</property>
+ </object>
+ <packing>
+ <property name="position">6</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Multiple controllers are not yet supported</property>
+ </object>
+ <packing>
+ <property name="position">7</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel" id="Controller8">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Controller 8</property>
+ </object>
+ <packing>
+ <property name="position">7</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="label" translatable="yes">Input</property>
+ </object>
+ <packing>
+ <property name="position">1</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="TabSystem">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">10</property>
+ <property name="margin_top">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox" id="CatCore">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="valign">start</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_left">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Core</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkCheckButton" id="_vSyncToggle">
+ <property name="label" translatable="yes">Enable VSync</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables or disables Vertical Sync</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_multiSchedToggle">
+ <property name="label" translatable="yes">Enable Multicore Scheduling</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables or disables multi-core scheduling of threads</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_legacyJitToggle">
+ <property name="label" translatable="yes">Use old ChocolArm64 ARM emulator</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Uses old ChocolArm64 ARM emulator rather then the new ARMeilleure</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_fsicToggle">
+ <property name="label" translatable="yes">Enable FS Integrity Checks</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables integrity checks on Game content files</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Graphics Shaders Dump Path</property>
+ <property name="label" translatable="yes">Graphics Shaders Dump Path:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEntry" id="_graphicsShadersDumpPath">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="tooltip_text" translatable="yes">Graphics Shaders Dump Path</property>
+ <property name="valign">center</property>
+ <property name="caps_lock_warning">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">4</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSeparator">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="CatLog">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Logging</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkCheckButton" id="_fileLogToggle">
+ <property name="label" translatable="yes">Enable Logging to File</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables or disables logging to a file on disk</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_bottom">10</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Location of the log file</property>
+ <property name="label" translatable="yes">Log File Location:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkEntry" id="_logPath">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="tooltip_text" translatable="yes">Location of the log file</property>
+ <property name="valign">center</property>
+ <property name="editable">False</property>
+ <property name="caps_lock_warning">False</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_debugLogToggle">
+ <property name="label" translatable="yes">Enable Debug Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing debug log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_stubLogToggle">
+ <property name="label" translatable="yes">Enable Stub Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing stub log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_infoLogToggle">
+ <property name="label" translatable="yes">Enable Info Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing info log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">4</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_warningLogToggle">
+ <property name="label" translatable="yes">Enable Warning Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing warning log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">5</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_errorLogToggle">
+ <property name="label" translatable="yes">Enable Error Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing error log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">6</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_guestLogToggle">
+ <property name="label" translatable="yes">Enable Guest Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing guest log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">7</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkCheckButton" id="_fsAccessLogToggle">
+ <property name="label" translatable="yes">Enable Fs Access Logs</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enables printing fs access log messages</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">8</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="tooltip_text" translatable="yes">Enables FS access log output to the console. Possible modes are 0-3</property>
+ <property name="label" translatable="yes">Fs Global Access Log Mode:</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSpinButton">
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="tooltip_text" translatable="yes">Enables FS access log output to the console. Possible modes are 0-3</property>
+ <property name="adjustment">_fsLogSpinAdjustment</property>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">9</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkSeparator">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">3</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox" id="CatHacks">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">5</property>
+ <property name="margin_right">5</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes">Hacks</property>
+ <attributes>
+ <attribute name="weight" value="bold"/>
+ </attributes>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">start</property>
+ <property name="margin_bottom">5</property>
+ <property name="label" translatable="yes"> - These may cause instability</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ <child>
+ <object class="GtkBox">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="margin_left">10</property>
+ <property name="margin_right">10</property>
+ <property name="orientation">vertical</property>
+ <child>
+ <object class="GtkCheckButton" id="_ignoreToggle">
+ <property name="label" translatable="yes">Ignore Missing Services</property>
+ <property name="visible">True</property>
+ <property name="can_focus">True</property>
+ <property name="receives_default">False</property>
+ <property name="tooltip_text" translatable="yes">Enable or disable ignoring missing services</property>
+ <property name="halign">start</property>
+ <property name="margin_top">5</property>
+ <property name="margin_bottom">5</property>
+ <property name="draw_indicator">True</property>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="position">0</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">False</property>
+ <property name="fill">True</property>
+ <property name="padding">5</property>
+ <property name="position">4</property>
+ </packing>
+ </child>
+ </object>
+ <packing>
+ <property name="position">2</property>
+ </packing>
+ </child>
+ <child type="tab">
+ <object class="GtkLabel">
+ <property name="visible">True</property>
+ <property name="can_focus">False</property>
+ <property name="halign">end</property>
+ <property name="label" translatable="yes">System</property>
+ </object>
+ <packing>
+ <property name="position">2</property>
+ <property name="tab_fill">False</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+ </child>
+ </object>
+ <packing>
+ <property name="expand">True</property>
+ <property name="fill">True</property>
+ <property name="position">1</property>
+ </packing>
+ </child>
+ </object>
+ </child>
+ </object>
+</interface>
diff --git a/Ryujinx/Ui/assets/DiscordLogo.png b/Ryujinx/Ui/assets/DiscordLogo.png
new file mode 100644
index 00000000..85c46fd8
--- /dev/null
+++ b/Ryujinx/Ui/assets/DiscordLogo.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/GitHubLogo.png b/Ryujinx/Ui/assets/GitHubLogo.png
new file mode 100644
index 00000000..192846a1
--- /dev/null
+++ b/Ryujinx/Ui/assets/GitHubLogo.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/JoyCon.png b/Ryujinx/Ui/assets/JoyCon.png
new file mode 100644
index 00000000..ec8a8f99
--- /dev/null
+++ b/Ryujinx/Ui/assets/JoyCon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/PatreonLogo.png b/Ryujinx/Ui/assets/PatreonLogo.png
new file mode 100644
index 00000000..5b35572a
--- /dev/null
+++ b/Ryujinx/Ui/assets/PatreonLogo.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/TwitterLogo.png b/Ryujinx/Ui/assets/TwitterLogo.png
new file mode 100644
index 00000000..a2030bc6
--- /dev/null
+++ b/Ryujinx/Ui/assets/TwitterLogo.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxIcon.png b/Ryujinx/Ui/assets/ryujinxIcon.png
new file mode 100644
index 00000000..2fc7b017
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxIcon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxNCAIcon.png b/Ryujinx/Ui/assets/ryujinxNCAIcon.png
new file mode 100644
index 00000000..6d73c8c7
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxNCAIcon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxNROIcon.png b/Ryujinx/Ui/assets/ryujinxNROIcon.png
new file mode 100644
index 00000000..bc6b65bf
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxNROIcon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxNSOIcon.png b/Ryujinx/Ui/assets/ryujinxNSOIcon.png
new file mode 100644
index 00000000..8782b3ea
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxNSOIcon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxNSPIcon.png b/Ryujinx/Ui/assets/ryujinxNSPIcon.png
new file mode 100644
index 00000000..d01dc482
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxNSPIcon.png
Binary files differ
diff --git a/Ryujinx/Ui/assets/ryujinxXCIIcon.png b/Ryujinx/Ui/assets/ryujinxXCIIcon.png
new file mode 100644
index 00000000..08f783a8
--- /dev/null
+++ b/Ryujinx/Ui/assets/ryujinxXCIIcon.png
Binary files differ
diff --git a/Ryujinx/_schema.json b/Ryujinx/_schema.json
index c1a64c67..b9546a84 100644
--- a/Ryujinx/_schema.json
+++ b/Ryujinx/_schema.json
@@ -494,6 +494,38 @@
false
]
},
+ "game_dirs": {
+ "$id": "#/properties/game_dirs",
+ "type": "string list",
+ "title": "List of Game Directories",
+ "description": "A list of directories containing games to be used to load games into the games list",
+ "default": []
+ },
+ "gui_columns": {
+ "$id": "#/properties/gui_columns",
+ "type": "bool list",
+ "title": "Used to toggle columns in the GUI",
+ "description": "Used to toggle columns in the GUI",
+ "default": [ true, true, true, true, true, true, true, true, true ]
+ },
+ "enable_custom_theme": {
+ "$id": "#/properties/enable_custom_theme",
+ "type": "boolean",
+ "title": "Enable custom themes in the GUI",
+ "description": "Enable or disable custom themes in the GUI",
+ "default": false,
+ "examples": [
+ true,
+ false
+ ]
+ },
+ "custom_theme_path": {
+ "$id": "#/properties/custom_theme_path",
+ "type": "string",
+ "title": "Path to custom GUI theme",
+ "description": "Path to custom GUI theme",
+ "default": ""
+ },
"controller_type": {
"$id": "#/properties/controller_type",
"type": "string",